# -*- coding: utf-8 -*- ''' *GSASIIplot: plotting routines* =============================== ''' ########### SVN repository information ################### # $Date: 2017-10-24 19:15:48 +0000 (Tue, 24 Oct 2017) $ # $Author: vondreele $ # $Revision: 3138 $ # $URL: trunk/GSASIIplot.py $ # $Id: GSASIIplot.py 3138 2017-10-24 19:15:48Z vondreele $ ########### SVN repository information ################### from __future__ import division, print_function import platform import math import sys import os.path import numpy as np import numpy.ma as ma import numpy.linalg as nl # Don't depend on wx/matplotlib for scriptable try: import wx import wx.aui import wx.glcanvas import matplotlib as mpl import matplotlib.collections as mplC import mpl_toolkits.mplot3d.axes3d as mp3d except ImportError: pass import GSASIIpath Clip_on = GSASIIpath.GetConfigValue('Clip_on',True) GSASIIpath.SetVersionNumber("$Revision: 3138 $") import GSASIIdataGUI as G2gd import GSASIIimage as G2img import GSASIIpwd as G2pwd import GSASIIIO as G2IO import GSASIIpwdGUI as G2pdG import GSASIIimgGUI as G2imG import GSASIIphsGUI as G2phG import GSASIIlattice as G2lat import GSASIIspc as G2spc import GSASIImath as G2mth import GSASIIctrlGUI as G2G import GSASIIobj as G2obj import pytexture as ptx #from OpenGL.GL import * import OpenGL.GL as GL import OpenGL.GLU as GLU import gltext import matplotlib.colors as mpcls from matplotlib.backends.backend_wx import _load_bitmap from matplotlib.backends.backend_wxagg import FigureCanvasWxAgg as Canvas from matplotlib.backends.backend_wxagg import NavigationToolbar2Wx as Toolbar # useful degree trig functions sind = lambda x: math.sin(x*math.pi/180.) cosd = lambda x: math.cos(x*math.pi/180.) tand = lambda x: math.tan(x*math.pi/180.) asind = lambda x: 180.*math.asin(x)/math.pi acosd = lambda x: 180.*math.acos(x)/math.pi atan2d = lambda x,y: 180.*math.atan2(y,x)/math.pi atand = lambda x: 180.*math.atan(x)/math.pi # numpy versions npsind = lambda x: np.sin(x*np.pi/180.) npcosd = lambda x: np.cos(x*np.pi/180.) nptand = lambda x: np.tan(x*np.pi/180.) npacosd = lambda x: 180.*np.arccos(x)/np.pi npasind = lambda x: 180.*np.arcsin(x)/np.pi npatand = lambda x: 180.*np.arctan(x)/np.pi npatan2d = lambda x,y: 180.*np.arctan2(x,y)/np.pi if '2' in platform.python_version_tuple()[0]: GkDelta = unichr(0x0394) Gkrho = unichr(0x03C1) super2 = unichr(0xb2) else: GkDelta = chr(0x0394) Gkrho = chr(0x03C1) super2 = chr(0xb2) nxs = np.newaxis # GSASIIpath.IPyBreak() plotDebug = False #matplotlib 2.0.x dumbed down Paired to 16 colors - # this restores the pre 2.0 Paired color map found in matplotlib._cm.py _Old_Paired_data = {'blue': [(0.0, 0.89019608497619629, 0.89019608497619629), (0.090909090909090912, 0.70588237047195435, 0.70588237047195435), (0.18181818181818182, 0.54117649793624878, 0.54117649793624878), (0.27272727272727271, 0.17254902422428131, 0.17254902422428131), (0.36363636363636365, 0.60000002384185791, 0.60000002384185791), (0.45454545454545453, 0.10980392247438431, 0.10980392247438431), (0.54545454545454541, 0.43529412150382996, 0.43529412150382996), (0.63636363636363635, 0.0, 0.0), (0.72727272727272729, 0.83921569585800171, 0.83921569585800171), (0.81818181818181823, 0.60392159223556519, 0.60392159223556519), (0.90909090909090906, 0.60000002384185791, 0.60000002384185791), (1.0, 0.15686275064945221, 0.15686275064945221)], 'green': [(0.0, 0.80784314870834351, 0.80784314870834351), (0.090909090909090912, 0.47058823704719543, 0.47058823704719543), (0.18181818181818182, 0.87450981140136719, 0.87450981140136719), (0.27272727272727271, 0.62745100259780884, 0.62745100259780884), (0.36363636363636365, 0.60392159223556519, 0.60392159223556519), (0.45454545454545453, 0.10196078568696976, 0.10196078568696976), (0.54545454545454541, 0.74901962280273438, 0.74901962280273438), (0.63636363636363635, 0.49803921580314636, 0.49803921580314636), (0.72727272727272729, 0.69803923368453979, 0.69803923368453979), (0.81818181818181823, 0.23921568691730499, 0.23921568691730499), (0.90909090909090906, 1.0, 1.0), (1.0, 0.3490196168422699, 0.3490196168422699)], 'red': [(0.0, 0.65098041296005249, 0.65098041296005249), (0.090909090909090912, 0.12156862765550613, 0.12156862765550613), (0.18181818181818182, 0.69803923368453979, 0.69803923368453979), (0.27272727272727271, 0.20000000298023224, 0.20000000298023224), (0.36363636363636365, 0.9843137264251709, 0.9843137264251709), (0.45454545454545453, 0.89019608497619629, 0.89019608497619629), (0.54545454545454541, 0.99215686321258545, 0.99215686321258545), (0.63636363636363635, 1.0, 1.0), (0.72727272727272729, 0.7921568751335144, 0.7921568751335144), (0.81818181818181823, 0.41568627953529358, 0.41568627953529358), (0.90909090909090906, 1.0, 1.0), (1.0, 0.69411766529083252, 0.69411766529083252)]} mpl.cm.register_cmap('Paired',data=_Old_Paired_data,lut=256) mpl.cm.register_cmap('Paired_r',data=mpl.cm._reverse_cmap_spec(_Old_Paired_data),lut=256) #This can be done on request for other colors class _tabPlotWin(wx.Panel): 'Creates a basic tabbed plot window for GSAS-II graphics' def __init__(self,parent,id=-1,dpi=None,**kwargs): self.ReplotRoutine = None self.ReplotArgs = [] self.ReplotKwArgs = {} wx.Panel.__init__(self,parent,id=id,**kwargs) class G2PlotMpl(_tabPlotWin): 'Creates a Matplotlib 2-D plot in the GSAS-II graphics window' def __init__(self,parent,id=-1,dpi=None,**kwargs): _tabPlotWin.__init__(self,parent,id=id,**kwargs) mpl.rcParams['legend.fontsize'] = 10 self.figure = mpl.figure.Figure(dpi=dpi,figsize=(5,6)) self.canvas = Canvas(self,-1,self.figure) self.toolbar = GSASIItoolbar(self.canvas) self.toolbar.Realize() sizer=wx.BoxSizer(wx.VERTICAL) sizer.Add(self.canvas,1,wx.EXPAND) sizer.Add(self.toolbar,0,wx.LEFT|wx.EXPAND) self.SetSizer(sizer) def SetToolTipString(self,text): if 'phoenix' in wx.version(): return self.canvas.SetToolTip(wx.ToolTip(text)) else: return self.canvas.SetToolTipString(text) class G2PlotOgl(_tabPlotWin): 'Creates an OpenGL plot in the GSAS-II graphics window' def __init__(self,parent,id=-1,dpi=None,**kwargs): self.figure = _tabPlotWin.__init__(self,parent,id=id,**kwargs) if 'win' in sys.platform: #Windows (& Mac) already double buffered self.canvas = wx.glcanvas.GLCanvas(self,-1,**kwargs) else: #fix from Jim Hester for X systems attribs = (wx.glcanvas.WX_GL_DOUBLEBUFFER,wx.glcanvas.WX_GL_DEPTH_SIZE,24) self.canvas = wx.glcanvas.GLCanvas(self,-1,attribList=attribs,**kwargs) # create GL context i,j= wx.__version__.split('.')[0:2] if int(i)+int(j)/10. > 2.8: self.context = wx.glcanvas.GLContext(self.canvas) self.canvas.SetCurrent(self.context) else: self.context = None self.camera = {} sizer=wx.BoxSizer(wx.VERTICAL) sizer.Add(self.canvas,1,wx.EXPAND) self.SetSizer(sizer) class G2Plot3D(_tabPlotWin): 'Creates a 3D Matplotlib plot in the GSAS-II graphics window' def __init__(self,parent,id=-1,dpi=None,**kwargs): _tabPlotWin.__init__(self,parent,id=id,**kwargs) self.figure = mpl.figure.Figure(dpi=dpi,figsize=(6,6)) self.canvas = Canvas(self,-1,self.figure) self.toolbar = Toolbar(self.canvas) self.toolbar = GSASIItoolbar(self.canvas) self.toolbar.Realize() sizer=wx.BoxSizer(wx.VERTICAL) sizer.Add(self.canvas,1,wx.EXPAND) sizer.Add(self.toolbar,0,wx.LEFT|wx.EXPAND) self.SetSizer(sizer) def SetToolTipString(self,text): if 'phoenix' in wx.version(): self.canvas.SetToolTip(wx.ToolTip(text)) else: self.canvas.SetToolTipString(text) class G2PlotNoteBook(wx.Panel): 'create a tabbed panel to hold a GSAS-II graphics window' def __init__(self,parent,id=-1,G2frame=None): wx.Panel.__init__(self,parent,id=id) #so one can't delete a plot page from tab!! self.nb = wx.aui.AuiNotebook(self, \ style=wx.aui.AUI_NB_DEFAULT_STYLE ^ wx.aui.AUI_NB_CLOSE_ON_ACTIVE_TAB) sizer = wx.BoxSizer() sizer.Add(self.nb,1,wx.EXPAND) self.SetSizer(sizer) self.status = parent.CreateStatusBar() self.status.SetFieldsCount(2) self.status.SetStatusWidths([150,-1]) self.Bind(wx.aui.EVT_AUINOTEBOOK_PAGE_CHANGED, self.OnPageChanged) self.nb.Bind(wx.EVT_KEY_UP,self.OnNotebookKey) self.G2frame = G2frame self.plotList = [] # contains the tab label for each plot self.panelList = [] # contains the panel object for each plot self.skipPageChange = False # set to True when no plot update is needed self.allowZoomReset = True # this indicates plot should be updated not initialized self.lastRaisedPlotTab = None def OnNotebookKey(self,event): '''Called when a keystroke event gets picked up by the notebook window rather the child. This is not expected, but somehow it does sometimes on the Mac and perhaps Linux. Assume that the page associated with the currently displayed tab has a child, .canvas; give that child the focus and pass it the event. ''' try: Page = self.nb.GetPage(self.nb.GetSelection()) except ValueError: # occurs with no plot tabs return try: Page.canvas.SetFocus() wx.PostEvent(Page.canvas,event) except AttributeError: pass def SetNoDelete(self,name): '''Indicate that a plot does not need to be redrawn ''' if name not in self.plotList: print('Error, in SetNoDelete plot not found: '+name) return page = self.panelList[self.plotList.index(name)] page.plotRequiresRedraw = False # plot should not be deleted even if not redrawn def RegisterRedrawRoutine(self,name,routine=None,args=(),kwargs={}): '''Save information to determine how to redraw a plot :param str name: label on tab of plot :param Object routine: a function to be called :param args: a list of positional parameters for the function :param kwargs: a dict with keyword parameters for the function ''' if name not in self.plotList: print('Error, plot not found: '+name) return page = self.panelList[self.plotList.index(name)] page.replotFunction = routine page.replotArgs = args page.replotKWargs = kwargs def GetTabIndex(self,label): '''Look up a tab label and return the index in the notebook (this appears to be independent to the order it is dragged to -- at least in Windows) as well as the associated wx.Panel An exception is raised if the label is not found ''' for i in range(self.nb.GetPageCount()): if label == self.nb.GetPageText(i): return i,self.nb.GetPage(i) else: raise ValueError('Plot not found') def RaiseLastPage(self,lastRaisedPlotTab,treeItemPlot): '''Raises either the Last tab clicked on or what is drawn by the selected tree item This is called after a refinement is completed by :meth:`GSASIIdataGUI.GSASII.ResetPlots` ''' plotNum = None if lastRaisedPlotTab in self.plotList: plotNum = self.plotList.index(lastRaisedPlotTab) elif treeItemPlot in self.plotList: plotNum = self.plotList.index(treeItemPlot) if plotNum is not None: wx.CallAfter(self.SetSelectionNoRefresh,plotNum) def FindPlotTab(self,label,Type,newImage=True): '''Open a plot tab for initial plotting, or raise the tab if it already exists Set a flag (Page.plotInvalid) that it has been redrawn Record the name of the this plot in self.lastRaisedPlotTab ''' limits = None Plot = None try: new = False plotNum,Page = self.GetTabIndex(label) if Type == 'mpl' or Type == '3d': Plot = Page.figure.gca() #get previous plot limits = Plot.get_xlim(),Plot.get_ylim() # save previous limits # print 'Plot limits:',limits if newImage: Page.figure.clf() Plot = Page.figure.gca() #get a fresh plot after clf() self.SetSelectionNoRefresh(plotNum) # raises plot tab except (ValueError,AttributeError): new = True if Type == 'mpl': Plot = self.addMpl(label).gca() elif Type == 'ogl': Plot = self.addOgl(label) elif Type == '3d': Plot = mp3d.Axes3D(self.add3D(label)) plotNum = self.plotList.index(label) Page = self.nb.GetPage(plotNum) Page.plotInvalid = False # plot has just been drawn self.lastRaisedPlotTab = label self.RaisePageNoRefresh(Page) # Save the help name from the DataItem that has created the plot in Tabbed page object # so we can use it in self.OnHelp(). # Are there any cases where plot tabs are created that are not tied to Data Tree entries? # One example is GSASII.SumDialog, where a test plot is created. Are there others? try: Page.helpKey = self.G2frame.dataWindow.helpKey except AttributeError: Page.helpKey = 'Data tree' return new,plotNum,Page,Plot,limits def _addPage(self,name,page): '''Add the newly created page to the notebook and associated lists. :param name: the label placed on the tab, which should be unique :param page: the wx.Frame for the matplotlib, openGL, etc. window ''' self.skipPageChange = True if name in self.plotList: print('Warning: duplicate plot name! Name='+name) self.nb.AddPage(page,name) self.plotList.append(name) # used to lookup plot in self.panelList # Note that order in lists make not agree with actual tab order; use self.nb.GetPageText(i) # where (self=G2plotNB) for latter self.panelList.append(page) # panel object for plot self.lastRaisedPlotTab = name page.plotInvalid = False # plot has just been drawn page.plotRequiresRedraw = True # set to False if plot should be retained even if not refreshed page.replotFunction = None # used to specify a routine to redraw the routine page.replotArgs = [] page.replotKWargs = {} self.skipPageChange = False def addMpl(self,name=""): 'Add a tabbed page with a matplotlib plot' page = G2PlotMpl(self.nb) self._addPage(name,page) return page.figure def add3D(self,name=""): 'Add a tabbed page with a 3D plot' page = G2Plot3D(self.nb) self._addPage(name,page) return page.figure def addOgl(self,name=""): 'Add a tabbed page with an openGL plot' page = G2PlotOgl(self.nb) self._addPage(name,page) self.RaisePageNoRefresh(page) # need to give window focus before GL use return page.figure def Delete(self,name): 'delete a tabbed page' try: item = self.plotList.index(name) del self.plotList[item] del self.panelList[item] self.nb.DeletePage(item) except ValueError: #no plot of this name - do nothing return def clear(self): 'clear all pages from plot window' while self.nb.GetPageCount(): self.nb.DeletePage(0) self.plotList = [] self.panelList = [] self.status.DestroyChildren() #get rid of special stuff on status bar def Rename(self,oldName,newName): 'rename a tab' try: item = self.plotList.index(oldName) self.plotList[item] = newName self.nb.SetPageText(item,newName) except ValueError: #no plot of this name - do nothing return def RaisePageNoRefresh(self,Page): 'Raises a plot tab without triggering a refresh via OnPageChanged' if plotDebug: print ('Raise'+str(self).split('0x')[1]) self.skipPageChange = True Page.SetFocus() self.skipPageChange = False def SetSelectionNoRefresh(self,plotNum): 'Raises a plot tab without triggering a refresh via OnPageChanged' if plotDebug: print ('Select'+str(self).split('0x')[1]) self.skipPageChange = True self.nb.SetSelection(plotNum) # raises plot tab Page = self.G2frame.G2plotNB.nb.GetPage(plotNum) Page.SetFocus() self.skipPageChange = False def OnPageChanged(self,event): '''respond to someone pressing a tab on the plot window. Called when a plot tab is clicked. on some platforms (Mac for sure) this is also called when a plot is created or selected with .SetSelection() or .SetFocus(). The self.skipPageChange is used variable is set to suppress repeated replotting. ''' tabLabel = event.GetEventObject().GetPageText(event.GetSelection()) self.lastRaisedPlotTab = tabLabel if plotDebug: print ('PageChanged, self='+str(self).split('0x')[1]+tabLabel+str(self.skipPageChange)) print ('event type='+event.GetEventType()) self.status.DestroyChildren() #get rid of special stuff on status bar self.status.SetStatusText('') # clear old status message self.status.SetStatusWidths([150,-1]) def InvokeTreeItem(self,pid): '''This is called to select an item from the tree using the self.allowZoomReset flag to prevent a reset to the zoom of the plot (where implemented) ''' self.allowZoomReset = False if pid: self.G2frame.GPXtree.SelectItem(pid) self.allowZoomReset = True if plotDebug: print ('invoke'+str(self).split('0x')[1]+str(pid)) class GSASIItoolbar(Toolbar): 'Override the matplotlib toolbar so we can add more icons' ON_MPL_HELP = wx.NewId() ON_MPL_KEY = wx.NewId() arrows = {} for direc in ('left','right','up','down','Expand X', 'Shrink X','Expand Y','Shrink Y'): arrows[direc] = wx.NewId() def __init__(self,plotCanvas): '''Adds additional icons to toolbar''' Toolbar.__init__(self,plotCanvas) G2path = os.path.split(os.path.abspath(__file__))[0] self.plotCanvas = plotCanvas POSITION_OF_CONFIGURE_SUBPLOTS_BTN = 6 # remove one button, nos. start at 1! self.DeleteToolByPos(POSITION_OF_CONFIGURE_SUBPLOTS_BTN) #doesn't work in miniconda self.parent = self.GetParent() key = os.path.join(G2path,'key.ico') if 'phoenix' in wx.version(): button = self.AddTool(self.ON_MPL_KEY,'Key press',_load_bitmap(key),'Select key press') else: button = self.AddSimpleTool(self.ON_MPL_KEY,_load_bitmap(key),'Key press','Select key press') wx.EVT_TOOL.Bind(self,self.ON_MPL_KEY,button.GetId(),self.OnKey) help = os.path.join(G2path,'help.ico') if 'phoenix' in wx.version(): button = self.AddTool(self.ON_MPL_HELP,'Help on',_load_bitmap(help),'Show help on') else: button = self.AddSimpleTool(self.ON_MPL_HELP,_load_bitmap(help),'Help on','Show help on') wx.EVT_TOOL.Bind(self,self.ON_MPL_HELP,button.GetId(),self.OnHelp) # add arrow keys to control zooming for direc in ('left','right','up','down'): icon = os.path.join(G2path,direc[0]+'arrow.ico') if 'phoenix' in wx.version(): button = self.AddTool(self.arrows[direc],'Shift '+direc,_load_bitmap(icon),'Shift plot '+direc) else: button = self.AddSimpleTool(self.arrows[direc],_load_bitmap(icon),'Shift '+direc,'Shift plot '+direc) wx.EVT_TOOL.Bind(self,self.arrows[direc],button.GetId(),self.OnArrow) for direc in ('Expand X','Shrink X','Expand Y','Shrink Y'): fil = ''.join([i[0].lower() for i in direc.split()]+['arrow.ico']) icon = os.path.join(G2path,fil) if 'phoenix' in wx.version(): button = self.AddTool(self.arrows[direc],direc,_load_bitmap(icon),'Zoom: '+direc) else: button = self.AddSimpleTool(self.arrows[direc],_load_bitmap(icon),direc,'Zoom: '+direc) wx.EVT_TOOL.Bind(self,self.arrows[direc],button.GetId(),self.OnArrow) def OnArrow(self,event): 'reposition limits to scan or zoom by button press' ax = self.plotCanvas.figure.get_axes()[0] xmin,xmax,ymin,ymax = ax.axis() #print xmin,xmax,ymin,ymax if event.Id == self.arrows['right']: delta = (xmax-xmin)/10. xmin -= delta xmax -= delta elif event.Id == self.arrows['left']: delta = (xmax-xmin)/10. xmin += delta xmax += delta elif event.Id == self.arrows['up']: delta = (ymax-ymin)/10. ymin -= delta ymax -= delta elif event.Id == self.arrows['down']: delta = (ymax-ymin)/10. ymin += delta ymax += delta elif event.Id == self.arrows['Expand X']: delta = (xmax-xmin)/10. xmin += delta xmax -= delta elif event.Id == self.arrows['Expand Y']: delta = (ymax-ymin)/10. ymin += delta ymax -= delta elif event.Id == self.arrows['Shrink X']: delta = (xmax-xmin)/10. xmin -= delta xmax += delta elif event.Id == self.arrows['Shrink Y']: delta = (ymax-ymin)/10. ymin -= delta ymax += delta else: # should not happen! GSASIIpath.IPyBreak() self.parent.toolbar.push_current() ax.axis((xmin,xmax,ymin,ymax)) #print xmin,xmax,ymin,ymax self.plotCanvas.figure.canvas.draw() self.parent.toolbar.draw() # self.parent.toolbar.push_current() def OnHelp(self,event): 'Respond to press of help button on plot toolbar' bookmark = self.Parent.helpKey # get help category used to create plot #if GSASIIpath.GetConfigValue('debug'): print 'plot help: key=',bookmark G2G.ShowHelp(bookmark,self.TopLevelParent) def OnKey(self,event): '''Provide user with list of keystrokes defined for plot as well as an alternate way to access the same functionality ''' parent = self.GetParent() if parent.Choice: dlg = wx.SingleChoiceDialog(parent,'Select','Key press',list(parent.Choice)) if dlg.ShowModal() == wx.ID_OK: sel = dlg.GetSelection() event.key = parent.Choice[sel][0] parent.keyPress(event) dlg.Destroy() ################################################################################ ##### PlotSngl ################################################################################ def PlotSngl(G2frame,newPlot=False,Data=None,hklRef=None,Title=''): '''Structure factor plotting package - displays zone of reflections as rings proportional to F, F**2, etc. as requested ''' from matplotlib.patches import Circle global HKL,HKLF,HKLref HKLref = hklRef def OnSCKeyPress(event): i = zones.index(Data['Zone']) newPlot = False pwdrChoice = {'f':'Fo','s':'Fosq','u':'Unit Fc'} hklfChoice = {'1':'|DFsq|>sig','3':'|DFsq|>3sig','w':'|DFsq|/sig','f':'Fo','s':'Fosq','i':'Unit Fc'} if event.key == 'h': Data['Zone'] = '100' newPlot = True elif event.key == 'k': Data['Zone'] = '010' newPlot = True elif event.key == 'l': Data['Zone'] = '001' newPlot = True elif event.key == 'i': Data['Scale'] *= 1.1 elif event.key == 'd': Data['Scale'] /= 1.1 elif event.key in ['+','=']: Data['Layer'] = min(Data['Layer']+1,HKLmax[i]) elif event.key == '-': Data['Layer'] = max(Data['Layer']-1,HKLmin[i]) elif event.key == '0': Data['Layer'] = 0 Data['Scale'] = 1.0 elif event.key in hklfChoice and 'HKLF' in Name: Data['Type'] = hklfChoice[event.key] newPlot = True elif event.key in pwdrChoice and 'PWDR' in Name: Data['Type'] = pwdrChoice[event.key] newPlot = True PlotSngl(G2frame,newPlot,Data,HKLref,Title) def OnSCMotion(event): xpos = event.xdata if xpos: xpos = round(xpos) #avoid out of frame mouse position ypos = round(event.ydata) zpos = Data['Layer'] if '100' in Data['Zone']: HKLtxt = '(%d,%d,%d)'%(zpos,xpos,ypos) elif '010' in Data['Zone']: HKLtxt = '(%d,%d,%d)'%(xpos,zpos,ypos) elif '001' in Data['Zone']: HKLtxt = '(%d,%d,%d)'%(xpos,ypos,zpos) Page.SetToolTipString(HKLtxt) G2frame.G2plotNB.status.SetStatusText('HKL = '+HKLtxt,0) def OnSCPress(event): zpos = Data['Layer'] xpos = event.xdata if xpos: pos = int(round(event.xdata)),int(round(event.ydata)) if '100' in Data['Zone']: hkl = np.array([zpos,pos[0],pos[1]]) elif '010' in Data['Zone']: hkl = np.array([pos[0],zpos,pos[1]]) elif '001' in Data['Zone']: hkl = np.array([pos[0],pos[1],zpos]) h,k,l = hkl hklf = HKLF[np.where(np.all(HKL-hkl == [0,0,0],axis=1))] if len(hklf): Fosq,sig,Fcsq = hklf[0] HKLtxt = '( %.2f %.3f %.2f %.2f)'%(Fosq,sig,Fcsq,(Fosq-Fcsq)/(scale*sig)) G2frame.G2plotNB.status.SetStatusText('Fosq, sig, Fcsq, delFsq/sig = '+HKLtxt,1) def OnPick(event): pick = event.artist HKLtext = pick.get_gid() Page.SetToolTipString(HKLtext) G2frame.G2plotNB.status.SetStatusText('H = '+HKLtext,0) Name = G2frame.GPXtree.GetItemText(G2frame.PatternId) if not Title: Title = Name new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('Structure Factors','mpl') if not new: if not newPlot: xylim = lim else: Page.canvas.mpl_connect('button_press_event', OnSCPress) Page.canvas.mpl_connect('motion_notify_event', OnSCMotion) Page.canvas.mpl_connect('pick_event', OnPick) Page.canvas.mpl_connect('key_press_event', OnSCKeyPress) Page.keyPress = OnSCKeyPress Page.Choice = (' key press','i: increase scale','d: decrease scale', 'h: select 100 zone','k: select 010 zone','l: select 001 zone', 'f: select Fo','s: select Fosq','u: select unit Fc', '+: increase index','-: decrease index','0: zero layer',) if 'HKLF' in Name: Page.Choice += ('w: select |DFsq|/sig','1: select |DFsq|>sig','3: select |DFsq|>3sig',) Plot.set_aspect(aspect='equal') Type = Data['Type'] scale = Data['Scale'] HKLmax = Data['HKLmax'] HKLmin = Data['HKLmin'] FosqMax = Data['FoMax'] Super = Data['Super'] SuperVec = [] if Super: SuperVec = np.array(Data['SuperVec'][0]) FoMax = math.sqrt(FosqMax) xlabel = ['k, h=','h, k=','h, l='] ylabel = ['l','l','k'] zones = ['100','010','001'] pzone = [[1,2],[0,2],[0,1]] izone = zones.index(Data['Zone']) Plot.set_title(Data['Type']+' for '+Title) HKL = [] HKLF = [] sumFo = 0. sumDF = 0. # GSASIIpath.IPyBreak() for refl in HKLref: H = refl[:3] if 'HKLF' in Name: Fosq,sig,Fcsq = refl[5+Super:8+Super] else: Fosq,sig,Fcsq = refl[8+Super],1.0,refl[9+Super] if Super: HKL.append(H+SuperVec*refl[3]) else: HKL.append(H) HKLF.append([Fosq,sig,Fcsq]) if H[izone] == Data['Layer']: A = 0 B = 0 if Type == 'Fosq': A = scale*Fosq/FosqMax sumFo += A B = scale*Fcsq/FosqMax C = abs(A-B) sumDF += C elif Type == 'Fo': A = scale*math.sqrt(max(0,Fosq))/FoMax sumFo += A B = scale*math.sqrt(max(0,Fcsq))/FoMax C = abs(A-B) sumDF += C elif Type == 'Unit Fc': A = scale/2 B = scale/2 C = 0.0 if Fcsq and Fosq > 0: A *= min(1.0,Fosq/Fcsq) C = abs(A-B) elif Type == '|DFsq|/sig': if sig > 0.: A = scale*(Fosq-Fcsq)/(3*sig) B = 0 elif Type == '|DFsq|>sig': if sig > 0.: A = scale*(Fosq-Fcsq)/(3*sig) if abs(A) < 1.0: A = 0 B = 0 elif Type == '|DFsq|>3sig': if sig > 0.: A = scale*(Fosq-Fcsq)/(3*sig) if abs(A) < 3.0: A = 0 B = 0 if Super: h = H+SuperVec*refl[3] if refl[3]: hid = '(%d,%d,%d,%d)'%(refl[0],refl[1],refl[2],refl[3]) else: hid = '(%d,%d,%d)'%(refl[0],refl[1],refl[2]) else: h = H hid = '(%d,%d,%d)'%(refl[0],refl[1],refl[2]) xy = (h[pzone[izone][0]],h[pzone[izone][1]]) if Type in ['|DFsq|/sig','|DFsq|>sig','|DFsq|>3sig']: if A > 0.0: Plot.add_artist(Circle(xy,radius=A,ec='g',fc='w',picker=1.,gid=hid)) else: Plot.add_artist(Circle(xy,radius=-A,ec='r',fc='w',picker=1.,gid=hid)) else: if A > 0.0 and A > B: Plot.add_artist(Circle(xy,radius=A,ec='g',fc='w')) if B: Plot.add_artist(Circle(xy,radius=B,ec='b',fc='w',picker=1.,gid=hid)) if A < B: Plot.add_artist(Circle(xy,radius=A,ec='g',fc='w')) radius = C if radius > 0: if A > B: Plot.add_artist(Circle(xy,radius=radius,ec='g',fc='g')) else: Plot.add_artist(Circle(xy,radius=radius,ec='r',fc='r')) # print 'plot time: %.3f'%(time.time()-time0) HKL = np.array(HKL) HKLF = np.array(HKLF) Plot.set_xlabel(xlabel[izone]+str(Data['Layer']),fontsize=12) Plot.set_ylabel(ylabel[izone],fontsize=12) if sumFo and sumDF: G2frame.G2plotNB.status.SetStatusText(xlabel[izone].split(',')[1]+str(Data['Layer'])+ \ ' layer R = %6.2f%s'%(100.*sumDF/sumFo,'%'),1) else: G2frame.G2plotNB.status.SetStatusText('Use K-box to set plot controls',1) if not newPlot: Page.toolbar.push_current() Plot.set_xlim(xylim[0]) Plot.set_ylim(xylim[1]) # xylim = [] Page.toolbar.push_current() Page.toolbar.draw() else: Plot.set_xlim((HKLmin[pzone[izone][0]],HKLmax[pzone[izone][0]])) Plot.set_ylim((HKLmin[pzone[izone][1]],HKLmax[pzone[izone][1]])) Page.canvas.draw() ################################################################################ ##### Plot3DSngl ################################################################################ def Plot3DSngl(G2frame,newPlot=False,Data=None,hklRef=None,Title=False): '''3D Structure factor plotting package - displays reflections as rings proportional to F, F**2, etc. as requested as 3D array ''' global ifBox ifBox = False def OnKeyBox(event): mode = cb.GetValue() if mode in ['jpeg','bmp','tiff',]: try: import Image as Im except ImportError: try: from PIL import Image as Im except ImportError: print ("PIL/pillow Image module not present. Cannot save images without this") raise Exception("PIL/pillow Image module not found") try: Fname = os.path.join(Mydir,generalData['Name']+'.'+mode) except NameError: #for when generalData doesn't exist! Fname = (os.path.join(Mydir,'unknown'+'.'+mode)).replace('*','+') print (Fname+' saved') size = Page.canvas.GetSize() GL.glPixelStorei(GL.GL_UNPACK_ALIGNMENT, 1) if mode in ['jpeg',]: Pix = GL.glReadPixels(0,0,size[0],size[1],GL.GL_RGBA,GL.GL_UNSIGNED_BYTE) im = Im.new("RGBA", (size[0],size[1])) else: Pix = GL.glReadPixels(0,0,size[0],size[1],GL.GL_RGB,GL.GL_UNSIGNED_BYTE) im = Im.new("RGB", (size[0],size[1])) try: im.frombytes(Pix) except AttributeError: im.fromstring(Pix) im = im.transpose(Im.FLIP_TOP_BOTTOM) im.save(Fname,mode) cb.SetValue(' save as/key:') G2frame.G2plotNB.status.SetStatusText('Drawing saved to: '+Fname,1) else: event.key = cb.GetValue()[0] cb.SetValue(' save as/key:') wx.CallAfter(OnKey,event) Page.canvas.SetFocus() # redirect the Focus from the button back to the plot def OnKey(event): #on key UP!! global ifBox Choice = {'F':'Fo','S':'Fosq','U':'Unit','D':'dFsq','W':'dFsq/sig'} viewChoice = {'L':np.array([[0,0,1],[1,0,0],[0,1,0]]),'K':np.array([[0,1,0],[0,0,1],[1,0,0]]),'H':np.array([[1,0,0],[0,0,1],[0,1,0]])} try: keyCode = event.GetKeyCode() if keyCode > 255: keyCode = 0 key = chr(keyCode) except AttributeError: #if from OnKeyBox above key = str(event.key).upper() if key in ['C','H','K','L']: if key == 'C': Data['Zone'] = False key = 'L' Data['viewKey'] = key drawingData['viewPoint'][0] = np.array(drawingData['default']) drawingData['viewDir'] = viewChoice[key][0] drawingData['viewUp'] = viewChoice[key][1] drawingData['oldxy'] = [] if Data['Zone']: if key == 'L': Q = [-1,0,0,0] else: V0 = viewChoice[key][0] V1 = viewChoice[key][1] V0 = np.inner(Amat,V0) V1 = np.inner(Amat,V1) V0 /= nl.norm(V0) V1 /= nl.norm(V1) A = np.arccos(np.sum(V1*V0)) Q = G2mth.AV2Q(-A,viewChoice[key][2]) G2frame.G2plotNB.status.SetStatusText('zone = %s'%(str(list(viewChoice[key][0]))),1) else: V0 = viewChoice[key][0] V = np.inner(Bmat,V0) V /= np.sqrt(np.sum(V**2)) V *= np.array([0,0,1]) A = np.arccos(np.sum(V*V0)) Q = G2mth.AV2Q(-A,viewChoice[key][2]) drawingData['Quaternion'] = Q elif key in 'O': drawingData['viewPoint'][0] = [0,0,0] elif key in 'Z': Data['Zone'] = not Data['Zone'] elif key in 'B': ifBox = not ifBox elif key in ['+','=']: Data['Scale'] *= 1.25 elif key == '-': Data['Scale'] /= 1.25 elif key == 'P': vec = viewChoice[Data['viewKey']][0] drawingData['viewPoint'][0] -= vec elif key == 'N': vec = viewChoice[Data['viewKey']][0] drawingData['viewPoint'][0] += vec elif key == '0': drawingData['viewPoint'][0] = np.array([0,0,0]) Data['Scale'] = 1.0 elif key == 'I': Data['Iscale'] = not Data['Iscale'] elif key in Choice: Data['Type'] = Choice[key] Draw('key') Name = G2frame.GPXtree.GetItemText(G2frame.PatternId) if Title and Title in G2frame.GetPhaseData(): #NB: save image as e.g. jpeg will fail if False; MyDir is unknown generalData = G2frame.GetPhaseData()[Title]['General'] cell = generalData['Cell'][1:7] Mydir = generalData['Mydir'] else: Title = 'Unknown' cell = [10,10,10,90,90,90] Mydir = G2frame.dirname drawingData = Data['Drawing'] Super = Data['Super'] SuperVec = [] if Super: SuperVec = np.array(Data['SuperVec'][0]) Amat,Bmat = G2lat.cell2AB(cell) #Amat - crystal to cartesian, Bmat - inverse Gmat,gmat = G2lat.cell2Gmat(cell) B4mat = np.concatenate((np.concatenate((Bmat,[[0],[0],[0]]),axis=1),[[0,0,0,1],]),axis=0) drawingData['Quaternion'] = G2mth.AV2Q(2*np.pi,np.inner(Bmat,[0,0,1])) Wt = np.array([255,255,255]) Rd = np.array([255,0,0]) Gr = np.array([0,255,0]) Bl = np.array([0,0,255]) uBox = np.array([[0,0,0],[1,0,0],[1,1,0],[0,1,0],[0,0,1],[1,0,1],[1,1,1],[0,1,1]]) uEdges = np.array([ [uBox[0],uBox[1]],[uBox[0],uBox[3]],[uBox[0],uBox[4]],[uBox[1],uBox[2]], [uBox[2],uBox[3]],[uBox[1],uBox[5]],[uBox[2],uBox[6]],[uBox[3],uBox[7]], [uBox[4],uBox[5]],[uBox[5],uBox[6]],[uBox[6],uBox[7]],[uBox[7],uBox[4]]]) uColors = [Rd,Gr,Bl, Wt,Wt,Wt, Wt,Wt,Wt, Wt,Wt,Wt] def FillHKLRC(): sumFo2 = 0. sumDF2 = 0. sumFo = 0. sumDF = 0. R = np.zeros(len(hklRef)) C = [] HKL = [] for i,refl in enumerate(hklRef): H = refl[:3] if 'HKLF' in Name: Fosq,sig,Fcsq = refl[5+Super:8+Super] if refl[3+Super] < 0: Fosq,sig,Fcsq = [0,1,0] else: Fosq,sig,Fcsq = refl[8+Super],1.0,refl[9+Super] sumFo2 += Fosq sumDF2 += abs(Fosq-Fcsq) if Fosq > 0.: sumFo += np.sqrt(Fosq) sumDF += abs(np.sqrt(Fosq)-np.sqrt(Fcsq)) if Super: HKL.append(H+SuperVec*refl[3]) else: HKL.append(H) if Data['Type'] == 'Unit': R[i] = 0.1 C.append(Gr) elif Data['Type'] == 'Fosq': if Fosq > 0: R[i] = Fosq C.append(Gr) else: R[i] = -Fosq C.append(Rd) elif Data['Type'] == 'Fo': if Fosq > 0: R[i] = np.sqrt(Fosq) C.append(Gr) else: R[i] = np.sqrt(-Fosq) C.append(Rd) elif Data['Type'] == 'dFsq/sig': dFsig = (Fosq-Fcsq)/sig if dFsig > 0: R[i] = dFsig C.append(Gr) else: R[i] = -dFsig C.append(Rd) elif Data['Type'] == 'dFsq': dF = Fosq-Fcsq if dF > 0: R[i] = dF C.append(Gr) else: R[i] = -dF C.append(Rd) R /= np.max(R) R *= Data['Scale'] R = np.where(R<1.e-5,1.e-5,R) if Data['Iscale']: R = np.where(R<=1.,R,1.) C = np.array(C) C = (C.T*R).T R = np.ones_like(R)*0.05 RF = 100. RF2 = 100. if sumFo and sumDF: RF = 100.*sumDF/sumFo RF2 = 100.*sumDF2/sumFo2 return HKL,zip(list(R),C),RF,RF2 def GetTruePosition(xy): View = GL.glGetIntegerv(GL.GL_VIEWPORT) Proj = GL.glGetDoublev(GL.GL_PROJECTION_MATRIX) Model = GL.glGetDoublev(GL.GL_MODELVIEW_MATRIX) Zmax = 1. xy = [int(xy[0]),int(View[3]-xy[1])] for i,ref in enumerate(hklRef): h,k,l = ref[:3] try: X,Y,Z = GLU.gluProject(h,k,l,Model,Proj,View) XY = [int(X),int(Y)] if np.allclose(xy,XY,atol=10) and Z < Zmax: Zmax = Z return [int(h),int(k),int(l)] except ValueError: return [int(h),int(k),int(l)] def SetTranslation(newxy): #first get translation vector in screen coords. oldxy = drawingData['oldxy'] if not len(oldxy): oldxy = list(newxy) dxy = newxy-oldxy drawingData['oldxy'] = list(newxy) V = np.array([-dxy[0],dxy[1],0.]) #then transform to rotated crystal coordinates & apply to view point Q = drawingData['Quaternion'] V = np.inner(Bmat,G2mth.prodQVQ(G2mth.invQ(Q),V)) Tx,Ty,Tz = drawingData['viewPoint'][0] Tx += V[0]*0.1 Ty += V[1]*0.1 Tz += V[2]*0.1 drawingData['viewPoint'][0] = np.array([Tx,Ty,Tz]) def SetRotation(newxy): 'Perform a rotation in x-y space due to a left-mouse drag' #first get rotation vector in screen coords. & angle increment oldxy = drawingData['oldxy'] if not len(oldxy): oldxy = list(newxy) dxy = newxy-oldxy drawingData['oldxy'] = list(newxy) V = np.array([dxy[1],dxy[0],0.]) A = 0.25*np.sqrt(dxy[0]**2+dxy[1]**2) if not A: return # nothing changed, nothing to do # next transform vector back to xtal coordinates via inverse quaternion # & make new quaternion Q = drawingData['Quaternion'] V = G2mth.prodQVQ(G2mth.invQ(Q),np.inner(Bmat,V)) DQ = G2mth.AVdeg2Q(A,V) Q = G2mth.prodQQ(Q,DQ) drawingData['Quaternion'] = Q # finally get new view vector - last row of rotation matrix VD = np.inner(Bmat,G2mth.Q2Mat(Q)[2]) VD /= np.sqrt(np.sum(VD**2)) drawingData['viewDir'] = VD def SetRotationZ(newxy): #first get rotation vector (= view vector) in screen coords. & angle increment View = GL.glGetIntegerv(GL.GL_VIEWPORT) cent = [View[2]/2,View[3]/2] oldxy = drawingData['oldxy'] if not len(oldxy): oldxy = list(newxy) dxy = newxy-oldxy drawingData['oldxy'] = list(newxy) V = drawingData['viewDir'] A = [0,0] A[0] = dxy[1]*.25 A[1] = dxy[0]*.25 if newxy[0] > cent[0]: A[0] *= -1 if newxy[1] < cent[1]: A[1] *= -1 # next transform vector back to xtal coordinates & make new quaternion Q = drawingData['Quaternion'] V = np.inner(Amat,V) Qx = G2mth.AVdeg2Q(A[0],V) Qy = G2mth.AVdeg2Q(A[1],V) Q = G2mth.prodQQ(Q,Qx) Q = G2mth.prodQQ(Q,Qy) drawingData['Quaternion'] = Q def OnMouseDown(event): xy = event.GetPosition() drawingData['oldxy'] = list(xy) def OnMouseMove(event): if event.ShiftDown(): #don't want any inadvertant moves when picking return newxy = event.GetPosition() if event.Dragging(): if event.LeftIsDown(): SetRotation(newxy) elif event.RightIsDown(): SetTranslation(newxy) Tx,Ty,Tz = drawingData['viewPoint'][0] elif event.MiddleIsDown(): SetRotationZ(newxy) Draw('move') else: hkl = GetTruePosition(newxy) if hkl: h,k,l = hkl Page.SetToolTipString('%d,%d,%d'%(h,k,l)) G2frame.G2plotNB.status.SetStatusText('hkl = %d,%d,%d'%(h,k,l),1) def OnMouseWheel(event): if event.ShiftDown(): return drawingData['cameraPos'] += event.GetWheelRotation()/120. drawingData['cameraPos'] = max(0.1,min(20.00,drawingData['cameraPos'])) Draw('wheel') def SetBackground(): R,G,B,A = Page.camera['backColor'] GL.glClearColor(R,G,B,A) GL.glClear(GL.GL_COLOR_BUFFER_BIT | GL.GL_DEPTH_BUFFER_BIT) def SetLights(): GL.glEnable(GL.GL_DEPTH_TEST) # GL.glShadeModel(GL.GL_SMOOTH) GL.glEnable(GL.GL_LIGHTING) GL.glEnable(GL.GL_LIGHT0) GL.glLightModeli(GL.GL_LIGHT_MODEL_TWO_SIDE,0) GL.glLightfv(GL.GL_LIGHT0,GL.GL_AMBIENT,[1,1,1,1]) GL.glLightfv(GL.GL_LIGHT0,GL.GL_DIFFUSE,[1,1,1,1]) def RenderBox(x,y,z): GL.glEnable(GL.GL_COLOR_MATERIAL) GL.glLineWidth(1) GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glColor4ubv([0,0,0,0]) GL.glBegin(GL.GL_LINES) for line,color in zip(uEdges,uColors): GL.glColor3ubv(color) GL.glVertex3fv(line[0]) GL.glVertex3fv(line[1]) GL.glEnd() GL.glPopMatrix() GL.glColor4ubv([0,0,0,0]) GL.glDisable(GL.GL_COLOR_MATERIAL) def RenderUnitVectors(x,y,z,labxyz=['','','']): GL.glEnable(GL.GL_COLOR_MATERIAL) GL.glLineWidth(1) GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glBegin(GL.GL_LINES) for line,color in list(zip(uEdges,uColors))[:3]: GL.glColor3ubv(color) GL.glVertex3fv([0,0,0]) # GL.glVertex3fv(-line[1]) GL.glVertex3fv(line[1]) GL.glEnd() GL.glRotate(180,1,0,0) #fix to flip about x-axis for ix,txt in enumerate(labxyz): if txt: pos = uEdges[ix][1] GL.glTranslate(pos[0],-1.5*pos[1],-pos[2]) text = gltext.TextElement(text=txt,font=Font) text.draw_text(scale=0.05) GL.glTranslate(-pos[0],1.5*pos[1],pos[2]) GL.glPopMatrix() GL.glColor4ubv([0,0,0,0]) GL.glDisable(GL.GL_COLOR_MATERIAL) def RenderDots(XYZ,RC): GL.glEnable(GL.GL_COLOR_MATERIAL) XYZ = np.array(XYZ) GL.glPushMatrix() for xyz,rc in zip(XYZ,RC): x,y,z = xyz r,c = rc GL.glColor3ubv(c) GL.glPointSize(r*50) GL.glBegin(GL.GL_POINTS) GL.glVertex3fv(xyz) GL.glEnd() GL.glPopMatrix() GL.glColor4ubv([0,0,0,0]) GL.glDisable(GL.GL_COLOR_MATERIAL) def Draw(caller=''): #useful debug? # if caller: # print caller # end of useful debug VS = np.array(Page.canvas.GetSize()) aspect = float(VS[0])/float(VS[1]) cPos = drawingData['cameraPos'] Zclip = drawingData['Zclip']*cPos/20. if Data['Zone']: Zclip = 0.01 Q = drawingData['Quaternion'] Tx,Ty,Tz = drawingData['viewPoint'][0][:3] G,g = G2lat.cell2Gmat(cell) GS = G GS[0][1] = GS[1][0] = math.sqrt(GS[0][0]*GS[1][1]) GS[0][2] = GS[2][0] = math.sqrt(GS[0][0]*GS[2][2]) GS[1][2] = GS[2][1] = math.sqrt(GS[1][1]*GS[2][2]) HKL,RC,RF,RF2 = FillHKLRC() G2frame.G2plotNB.status.SetStatusText \ ('Plot type = %s for %s; RF = %6.2f%%, RF%s = %6.2f%%'%(Data['Type'],Name,RF,super2,RF2),1) SetBackground() GL.glInitNames() GL.glPushName(0) GL.glMatrixMode(GL.GL_PROJECTION) GL.glLoadIdentity() GL.glViewport(0,0,VS[0],VS[1]) GLU.gluPerspective(20.,aspect,cPos-Zclip,cPos+Zclip) GLU.gluLookAt(0,0,cPos,0,0,0,0,1,0) SetLights() GL.glMatrixMode(GL.GL_MODELVIEW) GL.glLoadIdentity() matRot = G2mth.Q2Mat(Q) matRot = np.concatenate((np.concatenate((matRot,[[0],[0],[0]]),axis=1),[[0,0,0,1],]),axis=0) GL.glMultMatrixf(matRot.T) GL.glMultMatrixf(B4mat) GL.glTranslate(-Tx,-Ty,-Tz) x,y,z = drawingData['viewPoint'][0] if ifBox: RenderBox(x,y,z) else: RenderUnitVectors(x,y,z) RenderUnitVectors(0,0,0,labxyz=['h','k','l']) RenderDots(HKL,RC) try: if Page.context: Page.canvas.SetCurrent(Page.context) except: pass Page.canvas.SwapBuffers() # PlotStructure execution starts here (N.B. initialization above) new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('3D Structure Factors','ogl') if new: Page.views = False Font = Page.GetFont() Page.Choice = None choice = [' save as/key:','jpeg','tiff','bmp','h: view down h','k: view down k','l: view down l', 'z: zero zone toggle','c: reset to default','o: set view point = 0,0,0','b: toggle box ','+: increase scale','-: decrease scale', 'f: Fobs','s: Fobs**2','u: unit','d: Fo-Fc','w: DF/sig','i: toggle intensity scaling'] cb = wx.ComboBox(G2frame.G2plotNB.status,style=wx.CB_DROPDOWN|wx.CB_READONLY,choices=choice) cb.Bind(wx.EVT_COMBOBOX, OnKeyBox) cb.SetValue(' save as/key:') Page.canvas.Bind(wx.EVT_MOUSEWHEEL, OnMouseWheel) Page.canvas.Bind(wx.EVT_LEFT_DOWN, OnMouseDown) Page.canvas.Bind(wx.EVT_RIGHT_DOWN, OnMouseDown) Page.canvas.Bind(wx.EVT_MIDDLE_DOWN, OnMouseDown) Page.canvas.Bind(wx.EVT_KEY_UP, OnKey) Page.canvas.Bind(wx.EVT_MOTION, OnMouseMove) # Page.canvas.Bind(wx.EVT_SIZE, OnSize) Page.camera['position'] = drawingData['cameraPos'] Page.camera['viewPoint'] = np.inner(Amat,drawingData['viewPoint'][0]) Page.camera['backColor'] = np.array(list(drawingData['backColor'])+[0,])/255. Page.controls = Data try: Page.canvas.SetCurrent() except: pass Draw('main') # if firstCall: Draw('main') # draw twice the first time that graphics are displayed ################################################################################ ##### PlotPatterns ################################################################################ def SequentialPlotPattern(G2frame,refdata,histogram): '''This is passed into :func:`GSASIIstrMain.SeqRefine` where it is used to provide a plot of the current powder histogram just after a refinement. It takes the old refinement information (Rfactors, curve locations, etc.) and combines it with the refinement results in refdata and passes that to :func:`PlotPatterns` ''' if not histogram.startswith('PWDR'): return pickId = G2frame.PickId G2frame.PickId = G2frame.PatternId = G2gd.GetGPXtreeItemId(G2frame, G2frame.root, histogram) treedata = G2frame.GPXtree.GetItemPyData(G2frame.PatternId) PlotPatterns(G2frame,newPlot=True,plotType='PWDR',data=[treedata[0],refdata]) wx.Yield() # force a plot update (needed on Windows?) G2frame.PickId = pickId def ReplotPattern(G2frame,newPlot,plotType,PatternName=None,PickName=None): '''This does the same as PlotPatterns except that it expects the information to be plotted (pattern name, item picked in tree + eventually the reflection list) to be passed as names rather than references to wx tree items, defined as class entries ''' if PatternName: G2frame.PatternId = G2gd.GetGPXtreeItemId(G2frame, G2frame.root, PatternName) if PickName == PatternName: G2frame.PickId = G2frame.PatternId elif PickName: G2frame.PickId = G2gd.GetGPXtreeItemId(G2frame, G2frame.PatternId, PickName) # for now I am not sure how to regenerate G2frame.HKL G2frame.HKL = [] # TODO PlotPatterns(G2frame,newPlot,plotType) def PlotPatterns(G2frame,newPlot=False,plotType='PWDR',data=None): '''Powder pattern plotting package - displays single or multiple powder patterns as intensity vs 2-theta, q or TOF. Can display multiple patterns as "waterfall plots" or contour plots. Log I plotting available. Note that plotting information will be found in: G2frame.PatternId (contains the tree item for the current histogram) G2frame.PickId (contains the actual selected tree item (can be child of histogram) G2frame.HKL (used for tool tip display of hkl for selected phase reflection list) ''' global exclLines global DifLine # BHT: probably does not need to be global global Ymax global Pattern,mcolors plottype = plotType if not G2frame.PatternId: return if 'PKS' in plottype: PlotPowderLines(G2frame) return #patch if data is None: data = G2frame.GPXtree.GetItemPyData(G2frame.PatternId) if 'Offset' not in data[0] and plotType in ['PWDR','SASD','REFD']: #plot offset data Ymax = max(data[1][1]) data[0].update({'Offset':[0.0,0.0],'delOffset':0.02*Ymax,'refOffset':-0.1*Ymax, 'refDelt':0.1*Ymax,}) G2frame.GPXtree.SetItemPyData(G2frame.PickId,data) #end patch def OnPlotKeyPress(event): try: #one way to check if key stroke will work on plot Parms,Parms2 = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId, 'Instrument Parameters')) except TypeError: G2frame.G2plotNB.status.SetStatusText('Select '+plottype+' pattern first',1) return newPlot = False if event.key == 'w': G2frame.Weight = not G2frame.Weight if not G2frame.Weight and 'PWDR' in plottype: G2frame.SinglePlot = True newPlot = True elif event.key == 'e' and plottype in ['SASD','REFD']: G2frame.ErrorBars = not G2frame.ErrorBars elif event.key == 'b': G2frame.SubBack = not G2frame.SubBack if not G2frame.SubBack: G2frame.SinglePlot = True elif event.key == 'n': if G2frame.Contour: pass else: G2frame.logPlot = not G2frame.logPlot if not G2frame.logPlot: Pattern[0]['Offset'][0] = 0 newPlot = True elif event.key == 's' and 'PWDR' in plottype: if G2frame.SinglePlot: #toggle sqrt plot G2frame.plotStyle['sqrtPlot'] = not G2frame.plotStyle['sqrtPlot'] Ymax = max(Pattern[1][1]) if G2frame.plotStyle['sqrtPlot']: Pattern[0]['delOffset'] = .002*np.sqrt(Ymax) Pattern[0]['refOffset'] = -0.1*np.sqrt(Ymax) Pattern[0]['refDelt'] = .1*np.sqrt(Ymax) else: Pattern[0]['delOffset'] = .02*Ymax Pattern[0]['refOffset'] = -0.1*Ymax Pattern[0]['refDelt'] = .1*Ymax else: #select color scheme for multiplots & contour plots choice = [m for m in mpl.cm.datad.keys()] # if not m.endswith("_r") choice.sort() dlg = wx.SingleChoiceDialog(G2frame,'Select','Color scheme',choice) if dlg.ShowModal() == wx.ID_OK: sel = dlg.GetSelection() G2frame.ContourColor = choice[sel] else: G2frame.ContourColor = GSASIIpath.GetConfigValue('Contour_color','Paired') dlg.Destroy() newPlot = True elif event.key == 'u' and (G2frame.Contour or not G2frame.SinglePlot): if G2frame.Contour: G2frame.Cmax = min(1.0,G2frame.Cmax*1.2) elif Pattern[0]['Offset'][0] < 100.: Pattern[0]['Offset'][0] += 1. elif event.key == 'd' and (G2frame.Contour or not G2frame.SinglePlot): if G2frame.Contour: G2frame.Cmax = max(0.0,G2frame.Cmax*0.8) elif Pattern[0]['Offset'][0] > -100.: Pattern[0]['Offset'][0] -= 1. elif event.key == 'U': if G2frame.Contour: G2frame.Cmin += (G2frame.Cmax - G2frame.Cmin)/5. elif Pattern[0]['Offset'][0] < 100.: Pattern[0]['Offset'][0] += 10. elif event.key == 'D': if G2frame.Contour: G2frame.Cmin -= (G2frame.Cmax - G2frame.Cmin)/5. elif Pattern[0]['Offset'][0] > -100.: Pattern[0]['Offset'][0] -= 10. elif event.key == 'l' and not G2frame.SinglePlot: Pattern[0]['Offset'][1] -= 1. elif event.key == 'r' and not G2frame.SinglePlot: Pattern[0]['Offset'][1] += 1. elif event.key == 'o' and not G2frame.SinglePlot: G2frame.Cmax = 1.0 Pattern[0]['Offset'] = [0,0] elif event.key == 'c' and 'PWDR' in plottype: newPlot = True if not G2frame.Contour: G2frame.SinglePlot = False Pattern[0]['Offset'] = [0.,0.] else: G2frame.SinglePlot = True G2frame.Contour = not G2frame.Contour if G2frame.Contour: G2frame.plotStyle['qPlot'] = False G2frame.plotStyle['dPlot'] = False elif event.key == 'q': newPlot = True if 'PWDR' in plottype: G2frame.plotStyle['qPlot'] = not G2frame.plotStyle['qPlot'] if G2frame.plotStyle['qPlot']: G2frame.Contour = False G2frame.plotStyle['dPlot'] = False elif plottype in ['SASD','REFD']: G2frame.plotStyle['sqPlot'] = not G2frame.plotStyle['sqPlot'] elif event.key == 't' and 'PWDR' in plottype: G2frame.plotStyle['dPlot'] = not G2frame.plotStyle['dPlot'] if G2frame.plotStyle['dPlot']: G2frame.Contour = False G2frame.plotStyle['qPlot'] = False newPlot = True elif event.key == 'm': G2frame.plotStyle['sqrtPlot'] = False G2frame.SinglePlot = not G2frame.SinglePlot newPlot = True elif event.key == 'f' and not G2frame.SinglePlot: choices = G2gd.GetGPXtreeDataNames(G2frame,plotType) dlg = G2G.G2MultiChoiceDialog(G2frame,'Select dataset to plot', 'Multidata plot selection',choices) if dlg.ShowModal() == wx.ID_OK: G2frame.selections = [] select = dlg.GetSelections() if select: for id in select: G2frame.selections.append(choices[id]) else: G2frame.selections = None dlg.Destroy() newPlot = True elif event.key in ['+','=']: G2frame.plusPlot = not G2frame.plusPlot elif event.key == 'i' and G2frame.Contour: #for smoothing contour plot choice = ['nearest','bilinear','bicubic','spline16','spline36','hanning', 'hamming','hermite','kaiser','quadric','catrom','gaussian','bessel', 'mitchell','sinc','lanczos'] dlg = wx.SingleChoiceDialog(G2frame,'Select','Interpolation',choice) if dlg.ShowModal() == wx.ID_OK: sel = dlg.GetSelection() G2frame.Interpolate = choice[sel] else: G2frame.Interpolate = 'nearest' dlg.Destroy() else: # print 'no binding for key',event.key #GSASIIpath.IPyBreak() return wx.CallAfter(PlotPatterns,G2frame,newPlot=newPlot,plotType=plottype) def OnMotion(event): xpos = event.xdata if xpos: #avoid out of frame mouse position ypos = event.ydata Page.canvas.SetCursor(wx.CROSS_CURSOR) try: Id = G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId, 'Instrument Parameters') if not Id: return Parms,Parms2 = G2frame.GPXtree.GetItemPyData(Id) if G2frame.plotStyle['qPlot'] and 'PWDR' in plottype: q = xpos dsp = 2.*np.pi/q try: xpos = G2lat.Dsp2pos(Parms,2.0*np.pi/xpos) except ValueError: #avoid bad value in asin beyond upper limit pass elif plottype in ['SASD','REFD']: q = xpos dsp = 2.*np.pi/q elif G2frame.plotStyle['dPlot']: dsp = xpos q = 2.*np.pi/dsp xpos = G2lat.Dsp2pos(Parms,xpos) elif G2frame.Contour and 'T' in Parms['Type'][0]: xpos = X[int(xpos)] dsp = G2lat.Pos2dsp(Parms,xpos) q = 2.*np.pi/dsp else: dsp = G2lat.Pos2dsp(Parms,xpos) q = 2.*np.pi/dsp if G2frame.Contour: #PWDR only if 'C' in Parms['Type'][0]: G2frame.G2plotNB.status.SetStatusText('2-theta =%9.3f d =%9.5f q = %9.5f pattern ID =%5d'%(xpos,dsp,q,int(ypos)),1) else: G2frame.G2plotNB.status.SetStatusText('TOF =%9.3f d =%9.5f q = %9.5f pattern ID =%5d'%(xpos,dsp,q,int(ypos)),1) else: if 'C' in Parms['Type'][0]: if 'PWDR' in plottype: if G2frame.plotStyle['sqrtPlot']: G2frame.G2plotNB.status.SetStatusText('2-theta =%9.3f d =%9.5f q = %9.5f sqrt(Intensity) =%9.2f'%(xpos,dsp,q,ypos),1) else: G2frame.G2plotNB.status.SetStatusText('2-theta =%9.3f d =%9.5f q = %9.5f Intensity =%9.2f'%(xpos,dsp,q,ypos),1) elif plottype == 'SASD': G2frame.G2plotNB.status.SetStatusText('q =%12.5g Intensity =%12.5g d =%9.1f'%(q,ypos,dsp),1) elif plottype == 'REFD': G2frame.G2plotNB.status.SetStatusText('q =%12.5g Reflectivity =%12.5g d =%9.1f'%(q,ypos,dsp),1) else: if G2frame.plotStyle['sqrtPlot']: G2frame.G2plotNB.status.SetStatusText('TOF =%9.3f d =%9.5f q =%9.5f sqrt(Intensity) =%9.2f'%(xpos,dsp,q,ypos),1) else: G2frame.G2plotNB.status.SetStatusText('TOF =%9.3f d =%9.5f q =%9.5f Intensity =%9.2f'%(xpos,dsp,q,ypos),1) if G2frame.itemPicked: Page.SetToolTipString('%9.5f'%(xpos)) if G2frame.PickId: found = [] pickIdText = G2frame.GPXtree.GetItemText(G2frame.PickId) if pickIdText in ['Index Peak List','Unit Cells List','Reflection Lists'] or \ 'PWDR' in pickIdText: indx = -1 if pickIdText in ['Index Peak List','Unit Cells List',]: indx = -2 if len(G2frame.HKL): view = Page.toolbar._views.forward()[0][:2] wid = view[1]-view[0] found = G2frame.HKL[np.where(np.fabs(G2frame.HKL.T[indx]-xpos) < 0.002*wid)] if len(found): if len(found[0]) > 6: #SS reflections h,k,l,m = found[0][:4] Page.SetToolTipString('%d,%d,%d,%d'%(int(h),int(k),int(l),int(m))) else: h,k,l = found[0][:3] Page.SetToolTipString('%d,%d,%d'%(int(h),int(k),int(l))) else: Page.SetToolTipString('') except TypeError: G2frame.G2plotNB.status.SetStatusText('Select '+plottype+' pattern first',1) def OnPress(event): #ugh - this removes a matplotlib error for mouse clicks in log plots np.seterr(invalid='ignore') def onMoveDiffCurve(event): '''Respond to a menu command to move the difference curve. ''' if not DifLine[0]: print('No difference curve!') return G2frame.itemPicked = DifLine[0] G2frame.G2plotNB.Parent.Raise() OnPick(None) def onMoveTopTick(event): '''Respond to a menu command to move the tick locations. ''' if len(Page.phaseList) == 0: print("there are tick marks (no phases)") return G2frame.itemPicked = Page.tickDict[Page.phaseList[0]] G2frame.G2plotNB.Parent.Raise() OnPick(None) def onMoveTickSpace(event): '''Respond to a menu command to move the tick spacing. ''' if len(Page.phaseList) == 0: print("there are tick marks (no phases)") return G2frame.itemPicked = Page.tickDict[Page.phaseList[-1]] G2frame.G2plotNB.Parent.Raise() OnPick(None) def onMovePeak(event): selectedPeaks = list(set([row for row,col in G2frame.phaseDisplay.GetSelectedCells()] + G2frame.phaseDisplay.GetSelectedRows())) if len(selectedPeaks) != 1: G2G.G2MessageBox(G2frame,'You must select one peak in the table first. # selected ='+ str(len(selectedPeaks)),'Select one peak') return #GSASIIpath.IPyBreak() G2frame.itemPicked = G2frame.Lines[selectedPeaks[0]+2] # 1st 2 lines are limits G2frame.G2plotNB.Parent.Raise() OnPick(None) def OnPick(event): '''Respond to an item being picked. This usually means that the item will be dragged with the mouse. ''' def OnDragMarker(event): '''Respond to dragging of a plot Marker ''' if event.xdata is None or event.ydata is None: return # ignore if cursor out of window Page.canvas.restore_region(savedplot) G2frame.itemPicked.set_data([event.xdata], [event.ydata]) Page.figure.gca().draw_artist(G2frame.itemPicked) Page.canvas.blit(Page.figure.gca().bbox) def OnDragLine(event): '''Respond to dragging of a plot line ''' if event.xdata is None: return # ignore if cursor out of window Page.canvas.restore_region(savedplot) coords = G2frame.itemPicked.get_data() coords[0][0] = coords[0][1] = event.xdata coords = G2frame.itemPicked.set_data(coords) Page.figure.gca().draw_artist(G2frame.itemPicked) Page.canvas.blit(Page.figure.gca().bbox) def OnDragTickmarks(event): '''Respond to dragging of the reflection tick marks ''' if event.ydata is None: return # ignore if cursor out of window Page.canvas.restore_region(savedplot) if Page.pickTicknum: refDelt = -(event.ydata-Pattern[0]['refOffset'])/Page.pickTicknum refOffset = Pattern[0]['refOffset'] else: #1st row of refl ticks refOffset = event.ydata refDelt = Pattern[0]['refDelt'] for pId,phase in enumerate(Page.phaseList): pos = refOffset - pId*refDelt coords = Page.tickDict[phase].get_data() coords[1][:] = pos Page.tickDict[phase].set_data(coords) Page.figure.gca().draw_artist(Page.tickDict[phase]) Page.canvas.blit(Page.figure.gca().bbox) def OnDragDiffCurve(event): '''Respond to dragging of the difference curve ''' if event.ydata is None: return # ignore if cursor out of window Page.canvas.restore_region(savedplot) coords = G2frame.itemPicked.get_data() coords[1][:] += Page.diffOffset + event.ydata Page.diffOffset = -event.ydata G2frame.itemPicked.set_data(coords) Page.figure.gca().draw_artist(G2frame.itemPicked) Page.canvas.blit(Page.figure.gca().bbox) try: Parms,Parms2 = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId, 'Instrument Parameters')) except TypeError: return if event is None: # called from a menu command rather than by click on mpl artist mouse = 1 pick = G2frame.itemPicked ind = np.array([0]) else: if G2frame.itemPicked is not None: return pick = event.artist mouse = event.mouseevent xpos = pick.get_xdata() ypos = pick.get_ydata() ind = event.ind xy = list(zip(np.take(xpos,ind),np.take(ypos,ind)))[0] # convert from plot units if G2frame.plotStyle['qPlot']: #qplot - convert back to 2-theta xy[0] = G2lat.Dsp2pos(Parms,2*np.pi/xy[0]) elif G2frame.plotStyle['dPlot']: #dplot - convert back to 2-theta xy[0] = G2lat.Dsp2pos(Parms,xy[0]) if G2frame.plotStyle['sqrtPlot']: xy[1] = xy[1]**2 PatternId = G2frame.PatternId PickId = G2frame.PickId if G2frame.GPXtree.GetItemText(PickId) == 'Peak List': if ind.all() != [0] and ObsLine[0].get_label() in str(pick): #picked a data point, add a new peak data = G2frame.GPXtree.GetItemPyData(G2frame.PickId) XY = G2mth.setPeakparms(Parms,Parms2,xy[0],xy[1]) data['peaks'].append(XY) data['sigDict'] = {} #now invalid G2pdG.UpdatePeakGrid(G2frame,data) PlotPatterns(G2frame,plotType=plottype) else: #picked a peak list line # prepare to animate move of line G2frame.itemPicked = pick pick.set_linestyle(':') # set line as dotted Page = G2frame.G2plotNB.nb.GetPage(plotNum) Page.figure.gca() Page.canvas.draw() # refresh without dotted line & save bitmap savedplot = Page.canvas.copy_from_bbox(Page.figure.gca().bbox) G2frame.cid = Page.canvas.mpl_connect('motion_notify_event', OnDragLine) pick.set_linestyle('--') # back to dashed elif G2frame.GPXtree.GetItemText(PickId) == 'Limits': if ind.all() != [0]: #picked a data point LimitId = G2gd.GetGPXtreeItemId(G2frame,PatternId, 'Limits') data = G2frame.GPXtree.GetItemPyData(LimitId) if G2frame.plotStyle['qPlot']: #qplot - convert back to 2-theta xy[0] = G2lat.Dsp2pos(Parms,2*np.pi/xy[0]) elif G2frame.plotStyle['dPlot']: #dplot - convert back to 2-theta xy[0] = G2lat.Dsp2pos(Parms,xy[0]) if G2frame.ifGetExclude: excl = [0,0] excl[0] = max(data[1][0],min(xy[0],data[1][1])) excl[1] = excl[0]+0.1 data.append(excl) G2frame.ifGetExclude = False else: if mouse.button==1: data[1][0] = min(xy[0],data[1][1]) if mouse.button==3: data[1][1] = max(xy[0],data[1][0]) G2frame.GPXtree.SetItemPyData(LimitId,data) G2pdG.UpdateLimitsGrid(G2frame,data,plottype) wx.CallAfter(PlotPatterns,G2frame,plotType=plottype) else: #picked a limit line # prepare to animate move of line G2frame.itemPicked = pick pick.set_linestyle(':') # set line as dotted Page = G2frame.G2plotNB.nb.GetPage(plotNum) Page.figure.gca() Page.canvas.draw() # refresh without dotted line & save bitmap savedplot = Page.canvas.copy_from_bbox(Page.figure.gca().bbox) G2frame.cid = Page.canvas.mpl_connect('motion_notify_event', OnDragLine) pick.set_linestyle('--') # back to dashed elif G2frame.GPXtree.GetItemText(PickId) == 'Models': if ind.all() != [0]: #picked a data point LimitId = G2gd.GetGPXtreeItemId(G2frame,PatternId, 'Limits') data = G2frame.GPXtree.GetItemPyData(LimitId) if mouse.button==1: data[1][0] = min(xy[0],data[1][1]) if mouse.button==3: data[1][1] = max(xy[0],data[1][0]) G2frame.GPXtree.SetItemPyData(LimitId,data) wx.CallAfter(PlotPatterns,G2frame,plotType=plottype) else: #picked a limit line G2frame.itemPicked = pick elif (G2frame.GPXtree.GetItemText(PickId) == 'Reflection Lists' or 'PWDR' in G2frame.GPXtree.GetItemText(PickId) ): G2frame.itemPicked = pick Page = G2frame.G2plotNB.nb.GetPage(plotNum) Page.figure.gca() if DifLine[0] is G2frame.itemPicked: # pick of difference curve Page.canvas.draw() # save bitmap savedplot = Page.canvas.copy_from_bbox(Page.figure.gca().bbox) Page.diffOffset = Pattern[0]['delOffset'] G2frame.cid = Page.canvas.mpl_connect('motion_notify_event', OnDragDiffCurve) else: # pick of plot tick mark (is anything else possible?) pick = str(G2frame.itemPicked).split('(',1)[1][:-1] if pick not in Page.phaseList: # picked something other than a tickmark return Page.pickTicknum = Page.phaseList.index(pick) resetlist = [] for pId,phase in enumerate(Page.phaseList): # set the tickmarks to a lighter color col = Page.tickDict[phase].get_color() rgb = mpl.colors.ColorConverter().to_rgb(col) rgb_light = [(2 + i)/3. for i in rgb] resetlist.append((Page.tickDict[phase],rgb)) Page.tickDict[phase].set_color(rgb_light) Page.tickDict[phase].set_zorder(99) # put on top Page.canvas.draw() # refresh with dimmed tickmarks savedplot = Page.canvas.copy_from_bbox(Page.figure.gca().bbox) for f,v in resetlist: # reset colors back f.set_zorder(0) f.set_color(v) # reset colors back to original values G2frame.cid = Page.canvas.mpl_connect('motion_notify_event', OnDragTickmarks) elif G2frame.GPXtree.GetItemText(PickId) == 'Background': # selected a fixed background point. Can move it or delete it. backPts = G2frame.dataWindow.wxID_BackPts for mode in backPts: # what menu is selected? if G2frame.dataWindow.BackMenu.FindItemById(backPts[mode]).IsChecked(): break # mode will be 'Add' or 'Move' or 'Del' if pick.get_marker() == 'D': # find the closest point backDict = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId, 'Background'))[1] d2 = [(x-xy[0])**2+(y-xy[1])**2 for x,y in backDict['FixedPoints']] G2frame.fixPtMarker = d2.index(min(d2)) if mode == 'Move': # animate move of FixedBkg marker G2frame.itemPicked = pick pick.set_marker('|') # change the point appearance Page = G2frame.G2plotNB.nb.GetPage(plotNum) Page.figure.gca() Page.canvas.draw() # refresh with changed point & save bitmap savedplot = Page.canvas.copy_from_bbox(Page.figure.gca().bbox) G2frame.cid = Page.canvas.mpl_connect('motion_notify_event', OnDragMarker) pick.set_marker('D') # put it back elif mode == 'Del': del backDict['FixedPoints'][G2frame.fixPtMarker] wx.CallAfter(PlotPatterns,G2frame,plotType=plottype) return def OnRelease(event): '''This is called when the mouse button is released when a plot object is dragged due to an item pick, or when invoked via a menu item (such as in onMoveDiffCurve), or for background points, which may be added/moved/deleted here. New peaks are also added here. ''' plotNum = G2frame.G2plotNB.plotList.index('Powder Patterns') Page = G2frame.G2plotNB.nb.GetPage(plotNum) if G2frame.cid is not None: # if there is a drag connection, delete it Page.canvas.mpl_disconnect(G2frame.cid) G2frame.cid = None if event.xdata is None or event.ydata is None: # ignore drag if cursor is outside of plot wx.CallAfter(PlotPatterns,G2frame,plotType=plottype) return if not G2frame.PickId: return PickId = G2frame.PickId # points to item in tree if G2frame.GPXtree.GetItemText(PickId) == 'Background' and event.xdata: if Page.toolbar._active: # prevent ops. if a toolbar zoom button pressed return # Background page, deal with fixed background points if G2frame.SubBack or G2frame.Weight or G2frame.Contour or not G2frame.SinglePlot: return backDict = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId, 'Background'))[1] if 'FixedPoints' not in backDict: backDict['FixedPoints'] = [] try: Parms,Parms2 = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId, 'Instrument Parameters')) except TypeError: return # unit conversions xy = [event.xdata,event.ydata] if G2frame.plotStyle['qPlot']: #qplot - convert back to 2-theta xy[0] = G2lat.Dsp2pos(Parms,2*np.pi/xy[0]) elif G2frame.plotStyle['dPlot']: #dplot - convert back to 2-theta xy[0] = G2lat.Dsp2pos(Parms,xy[0]) if G2frame.plotStyle['sqrtPlot']: xy[1] = xy[1]**2 backPts = G2frame.dataWindow.wxID_BackPts for mode in backPts: # what menu is selected? if G2frame.dataWindow.BackMenu.FindItemById(backPts[mode]).IsChecked(): break if mode == 'Add': backDict['FixedPoints'].append(xy) Plot = Page.figure.gca() Plot.plot(event.xdata,event.ydata,'rD',clip_on=Clip_on,picker=3.) Page.canvas.draw() return elif G2frame.itemPicked is not None: # end of drag in move backDict['FixedPoints'][G2frame.fixPtMarker] = xy G2frame.itemPicked = None wx.CallAfter(PlotPatterns,G2frame,plotType=plottype) return if G2frame.itemPicked is None: return if DifLine[0] is G2frame.itemPicked: # respond to dragging of the difference curve data = G2frame.GPXtree.GetItemPyData(PickId) ypos = event.ydata Pattern[0]['delOffset'] = -ypos G2frame.itemPicked = None wx.CallAfter(PlotPatterns,G2frame,plotType=plottype) return Parms,Parms2 = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId, 'Instrument Parameters')) xpos = event.xdata if G2frame.GPXtree.GetItemText(PickId) in ['Peak List','Limits'] and xpos: lines = [] for line in G2frame.Lines: lines.append(line.get_xdata()[0]) try: lineNo = lines.index(G2frame.itemPicked.get_xdata()[0]) except ValueError: lineNo = -1 nxcl = len(exclLines) if lineNo in [0,1] or lineNo in exclLines: LimitId = G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId, 'Limits') limits = G2frame.GPXtree.GetItemPyData(LimitId) id = lineNo//2+1 id2 = lineNo%2 if G2frame.plotStyle['qPlot'] and 'PWDR' in plottype: limits[id][id2] = G2lat.Dsp2pos(Parms,2.*np.pi/xpos) elif G2frame.plotStyle['dPlot'] and 'PWDR' in plottype: limits[id][id2] = G2lat.Dsp2pos(Parms,xpos) else: limits[id][id2] = xpos if id > 1 and limits[id][0] > limits[id][1]: limits[id].reverse() limits[1][0] = min(max(limits[0][0],limits[1][0]),limits[1][1]) limits[1][1] = max(min(limits[0][1],limits[1][1]),limits[1][0]) if G2frame.GPXtree.GetItemText(G2frame.PickId) == 'Limits': G2pdG.UpdateLimitsGrid(G2frame,limits,plottype) elif lineNo > 1+nxcl: PeakId = G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId, 'Peak List') peaks = G2frame.GPXtree.GetItemPyData(PeakId) if event.button == 3: del peaks['peaks'][lineNo-2-nxcl] else: if G2frame.plotStyle['qPlot']: peaks['peaks'][lineNo-2-nxcl][0] = G2lat.Dsp2pos(Parms,2.*np.pi/xpos) elif G2frame.plotStyle['dPlot']: peaks['peaks'][lineNo-2-nxcl][0] = G2lat.Dsp2pos(Parms,xpos) else: peaks['peaks'][lineNo-2-nxcl][0] = xpos peaks['sigDict'] = {} #no longer valid G2pdG.UpdatePeakGrid(G2frame,peaks) elif G2frame.GPXtree.GetItemText(PickId) in ['Models',] and xpos: lines = [] for line in G2frame.Lines: lines.append(line.get_xdata()[0]) try: lineNo = lines.index(G2frame.itemPicked.get_xdata()[0]) except ValueError: lineNo = -1 if lineNo in [0,1]: LimitId = G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId, 'Limits') data = G2frame.GPXtree.GetItemPyData(LimitId) data[1][lineNo] = xpos data[1][0] = min(max(data[0][0],data[1][0]),data[1][1]) data[1][1] = max(min(data[0][1],data[1][1]),data[1][0]) elif (G2frame.GPXtree.GetItemText(PickId) == 'Reflection Lists' or \ 'PWDR' in G2frame.GPXtree.GetItemText(PickId)) and xpos: Id = G2gd.GetGPXtreeItemId(G2frame,PatternId,'Reflection Lists') # GSASIIpath.IPyBreak() if Id: #Phases = G2frame.GPXtree.GetItemPyData(Id) pick = str(G2frame.itemPicked).split('(',1)[1][:-1] if 'line' not in pick: #avoid data points, etc. data = G2frame.GPXtree.GetItemPyData(G2frame.PatternId) num = Page.phaseList.index(pick) if num: data[0]['refDelt'] = -(event.ydata-Pattern[0]['refOffset'])/num else: #1st row of refl ticks data[0]['refOffset'] = event.ydata PlotPatterns(G2frame,plotType=plottype) G2frame.itemPicked = None #===================================================================================== # beginning PlotPatterns execution new,plotNum,Page,Plot,limits = G2frame.G2plotNB.FindPlotTab('Powder Patterns','mpl') if not new: G2frame.xylim = limits else: if plottype in ['SASD','REFD']: G2frame.logPlot = True G2frame.ErrorBars = True newPlot = True G2frame.Cmax = 1.0 Page.canvas.mpl_connect('key_press_event', OnPlotKeyPress) Page.canvas.mpl_connect('motion_notify_event', OnMotion) Page.canvas.mpl_connect('pick_event', OnPick) Page.canvas.mpl_connect('button_release_event', OnRelease) Page.canvas.mpl_connect('button_press_event',OnPress) if 'PWDR' in G2frame.GPXtree.GetItemText(G2frame.PickId): Histograms,Phases = G2frame.GetUsedHistogramsAndPhasesfromTree() refColors=['b','r','c','g','m','k'] Page.phaseColors = {p:refColors[i%len(refColors)] for i,p in enumerate(Phases)} Phases = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId,'Reflection Lists')) Page.phaseList = sorted(Phases.keys()) # define an order for phases (once!) G2frame.Bind(wx.EVT_MENU, onMoveDiffCurve, id=G2frame.dataWindow.moveDiffCurve.GetId()) G2frame.Bind(wx.EVT_MENU, onMoveTopTick, id=G2frame.dataWindow.moveTickLoc.GetId()) G2frame.Bind(wx.EVT_MENU, onMoveTickSpace, id=G2frame.dataWindow.moveTickSpc.GetId()) G2frame.dataWindow.moveDiffCurve.Enable(False) G2frame.dataWindow.moveTickLoc.Enable(False) G2frame.dataWindow.moveTickSpc.Enable(False) elif G2frame.GPXtree.GetItemText(G2frame.PickId) == 'Peak List': G2frame.Bind(wx.EVT_MENU, onMovePeak, id=G2frame.dataWindow.movePeak.GetId()) # save information needed to reload from tree and redraw kwargs={'PatternName':G2frame.GPXtree.GetItemText(G2frame.PatternId)} if G2frame.PickId: kwargs['PickName'] = G2frame.GPXtree.GetItemText(G2frame.PickId) #G2frame.G2plotNB.RegisterRedrawRoutine('Powder Patterns',ReplotPattern, G2frame.G2plotNB.RegisterRedrawRoutine(G2frame.G2plotNB.lastRaisedPlotTab,ReplotPattern, (G2frame,newPlot,plotType),kwargs) # now start plotting G2frame.G2plotNB.status.DestroyChildren() #get rid of special stuff on status bar Page.tickDict = {} DifLine = [''] if G2frame.Contour: Page.Choice = (' key press','d: lower contour max','u: raise contour max','o: reset contour max', 'i: interpolation method','s: color scheme','c: contour off') else: if G2frame.logPlot: if 'PWDR' in plottype: if G2frame.SinglePlot: Page.Choice = (' key press','n: log(I) off', 'c: contour on','q: toggle q plot','t: toggle d-spacing plot', 'm: toggle multidata plot','w: toggle divide by sig','+: toggle selection') else: Page.Choice = (' key press','n: log(I) off', 'd: offset down','l: offset left','r: offset right','u: offset up','o: reset offset', 'c: contour on','q: toggle q plot','t: toggle d-spacing plot','f: select data', 'm: toggle multidata plot','w: toggle divide by sig','+: toggle selection') elif plottype in ['SASD','REFD']: if G2frame.SinglePlot: Page.Choice = (' key press','b: toggle subtract background file','n: semilog on', 'q: toggle S(q) plot','m: toggle multidata plot','w: toggle (Io-Ic)/sig plot','+: toggle selection') else: Page.Choice = (' key press','b: toggle subtract background file','n: semilog on', 'd: offset down','l: offset left','r: offset right','u: offset up','o: reset offset', 'q: toggle S(q) plot','m: toggle multidata plot','w: toggle (Io-Ic)/sig plot','+: toggle selection') else: if 'PWDR' in plottype: if G2frame.SinglePlot: Page.Choice = (' key press', 'b: toggle subtract background','n: log(I) on','s: toggle sqrt plot','c: contour on', 'q: toggle q plot','t: toggle d-spacing plot','m: toggle multidata plot', 'w: toggle divide by sig','+: no selection') else: Page.Choice = (' key press','l: offset left','r: offset right','d/D: offset down/10x','u/U: offset up/10x','o: reset offset', 'b: toggle subtract background','n: log(I) on','c: contour on','q: toggle q plot','t: toggle d-spacing plot', 'm: toggle multidata plot','f: select data','s: color scheme','w: toggle divide by sig','+: no selection') elif plottype in ['SASD','REFD']: if G2frame.SinglePlot: Page.Choice = (' key press','b: toggle subtract background file','n: loglog on','e: toggle error bars', 'q: toggle S(q) plot','m: toggle multidata plot','w: toggle (Io-Ic)/sig plot','+: no selection') else: Page.Choice = (' key press','b: toggle subtract background file','n: loglog on','e: toggle error bars', 'd: offset down','l: offset left','r: offset right','u: offset up','o: reset offset', 'q: toggle S(q) plot','m: toggle multidata plot','w: toggle (Io-Ic)/sig plot','+: no selection') G2frame.cid = None Page.keyPress = OnPlotKeyPress PickId = G2frame.PickId PatternId = G2frame.PatternId colors=['b','g','r','c','m','k'] Lines = [] exclLines = [] if G2frame.SinglePlot and PatternId: Pattern = G2frame.GPXtree.GetItemPyData(PatternId) Pattern.append(G2frame.GPXtree.GetItemText(PatternId)) PlotList = [Pattern,] PId = G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId, 'Background') Pattern[0]['BackFile'] = ['',-1.0] if PId: Pattern[0]['BackFile'] = G2frame.GPXtree.GetItemPyData(PId)[1].get('background PWDR',['',-1.0]) Parms,Parms2 = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame, G2frame.PatternId, 'Instrument Parameters')) Sample = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId, 'Sample Parameters')) ParmList = [Parms,] SampleList = [Sample,] Title = Pattern[-1] else: #G2frame.selection Title = os.path.split(G2frame.GSASprojectfile)[1] PlotList = [] ParmList = [] SampleList = [] if G2frame.selections is None: choices = G2gd.GetGPXtreeDataNames(G2frame,plotType) else: choices = G2frame.selections for item in choices: id = G2gd.GetGPXtreeItemId(G2frame,G2frame.root, item) Pattern = G2frame.GPXtree.GetItemPyData(id) if len(Pattern) < 3: # put name on end if needed Pattern.append(G2frame.GPXtree.GetItemText(id)) if 'Offset' not in Pattern[0]: #plot offset data Ymax = max(Pattern[1][1]) Pattern[0].update({'Offset':[0.0,0.0],'delOffset':0.02*Ymax,'refOffset':-0.1*Ymax,'refDelt':0.1*Ymax,}) PId = G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId, 'Background') Pattern[0]['BackFile'] = ['',-1.0] if PId: Pattern[0]['BackFile'] = G2frame.GPXtree.GetItemPyData(PId)[1].get('background PWDR',['',-1.0]) PlotList.append(Pattern) ParmList.append(G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame, id,'Instrument Parameters'))[0]) SampleList.append(G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame, id, 'Sample Parameters'))) lenX = 0 Ymax = None for Pattern in PlotList: xye = Pattern[1] bxye = G2pdG.GetFileBackground(G2frame,xye,Pattern) if xye[1] is None: continue if Ymax is None: Ymax = max(xye[1]+bxye) Ymax = max(Ymax,max(xye[1]+bxye)) if Ymax is None: return # nothing to plot offsetX = Pattern[0]['Offset'][1] offsetY = Pattern[0]['Offset'][0] if G2frame.logPlot: Title = 'log('+Title+')' Plot.set_title(Title) if G2frame.plotStyle['qPlot'] or plottype in ['SASD','REFD'] and not G2frame.Contour: Plot.set_xlabel(r'$Q, \AA^{-1}$',fontsize=16) elif G2frame.plotStyle['dPlot'] and 'PWDR' in plottype and not G2frame.Contour: Plot.set_xlabel(r'$d, \AA$',fontsize=16) else: if 'C' in ParmList[0]['Type'][0]: Plot.set_xlabel(r'$\mathsf{2\theta}$',fontsize=16) else: if G2frame.Contour: Plot.set_xlabel(r'Channel no.',fontsize=16) else: Plot.set_xlabel(r'$TOF, \mathsf{\mu}$s',fontsize=16) if G2frame.Weight: if 'PWDR' in plottype: Plot.set_ylabel(r'$\mathsf{I/\sigma(I)}$',fontsize=16) elif plottype in ['SASD','REFD']: Plot.set_ylabel(r'$\mathsf{\Delta(I)/\sigma(I)}$',fontsize=16) else: if 'C' in ParmList[0]['Type'][0]: if 'PWDR' in plottype: if G2frame.plotStyle['sqrtPlot']: Plot.set_ylabel(r'$\sqrt{Intensity}$',fontsize=16) else: Plot.set_ylabel(r'$Intensity$',fontsize=16) elif plottype == 'SASD': if G2frame.plotStyle['sqPlot']: Plot.set_ylabel(r'$S(Q)=I*Q^{4}$',fontsize=16) else: Plot.set_ylabel(r'$Intensity,\ cm^{-1}$',fontsize=16) elif plottype == 'REFD': if G2frame.plotStyle['sqPlot']: Plot.set_ylabel(r'$S(Q)=R*Q^{4}$',fontsize=16) else: Plot.set_ylabel(r'$Reflectivity$',fontsize=16) else: #neutron TOF if G2frame.plotStyle['sqrtPlot']: Plot.set_ylabel(r'$\sqrt{Normalized\ intensity}$',fontsize=16) else: Plot.set_ylabel(r'$Normalized\ intensity$',fontsize=16) mpl.rcParams['image.cmap'] = G2frame.ContourColor mcolors = mpl.cm.ScalarMappable() #wants only default as defined in previous line!! if G2frame.Contour: ContourZ = [] ContourY = [] Nseq = 0 for N,Pattern in enumerate(PlotList): Parms = ParmList[N] Sample = SampleList[N] ifpicked = False LimitId = 0 if Pattern[1] is None: continue # skip over uncomputed simulations # xye = ma.array(ma.getdata(Pattern[1])) xye = np.array(ma.getdata(Pattern[1])) bxye = G2pdG.GetFileBackground(G2frame,xye,Pattern) if PickId: ifpicked = Pattern[2] == G2frame.GPXtree.GetItemText(PatternId) LimitId = G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId,'Limits') limits = G2frame.GPXtree.GetItemPyData(LimitId) excls = limits[2:] for excl in excls: xye[0] = ma.masked_inside(xye[0],excl[0],excl[1]) if G2frame.plotStyle['qPlot'] and 'PWDR' in plottype: X = 2.*np.pi/G2lat.Pos2dsp(Parms,xye[0]) elif G2frame.plotStyle['dPlot'] and 'PWDR' in plottype: X = G2lat.Pos2dsp(Parms,xye[0]) else: X = xye[0] if not lenX: lenX = len(X) if 'PWDR' in plottype: if G2frame.plotStyle['sqrtPlot']: olderr = np.seterr(invalid='ignore') #get around sqrt(-ve) error Y = np.where(xye[1]+bxye>=0.,np.sqrt(xye[1]+bxye),-np.sqrt(-xye[1]-bxye)) np.seterr(invalid=olderr['invalid']) else: Y = xye[1]+bxye+offsetY*N*Ymax/100.0 elif plottype in ['SASD','REFD']: if plottype == 'SASD': B = xye[5] else: B = np.zeros_like(xye[5]) if G2frame.plotStyle['sqPlot']: Y = xye[1]*Sample['Scale'][0]*(1.05)**(offsetY*N)*X**4 else: Y = xye[1]*Sample['Scale'][0]*(1.05)**(offsetY*N) if LimitId and ifpicked: limits = np.array(G2frame.GPXtree.GetItemPyData(LimitId)) lims = limits[1] if G2frame.plotStyle['qPlot'] and 'PWDR' in plottype: lims = 2.*np.pi/G2lat.Pos2dsp(Parms,lims) elif G2frame.plotStyle['dPlot'] and 'PWDR' in plottype: lims = G2lat.Pos2dsp(Parms,lims) Lines.append(Plot.axvline(lims[0],color='g',dashes=(5,5),picker=3.)) Lines.append(Plot.axvline(lims[1],color='r',dashes=(5,5),picker=3.)) for i,item in enumerate(limits[2:]): Lines.append(Plot.axvline(item[0],color='m',dashes=(5,5),picker=3.)) Lines.append(Plot.axvline(item[1],color='m',dashes=(5,5),picker=3.)) exclLines += [2*i+2,2*i+3] if G2frame.Contour: if lenX == len(X): ContourY.append(N) ContourZ.append(Y) if 'C' in ParmList[0]['Type'][0]: ContourX = X else: #'T'OF ContourX = range(lenX) Nseq += 1 Plot.set_ylabel('Data sequence',fontsize=12) else: if G2frame.plusPlot: pP = '+' else: pP = '' if plottype in ['SASD','REFD'] and G2frame.logPlot: X *= (1.01)**(offsetX*N) else: xlim = Plot.get_xlim() DX = xlim[1]-xlim[0] X += 0.002*offsetX*DX*N Xum = ma.getdata(X) if ifpicked: if G2frame.plotStyle['sqrtPlot']: olderr = np.seterr(invalid='ignore') #get around sqrt(-ve) error Z = np.where(xye[3]>=0.,np.sqrt(xye[3]),-np.sqrt(-xye[3])) np.seterr(invalid=olderr['invalid']) else: Z = xye[3]+offsetY*N*Ymax/100.0 if 'PWDR' in plottype: if G2frame.plotStyle['sqrtPlot']: olderr = np.seterr(invalid='ignore') #get around sqrt(-ve) error W = np.where(xye[4]>=0.,np.sqrt(xye[4]),-np.sqrt(-xye[4])) np.seterr(invalid=olderr['invalid']) D = np.where(xye[5],(Y-Z),0.)-Pattern[0]['delOffset'] else: W = xye[4]+offsetY*N*Ymax/100.0 D = xye[5]-Pattern[0]['delOffset'] #powder background elif plottype in ['SASD','REFD']: if G2frame.plotStyle['sqPlot']: W = xye[4]*X**4 Z = xye[3]*X**4 B = B*X**4 else: W = xye[4] if G2frame.SubBack: YB = Y-B ZB = Z else: YB = Y ZB = Z+B Plot.set_yscale("log",nonposy='mask') if np.any(W>0.): Plot.set_ylim(bottom=np.min(np.trim_zeros(W))/2.,top=np.max(Y)*2.) else: Plot.set_ylim(bottom=np.min(np.trim_zeros(YB))/2.,top=np.max(Y)*2.) if G2frame.logPlot: if 'PWDR' in plottype: Plot.set_yscale("log",nonposy='mask') Plot.plot(X,Y,colors[0]+pP,picker=3.,clip_on=Clip_on) Plot.plot(X,Z,colors[1],picker=False) Plot.plot(X,W,colors[2],picker=False) #background elif plottype in ['SASD','REFD']: Plot.set_xscale("log",nonposx='mask') Ibeg = np.searchsorted(X,limits[1][0]) Ifin = np.searchsorted(X,limits[1][1]) if G2frame.Weight: Plot.set_yscale("linear") DS = (YB-ZB)*np.sqrt(xye[2]) Plot.plot(X[Ibeg:Ifin],DS[Ibeg:Ifin],colors[3],picker=False) Plot.axhline(0.,color='k') Plot.set_ylim(bottom=np.min(DS[Ibeg:Ifin])*1.2,top=np.max(DS[Ibeg:Ifin])*1.2) else: Plot.set_yscale("log",nonposy='mask') if G2frame.ErrorBars: if G2frame.plotStyle['sqPlot']: Plot.errorbar(X,YB,yerr=X**4*Sample['Scale'][0]*np.sqrt(1./(Pattern[0]['wtFactor']*xye[2])), ecolor=colors[0],picker=3.,clip_on=Clip_on) else: Plot.errorbar(X,YB,yerr=Sample['Scale'][0]*np.sqrt(1./(Pattern[0]['wtFactor']*xye[2])), ecolor=colors[0],picker=3.,clip_on=Clip_on) else: Plot.plot(X,YB,colors[0]+pP,picker=3.,clip_on=Clip_on) Plot.plot(X,W,colors[2],picker=False) #const. background Plot.plot(X,ZB,colors[1],picker=False) elif G2frame.Weight and 'PWDR' in plottype: DY = xye[1]*np.sqrt(xye[2]) Ymax = max(DY) DZ = xye[3]*np.sqrt(xye[2]) DS = xye[5]*np.sqrt(xye[2])-Ymax*Pattern[0]['delOffset'] ObsLine = Plot.plot(X,DY,colors[0]+pP,picker=3.,clip_on=Clip_on) #Io/sig(Io) Plot.plot(X,DZ,colors[1],picker=False) #Ic/sig(Io) DifLine = Plot.plot(X,DS,colors[3],picker=1.) #(Io-Ic)/sig(Io) Plot.axhline(0.,color='k') else: if G2frame.SubBack: if 'PWDR' in plottype: Plot.plot(Xum,Y-W,colors[0]+pP,picker=False,clip_on=Clip_on) #Io-Ib Plot.plot(X,Z-W,colors[1],picker=False) #Ic-Ib else: Plot.plot(X,YB,colors[0]+pP,picker=3.,clip_on=Clip_on) Plot.plot(X,ZB,colors[1],picker=False) else: if 'PWDR' in plottype: ObsLine = Plot.plot(Xum,Y,colors[0]+pP,picker=3.,clip_on=Clip_on) #Io Plot.plot(X,Z,colors[1],picker=False) #Ic else: Plot.plot(X,YB,colors[0]+pP,picker=3.,clip_on=Clip_on) Plot.plot(X,ZB,colors[1],picker=False) if 'PWDR' in plottype: Plot.plot(X,W,colors[2],picker=False) #Ib DifLine = Plot.plot(X,D,colors[3],picker=1.) #Io-Ic Plot.axhline(0.,color='k') Page.SetToolTipString('') if PickId: if G2frame.GPXtree.GetItemText(PickId) == 'Peak List': tip = 'On data point: Pick peak - L or R MB. On line: L-move, R-delete' Page.SetToolTipString(tip) data = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,PatternId, 'Peak List')) selectedPeaks = list(set( [row for row,col in G2frame.reflGrid.GetSelectedCells()] + G2frame.reflGrid.GetSelectedRows())) G2frame.dataWindow.movePeak.Enable(len(selectedPeaks) == 1) # allow peak move from table when one peak is selected for i,item in enumerate(data['peaks']): if i in selectedPeaks: Ni = N+1 else: Ni = N if G2frame.plotStyle['qPlot']: Lines.append(Plot.axvline(2.*np.pi/G2lat.Pos2dsp(Parms,item[0]),color=colors[Ni%6],picker=2.)) elif G2frame.plotStyle['dPlot']: Lines.append(Plot.axvline(G2lat.Pos2dsp(Parms,item[0]),color=colors[Ni%6],picker=2.)) else: Lines.append(Plot.axvline(item[0],color=colors[Ni%6],picker=2.)) if Ni == N+1: Lines[-1].set_lw(Lines[-1].get_lw()+1) if G2frame.GPXtree.GetItemText(PickId) == 'Limits': tip = 'On data point: Lower limit - L MB; Upper limit - R MB. On limit: MB down to move' Page.SetToolTipString(tip) data = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,PatternId, 'Limits')) else: #not picked icolor = 256*N/len(PlotList) if G2frame.logPlot: if 'PWDR' in plottype: Plot.semilogy(X,Y,color=mcolors.cmap(icolor),picker=False,nonposy='mask') elif plottype in ['SASD','REFD']: Plot.semilogy(X,Y,color=mcolors.cmap(icolor),picker=False,nonposy='mask') else: if 'PWDR' in plottype: Plot.plot(X,Y,color=mcolors.cmap(icolor),picker=False) elif plottype in ['SASD','REFD']: Plot.loglog(X,Y,mcolors.cmap(icolor),picker=False,nonposy='mask') Plot.set_ylim(bottom=np.min(np.trim_zeros(Y))/2.,top=np.max(Y)*2.) if G2frame.logPlot and 'PWDR' in plottype: Plot.set_ylim(bottom=np.min(np.trim_zeros(Y))/2.,top=np.max(Y)*2.) # if not G2frame.SinglePlot and not G2frame.Contour: # axcb = mpl.colorbar.ColorbarBase(N) # axcb.set_label('PDF number') if PickId and not G2frame.Contour: Parms,Parms2 = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,PatternId, 'Instrument Parameters')) if G2frame.GPXtree.GetItemText(PickId) in ['Index Peak List','Unit Cells List']: peaks = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,PatternId, 'Index Peak List')) if not len(peaks): return # are there any peaks? for peak in peaks[0]: if peak[2]: if G2frame.plotStyle['qPlot']: Plot.axvline(2.*np.pi/G2lat.Pos2dsp(Parms,peak[0]),color='b') if G2frame.plotStyle['dPlot']: Plot.axvline(G2lat.Pos2dsp(Parms,peak[0]),color='b') else: Plot.axvline(peak[0],color='b') for hkl in G2frame.HKL: clr = 'r' if len(hkl) > 6 and hkl[3]: clr = 'g' if G2frame.plotStyle['qPlot']: Plot.axvline(2.*np.pi/G2lat.Pos2dsp(Parms,hkl[-2]),color=clr,dashes=(5,5)) if G2frame.plotStyle['dPlot']: Plot.axvline(G2lat.Pos2dsp(Parms,hkl[-2]),color=clr,dashes=(5,5)) else: Plot.axvline(hkl[-2],color=clr,dashes=(5,5)) elif G2frame.GPXtree.GetItemText(PickId) in ['Reflection Lists'] or \ 'PWDR' in G2frame.GPXtree.GetItemText(PickId): Phases = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,PatternId,'Reflection Lists')) l = GSASIIpath.GetConfigValue('Tick_length',8.0) w = GSASIIpath.GetConfigValue('Tick_width',1.) Page.phaseList = sorted(Phases.keys()) # define an order for phases (once!) for pId,phase in enumerate(Page.phaseList): if 'list' in str(type(Phases[phase])): continue peaks = Phases[phase].get('RefList',[]) if not len(peaks): continue if Phases[phase].get('Super',False): peak = np.array([[peak[5],peak[6]] for peak in peaks]) else: peak = np.array([[peak[4],peak[5]] for peak in peaks]) pos = Pattern[0]['refOffset']-pId*Pattern[0]['refDelt']*np.ones_like(peak) plsym = Page.phaseColors.get(phase,'y')+'|' # yellow should never happen! if G2frame.plotStyle['qPlot']: Page.tickDict[phase],j = Plot.plot(2*np.pi/peak.T[0],pos,plsym,mew=w,ms=l,picker=3.,label=phase) elif G2frame.plotStyle['dPlot']: Page.tickDict[phase],j = Plot.plot(peak.T[0],pos,plsym,mew=w,ms=l,picker=3.,label=phase) else: Page.tickDict[phase],j = Plot.plot(peak.T[1],pos,plsym,mew=w,ms=l,picker=3.,label=phase) if len(Phases): handles,legends = Plot.get_legend_handles_labels() #got double entries in the legends for some reason if handles: Plot.legend(handles[::2],legends[::2],title='Phases',loc='best') #skip every other one if G2frame.Contour: acolor = mpl.cm.get_cmap(G2frame.ContourColor) Img = Plot.imshow(ContourZ,cmap=acolor,vmin=0,vmax=Ymax*G2frame.Cmax,interpolation=G2frame.Interpolate, extent=[ContourX[0],ContourX[-1],ContourY[0],ContourY[-1]],aspect='auto',origin='lower') Page.figure.colorbar(Img) else: G2frame.Lines = Lines if PickId and G2frame.GPXtree.GetItemText(PickId) == 'Background': # plot fixed background points backDict = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId, 'Background'))[1] try: Parms,Parms2 = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,G2frame.PatternId, 'Instrument Parameters')) except TypeError: Parms = None for x,y in backDict.get('FixedPoints',[]): # "normal" intensity modes only! if G2frame.SubBack or G2frame.Weight or G2frame.Contour or not G2frame.SinglePlot: break if y < 0 and (G2frame.plotStyle['sqrtPlot'] or G2frame.logPlot): y = Page.figure.gca().get_ylim()[0] # put out of range point at bottom of plot elif G2frame.plotStyle['sqrtPlot']: y = math.sqrt(y) if G2frame.plotStyle['qPlot']: #Q - convert from 2-theta if Parms: x = 2*np.pi/G2lat.Pos2dsp(Parms,x) else: break elif G2frame.plotStyle['dPlot']: #d - convert from 2-theta if Parms: x = G2lat.Dsp2pos(Parms,x) else: break Plot.plot(x,y,'rD',clip_on=Clip_on,picker=3.) if not newPlot: # this restores previous plot limits (but I'm not sure why there are two .push_current calls) Page.toolbar.push_current() if G2frame.Contour: # for contour plots expand y-axis to include all histograms G2frame.xylim = (G2frame.xylim[0], (0.,len(PlotList)-1.)) Plot.set_xlim(G2frame.xylim[0]) Plot.set_ylim(G2frame.xylim[1]) # xylim = [] Page.toolbar.push_current() Page.toolbar.draw() else: G2frame.xylim = Plot.get_xlim(),Plot.get_ylim() Page.canvas.draw() olderr = np.seterr(invalid='ignore') #ugh - this removes a matplotlib error for mouse clicks in log plots # and sqrt(-ve) in np.where usage # G2frame.Pwdr = True if 'PWDR' in G2frame.GPXtree.GetItemText(G2frame.PickId): if len(Page.tickDict.keys()) == 1: G2frame.dataWindow.moveTickLoc.Enable(True) elif len(Page.tickDict.keys()) > 1: G2frame.dataWindow.moveTickLoc.Enable(True) G2frame.dataWindow.moveTickSpc.Enable(True) if DifLine[0]: G2frame.dataWindow.moveDiffCurve.Enable(True) ################################################################################ ##### PlotDeltSig ################################################################################ def PlotDeltSig(G2frame,kind,PatternName=None): 'Produces normal probability plot for a powder or single crystal histogram' if PatternName: G2frame.PatternId = G2gd.GetGPXtreeItemId(G2frame, G2frame.root, PatternName) new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('Error analysis','mpl') if new: G2frame.Cmin = 0.0 G2frame.Cmax = 1.0 # save information needed to reload from tree and redraw G2frame.G2plotNB.RegisterRedrawRoutine(G2frame.G2plotNB.lastRaisedPlotTab, PlotDeltSig,( G2frame,kind, G2frame.GPXtree.GetItemText(G2frame.PatternId)) ) Page.Choice = None PatternId = G2frame.PatternId Pattern = G2frame.GPXtree.GetItemPyData(PatternId) Pattern.append(G2frame.GPXtree.GetItemText(PatternId)) wtFactor = Pattern[0]['wtFactor'] if kind == 'PWDR': limits = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,PatternId, 'Limits'))[1] xye = np.array(Pattern[1]) xmin = np.searchsorted(xye[0],limits[0]) xmax = np.searchsorted(xye[0],limits[1]) DS = xye[5][xmin:xmax]*np.sqrt(wtFactor*xye[2][xmin:xmax]) elif kind == 'HKLF': refl = Pattern[1]['RefList'] im = 0 if Pattern[1]['Super']: im = 1 DS = [] for ref in refl: if ref[6+im] > 0.: DS.append((ref[5+im]-ref[7+im])/ref[6+im]) G2frame.G2plotNB.status.DestroyChildren() #get rid of special stuff on status bar DS.sort() EDS = np.zeros_like(DS) DX = np.linspace(0.,1.,num=len(DS),endpoint=True) np.seterr(invalid='ignore') #avoid problem at DX==0 T = np.sqrt(np.log(1.0/DX**2)) top = 2.515517+0.802853*T+0.010328*T**2 bot = 1.0+1.432788*T+0.189269*T**2+0.001308*T**3 EDS = np.where(DX>0,-(T-top/bot),(T-top/bot)) low1 = np.searchsorted(EDS,-1.) hi1 = np.searchsorted(EDS,1.) slp,intcp = np.polyfit(EDS[low1:hi1],DS[low1:hi1],deg=1) frac = 100.*(hi1-low1)/len(DS) G2frame.G2plotNB.status.SetStatusText( \ 'Over range -1. to 1. :'+' slope = %.3f, intercept = %.3f for %.2f%% of the fitted data'%(slp,intcp,frac),1) Plot.set_title('Normal probability for '+Pattern[-1]) Plot.set_xlabel(r'expected $\mathsf{\Delta/\sigma}$',fontsize=14) Plot.set_ylabel(r'observed $\mathsf{\Delta/\sigma}$',fontsize=14) Plot.plot(EDS,DS,'r+',label='result') Plot.plot([-2,2],[-2,2],'k',dashes=(5,5),label='ideal') Plot.legend(loc='upper left') np.seterr(invalid='warn') Page.canvas.draw() ################################################################################ ##### PlotISFG ################################################################################ def PlotISFG(G2frame,data,newPlot=False,plotType='',peaks=None): ''' Plotting package for PDF analysis; displays I(Q), S(Q), F(Q) and G(r) as single or multiple plots with waterfall and contour plots as options ''' global Peaks Peaks = peaks G2frame.ShiftDown = False if not plotType: plotType = G2frame.G2plotNB.plotList[G2frame.G2plotNB.nb.GetSelection()] if plotType not in ['I(Q)','S(Q)','F(Q)','G(R)','delt-G(R)']: return def OnPlotKeyUp(event): if event.key == 'shift': G2frame.ShiftDown = False return def OnPlotKeyPress(event): if event.key == 'shift': G2frame.ShiftDown = True return newPlot = False if G2frame.ShiftDown: event.key = event.key.upper() if event.key == 'u': if G2frame.Contour: G2frame.Cmax = min(1.0,G2frame.Cmax*1.2) elif Page.Offset[1] < 100.: Page.Offset[1] += 1. elif event.key == 'd': if G2frame.Contour: G2frame.Cmax = max(0.0,G2frame.Cmax*0.8) elif Page.Offset[1] > -100.: Page.Offset[1] -= 1. elif event.key == 'U': if G2frame.Contour: G2frame.Cmin += (G2frame.Cmax - G2frame.Cmin)/5. elif Page.Offset[1] < 100.: Page.Offset[1] += 10. elif event.key == 'D': if G2frame.Contour: G2frame.Cmin -= (G2frame.Cmax - G2frame.Cmin)/5. elif Page.Offset[1] > -100.: Page.Offset[1] -= 10. elif event.key == 'l': Page.Offset[0] -= 1. elif event.key == 'r': Page.Offset[0] += 1. elif event.key == 'o': if G2frame.Contour: G2frame.Interpolate = 'nearest' G2frame.Cmin = 0.0 G2frame.Cmax = 1.0 else: Page.Offset = [0,0] elif event.key == 'm': G2frame.SinglePlot = not G2frame.SinglePlot elif event.key == 'c': newPlot = True G2frame.Contour = not G2frame.Contour if G2frame.Contour: G2frame.SinglePlot = False else: Page.Offset = [0.,0.] G2frame.SinglePlot = not G2frame.SinglePlot elif not G2frame.Contour and event.key == 'w': G2frame.Waterfall = not G2frame.Waterfall elif event.key == 'f' and not G2frame.SinglePlot: choices = G2gd.GetGPXtreeDataNames(G2frame,'PDF ') dlg = G2G.G2MultiChoiceDialog(G2frame,'Select dataset to plot', 'Multidata plot selection',choices) if dlg.ShowModal() == wx.ID_OK: G2frame.PDFselections = [] select = dlg.GetSelections() if select: for id in select: G2frame.PDFselections.append(choices[id]) else: G2frame.PDFselections = None dlg.Destroy() elif event.key == 's': choice = [m for m in mpl.cm.datad.keys()] # if not m.endswith("_r") choice.sort() dlg = wx.SingleChoiceDialog(G2frame,'Select','Color scheme',choice) if dlg.ShowModal() == wx.ID_OK: sel = dlg.GetSelection() G2frame.ContourColor = choice[sel] else: G2frame.ContourColor = GSASIIpath.GetConfigValue('Contour_color','Paired') dlg.Destroy() elif event.key == 'i': #for smoothing contour plot choice = ['nearest','bilinear','bicubic','spline16','spline36','hanning', 'hamming','hermite','kaiser','quadric','catrom','gaussian','bessel', 'mitchell','sinc','lanczos'] dlg = wx.SingleChoiceDialog(G2frame,'Select','Interpolation',choice) if dlg.ShowModal() == wx.ID_OK: sel = dlg.GetSelection() G2frame.Interpolate = choice[sel] else: G2frame.Interpolate = 'nearest' dlg.Destroy() elif event.key == 't' and not G2frame.Contour: G2frame.Legend = not G2frame.Legend PlotISFG(G2frame,data,newPlot=newPlot,plotType=plotType) def OnMotion(event): xpos = event.xdata if xpos: #avoid out of frame mouse position ypos = event.ydata Page.canvas.SetCursor(wx.CROSS_CURSOR) try: if G2frame.Contour: G2frame.G2plotNB.status.SetStatusText('R =%.3fA pattern ID =%5d'%(xpos,int(ypos)),1) else: G2frame.G2plotNB.status.SetStatusText('R =%.3fA %s =%.2f'%(xpos,plotType,ypos),1) except TypeError: G2frame.G2plotNB.status.SetStatusText('Select '+plotType+' pattern first',1) def OnPick(event): def OnDragLine(event): '''Respond to dragging of a plot line ''' if event.xdata is None: return # ignore if cursor out of window Page.canvas.restore_region(savedplot) coords = G2frame.itemPicked.get_data() coords[0][0] = coords[0][1] = event.xdata coords = G2frame.itemPicked.set_data(coords) Page.figure.gca().draw_artist(G2frame.itemPicked) Page.canvas.blit(Page.figure.gca().bbox) if Peaks == None: return if G2frame.itemPicked is not None: return pick = event.artist mouse = event.mouseevent xpos = pick.get_xdata() ypos = pick.get_ydata() ind = event.ind xy = list(zip(np.take(xpos,ind),np.take(ypos,ind)))[0] if not ind[0]: # a limit line - allow it to drag # prepare to animate move of line G2frame.itemPicked = pick pick.set_linestyle(':') # set line as dotted Page = G2frame.G2plotNB.nb.GetPage(plotNum) Page.figure.gca() Page.canvas.draw() # refresh without dotted line & save bitmap savedplot = Page.canvas.copy_from_bbox(Page.figure.gca().bbox) G2frame.cid = Page.canvas.mpl_connect('motion_notify_event', OnDragLine) pick.set_linestyle('--') # back to dashed else: # a profile point, e.g. a peak if mouse.button == 1: # El = data['ElList'].keys()[0] Peaks['Peaks'].append([xy[0],(xy[1]-Peaks['Background'][1][1]*xy[0])/4.7,.085,'','O','O',0.]) Peaks['Peaks'] = G2mth.sortArray(Peaks['Peaks'],0,reverse=False) PlotISFG(G2frame,data,peaks=Peaks,newPlot=False) G2pdG.UpdatePDFPeaks(G2frame,Peaks,data) def OnRelease(event): if Peaks == None: return if G2frame.itemPicked == None: return if G2frame.cid is not None: # if there is a drag connection, delete it Page.canvas.mpl_disconnect(G2frame.cid) G2frame.cid = None if event.xdata is None or event.ydata is None: # ignore drag if cursor is outside of plot Page.canvas.mpl_disconnect(G2frame.cid) G2frame.cid = None PlotISFG(G2frame,data,peaks=Peaks,newPlot=False) return lines = [] for line in G2frame.Lines: lines.append(line.get_xdata()[0]) try: lineNo = lines.index(G2frame.itemPicked.get_xdata()[0]) except ValueError: lineNo = -1 if lineNo in [0,1]: Peaks['Limits'][lineNo] = event.xdata if event.button == 3: del Peaks['Peaks'][lineNo-2] G2frame.itemPicked = None G2pdG.UpdatePDFPeaks(G2frame,Peaks,data) PlotISFG(G2frame,data,peaks=Peaks,newPlot=False) # PlotISFG continues here ############################################################ xylim = [] new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab(plotType,'mpl') if not new: if not newPlot: xylim = lim else: newPlot = True G2frame.Cmin = 0.0 G2frame.Cmax = 1.0 Page.canvas.mpl_connect('key_press_event', OnPlotKeyPress) Page.canvas.mpl_connect('key_release_event', OnPlotKeyUp) Page.canvas.mpl_connect('motion_notify_event', OnMotion) Page.canvas.mpl_connect('pick_event', OnPick) Page.canvas.mpl_connect('button_release_event', OnRelease) Page.Offset = [0,0] G2frame.G2plotNB.status.DestroyChildren() #get rid of special stuff on status bar if Peaks == None: if G2frame.Contour: Page.Choice = (' key press','d: lower contour max','u: raise contour max', 'D: lower contour min','U: raise contour min','o: reset to default', 'i: interpolation method','s: color scheme','c: contour off','f: select data', ) else: Page.Choice = (' key press','l: offset left','r: offset right','d/D: offset down/10x','u/U: offset up/10x', 'o: reset offset','t: toggle legend','c: contour on','w: toggle waterfall colors (slow!)', 'm: toggle multiplot','s: color scheme','f: select data' ) Page.keyPress = OnPlotKeyPress else: G2frame.cid = None Page.Choice = () PatternId = G2frame.PatternId if not PatternId: return pId = G2gd.GetGPXtreeItemId(G2frame,PatternId, 'PDF Controls') if not pId: return PDFdata = G2frame.GPXtree.GetItemPyData(pId) numbDen = 0. if 'ElList' in PDFdata: numbDen = G2pwd.GetNumDensity(PDFdata['ElList'],PDFdata['Form Vol']) if G2frame.SinglePlot: if 'G(R)' not in data: return PlotList = [data[plotType],] try: name = PlotList[0][2] except: name = '' else: PlotList = [] if G2frame.PDFselections is None: choices = G2gd.GetGPXtreeDataNames(G2frame,'PDF ') else: choices = G2frame.PDFselections for item in choices: Pid = G2gd.GetGPXtreeItemId(G2frame,G2frame.root,item) Id = G2gd.GetGPXtreeItemId(G2frame,Pid,'PDF Controls') Pattern = G2frame.GPXtree.GetItemPyData(Id) if Pattern: PlotList.append(Pattern[plotType]) name = plotType if plotType == 'G(R)': Plot.set_xlabel(r'r,$\AA$',fontsize=14) Plot.set_ylabel(r'G(r), $\AA^{-2}$',fontsize=14) else: Plot.set_xlabel(r'$Q,\AA^{-1}$',fontsize=14) Plot.set_ylabel(r''+plotType,fontsize=14) Plot.set_title(name) colors=['b','g','r','c','m','k'] Ymax = 0.01 lenX = 0 for Pattern in PlotList: if not len(Pattern): return #no PDF's yet xye = Pattern[1] Ymax = max(Ymax,max(xye[1])) XYlist = [] if G2frame.Contour: ContourZ = [] ContourY = [] Nseq = 0 for N,Pattern in enumerate(PlotList): xye = Pattern[1] X = xye[0] if not lenX: lenX = len(X) if G2frame.Contour and len(PlotList)>1: Y = xye[1] if lenX == len(X): ContourY.append(N) ContourZ.append(Y) ContourX = X Nseq += 1 Plot.set_ylabel('Data sequence',fontsize=12) else: X = xye[0]+Page.Offset[0]*.005*N Y = xye[1]+Page.Offset[1]*.01*N XYlist.append(list(zip(X,Y))) # if G2frame.Legend: # Plot.plot(X,Y,colors[N%6],picker=False,label='Azm:'+Pattern[2].split('=')[1]) # else: # Plot.plot(X,Y,colors[N%6],picker=False) if G2frame.Contour and len(PlotList)>1: acolor = mpl.cm.get_cmap(G2frame.ContourColor) Img = Plot.imshow(ContourZ,cmap=acolor,vmin=Ymax*G2frame.Cmin,vmax=Ymax*G2frame.Cmax,interpolation=G2frame.Interpolate, extent=[ContourX[0],ContourX[-1],ContourY[0],ContourY[-1]],aspect='auto',origin='lower') Page.figure.colorbar(Img) else: XYlist = np.array(XYlist) Xmin = np.amin(XYlist.T[0]) Xmax = np.amax(XYlist.T[0]) dx = 0.02*(Xmax-Xmin) Ymin = np.amin(XYlist.T[1]) Ymax = np.amax(XYlist.T[1]) dy = 0.02*(Ymax-Ymin) Plot.set_xlim(Xmin-dx,Xmax+dx) Plot.set_ylim(Ymin-dy,Ymax+dy) if Peaks == None: normcl = mpcls.Normalize(Ymin,Ymax) acolor = mpl.cm.get_cmap(G2frame.ContourColor) wx.BeginBusyCursor() if XYlist.shape[0]>1: if G2frame.Waterfall: for xylist in XYlist: ymin = np.amin(xylist.T[1]) ymax = np.amax(xylist.T[1]) normcl = mpcls.Normalize(ymin,ymax) colorRange = xylist.T[1] segs = np.reshape(np.hstack((xylist[:-1],xylist[1:])),(-1,2,2)) line = mplC.LineCollection(segs,cmap=acolor,norm=normcl) line.set_array(colorRange) Plot.add_collection(line) axcb = Page.figure.colorbar(line) axcb.set_label(plotType) else: #ok lines = mplC.LineCollection(XYlist,cmap=acolor) lines.set_array(np.arange(XYlist.shape[0])) Plot.add_collection(lines) axcb = Page.figure.colorbar(lines) axcb.set_label('PDF number') lgndlist = [] if G2frame.Legend: # make short names from choices dropping PDF and AZM and then extension labels = [os.path.splitext(i[3:i.find('Azm')].strip())[0] for i in choices] numlines = len(labels) # create an empty labeled line for each label with color from color map for i,lbl in enumerate(labels): color = acolor(int(0.5+acolor.N*i/(numlines-1.))) lgndlist.append(mpl.lines.Line2D([], [], color=color, label=lbl)) Plot.legend(handles=lgndlist,loc='best') else: if G2frame.Waterfall: colorRange = XYlist[0].T[1] segs = np.reshape(np.hstack((XYlist[0][:-1],XYlist[0][1:])),(-1,2,2)) line = mplC.LineCollection(segs,cmap=acolor,norm=normcl) line.set_array(colorRange) Plot.add_collection(line) axcb = Page.figure.colorbar(line) axcb.set_label('Intensity') else: #ok line = mplC.LineCollection(XYlist,color=colors[0]) Plot.add_collection(line) wx.EndBusyCursor() if plotType == 'G(R)' and numbDen: Xb = [0.,2.5] Yb = [0.,-10.*np.pi*numbDen] Plot.plot(Xb,Yb,color='k',dashes=(5,5)) elif plotType == 'F(Q)': Plot.axhline(0.,color='k') elif plotType == 'S(Q)': Plot.axhline(1.,color='k') else: G2frame.Lines = [] X = XYlist[0].T[0] Y = XYlist[0].T[1] Plot.plot(X,Y,color='b',picker=3) if 'calc' in Peaks and len(Peaks['calc']): XC,YC= Peaks['calc'] Plot.plot(XC,YC,color='g') G2frame.Lines.append(Plot.axvline(peaks['Limits'][0],color='g',dashes=(5,5),picker=2.)) G2frame.Lines.append(Plot.axvline(peaks['Limits'][1],color='r',dashes=(5,5),picker=2.)) for peak in Peaks['Peaks']: G2frame.Lines.append(Plot.axvline(peak[0],color='r',picker=2.)) Xb = [0.,peaks['Limits'][1]] Yb = [0.,Xb[1]*peaks['Background'][1][1]] Plot.plot(Xb,Yb,color='k',dashes=(5,5)) # elif G2frame.Legend: # Plot.legend(loc='best') if not newPlot: Page.toolbar.push_current() Plot.set_xlim(xylim[0]) Plot.set_ylim(xylim[1]) xylim = [] Page.toolbar.push_current() Page.toolbar.draw() else: Page.canvas.draw() ################################################################################ ##### PlotCalib ################################################################################ def PlotCalib(G2frame,Inst,XY,Sigs,newPlot=False): '''plot of CW or TOF peak calibration ''' def OnMotion(event): xpos = event.xdata if xpos: #avoid out of frame mouse position ypos = event.ydata Page.canvas.SetCursor(wx.CROSS_CURSOR) try: G2frame.G2plotNB.status.SetStatusText('X =%9.3f %s =%9.3g'%(xpos,Title,ypos),1) except TypeError: G2frame.G2plotNB.status.SetStatusText('Select '+Title+' pattern first',1) found = [] wid = 1 view = Page.toolbar._views.forward() if view: view = view[0][:2] wid = view[1]-view[0] found = XY[np.where(np.fabs(XY.T[0]-xpos) < 0.005*wid)] if len(found): pos = found[0][1] if 'C' in Inst['Type'][0]: Page.SetToolTipString('position=%.4f'%(pos)) else: Page.SetToolTipString('position=%.2f'%(pos)) else: Page.SetToolTipString('') xylim = [] Title = 'Position calibration' new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab(Title,'mpl') if not new: if not newPlot: xylim = lim else: newPlot = True Page.canvas.mpl_connect('motion_notify_event', OnMotion) Page.Choice = None G2frame.G2plotNB.status.DestroyChildren() #get rid of special stuff on status bar Plot.set_title(Title) Plot.set_xlabel(r'd-spacing',fontsize=14) if 'C' in Inst['Type'][0]: Plot.set_ylabel(r'$\mathsf{\Delta(2\theta)}$',fontsize=14) else: Plot.set_ylabel(r'$\mathsf{\Delta}T/T$',fontsize=14) for ixy,xyw in enumerate(XY): if len(xyw) > 2: X,Y,W = xyw else: X,Y = xyw W = 0. Yc = G2lat.Dsp2pos(Inst,X) if 'C' in Inst['Type'][0]: Y = Y-Yc E = Sigs[ixy] bin = W/2. else: Y = (Y-Yc)/Yc E = Sigs[ixy]/Yc bin = W/(2.*Yc) if E: Plot.errorbar(X,Y,ecolor='k',yerr=E) if ixy: Plot.plot(X,Y,'kx',picker=3) else: Plot.plot(X,Y,'kx',label='peak') if W: if ixy: Plot.plot(X,bin,'b+') else: Plot.plot(X,bin,'b+',label='bin width') Plot.plot(X,-bin,'b+') Plot.axhline(0.,color='r',linestyle='--') Plot.legend(loc='best') if not newPlot: Page.toolbar.push_current() Plot.set_xlim(xylim[0]) Plot.set_ylim(xylim[1]) # xylim = [] Page.toolbar.push_current() Page.toolbar.draw() else: Page.canvas.draw() ################################################################################ ##### PlotXY ################################################################################ def PlotXY(G2frame,XY,XY2=None,labelX='X',labelY='Y',newPlot=False, Title='',lines=False,names=[],names2=[],vertLines=[]): '''simple plot of xy data :param wx.Frame G2frame: The main GSAS-II tree "window" :param list XY: a list of X,Y array pairs; len(X) = len(Y) :param list XY2: a secondary list of X,Y pairs :param str labelX: label for X-axis :param str labelY: label for Y-axis :param bool newPlot: =True if new plot is to be made :param str Title: title for plot :param bool lines: = True if lines desired for XY plot; XY2 always plotted as lines :param list names: legend names for each XY plot as list a of str values :param list names2: legend names for each XY2 plot as list a of str values :param list vertLines: lists of vertical line x-positions; can be one for each XY :returns: nothing ''' global xylim def OnKeyPress(event): if event.key == 'u': if Page.Offset[1] < 100.: Page.Offset[1] += 1. elif event.key == 'd': if Page.Offset[1] > 0.: Page.Offset[1] -= 1. elif event.key == 'l': Page.Offset[0] -= 1. elif event.key == 'r': Page.Offset[0] += 1. elif event.key == 'o': Page.Offset = [0,0] elif event.key == 's': if len(XY): G2IO.XYsave(G2frame,XY,labelX,labelY,names) if XY2 != []: G2IO.XYsave(G2frame,XY2,labelX,labelY,names2) # else: # return Draw() def OnMotion(event): xpos = event.xdata if xpos: #avoid out of frame mouse position ypos = event.ydata Page.canvas.SetCursor(wx.CROSS_CURSOR) try: G2frame.G2plotNB.status.SetStatusText('X =%9.3f %s =%9.3f'%(xpos,Title,ypos),1) except TypeError: G2frame.G2plotNB.status.SetStatusText('Select '+Title+' pattern first',1) def Draw(): global xylim Plot.clear() Plot.set_title(Title) Plot.set_xlabel(r''+labelX,fontsize=14) Plot.set_ylabel(r''+labelY,fontsize=14) colors=['b','r','g','c','m','k'] Page.keyPress = OnKeyPress Xmax = 0. Ymax = 0. for ixy,xy in enumerate(XY): X,Y = XY[ixy] Xmax = max(Xmax,max(X)) Ymax = max(Ymax,max(Y)) if lines: dX = Page.Offset[0]*(ixy)*Xmax/500. dY = Page.Offset[1]*(ixy)*Ymax/100. if len(names): Plot.plot(X+dX,Y+dY,colors[ixy%6],picker=False,label=names[ixy]) else: Plot.plot(X+dX,Y+dY,colors[ixy%6],picker=False) else: Plot.plot(X,Y,colors[ixy%6]+'+',picker=False) if len(vertLines): for ixy,X in enumerate(vertLines): dX = Page.Offset[0]*(ixy)*Xmax/500. for x in X: Plot.axvline(x+dX,color=colors[ixy%6],dashes=(5,5),picker=False) if XY2 is not None and len(XY2): for ixy,xy in enumerate(XY2): X,Y = XY2[ixy] dX = Page.Offset[0]*(ixy+1)*Xmax/500. dY = Page.Offset[1]*(ixy+1)*Ymax/100. if len(names2): Plot.plot(X+dX,Y+dY,colors[ixy%6],picker=False,label=names2[ixy]) else: Plot.plot(X+dX,Y+dY,colors[ixy%6],picker=False) if len(names): Plot.legend(names,loc='best') if not newPlot: Page.toolbar.push_current() Plot.set_xlim(xylim[0]) Plot.set_ylim(xylim[1]) xylim = [] Page.toolbar.push_current() Page.toolbar.draw() Page.canvas.draw() else: Page.canvas.draw() new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab(Title,'mpl') Page.Offset = [0,0] if not new: if not newPlot: xylim = lim else: newPlot = True Page.canvas.mpl_connect('key_press_event', OnKeyPress) Page.canvas.mpl_connect('motion_notify_event', OnMotion) Page.Offset = [0,0] if lines: Page.Choice = (' key press','l: offset left','r: offset right','d: offset down', 'u: offset up','o: reset offset','s: save data as csv file') else: Page.Choice = None Draw() ################################################################################ ##### PlotXYZ ################################################################################ def PlotXYZ(G2frame,XY,Z,labelX='X',labelY='Y',newPlot=False,Title='',zrange=None,color=None): '''simple contour plot of xyz data :param wx.Frame G2frame: The main GSAS-II tree "window" :param list XY: a list of X,Y arrays :param list Z: a list of Z values for each X,Y pair :param str labelX: label for X-axis :param str labelY: label for Y-axis :param bool newPlot: =True if new plot is to be made :param str Title: title for plot :param list zrange: [zmin,zmax]; default=None to use limits in Z :param str color: one of mpl.cm.dated.keys(); default=None to use G2frame.ContourColor :returns: nothing ''' def OnKeyPress(event): if event.key == 'u': G2frame.Cmax = min(1.0,G2frame.Cmax*1.2) elif event.key == 'd': G2frame.Cmax = max(0.0,G2frame.Cmax*0.8) elif event.key == 'o': G2frame.Cmax = 1.0 elif event.key == 'i': choice = ['nearest','bilinear','bicubic','spline16','spline36','hanning', 'hamming','hermite','kaiser','quadric','catrom','gaussian','bessel', 'mitchell','sinc','lanczos'] dlg = wx.SingleChoiceDialog(G2frame,'Select','Interpolation',choice) if dlg.ShowModal() == wx.ID_OK: sel = dlg.GetSelection() G2frame.Interpolate = choice[sel] else: G2frame.Interpolate = 'nearest' dlg.Destroy() elif event.key == 's': choice = [m for m in mpl.cm.datad.keys()] # if not m.endswith("_r") choice.sort() dlg = wx.SingleChoiceDialog(G2frame,'Select','Color scheme',choice) if dlg.ShowModal() == wx.ID_OK: sel = dlg.GetSelection() G2frame.ContourColor = choice[sel] else: G2frame.ContourColor = GSASIIpath.GetConfigValue('Contour_color','RdYlGn') dlg.Destroy() wx.CallAfter(PlotXYZ,G2frame,XY,Z,labelX,labelY,False,Title) def OnMotion(event): xpos = event.xdata if Xminthresh[0][1],'r','b')) Plot1.barh(np.arange(len(resNames)),Probs1,color=colors,linewidth=0) if thresh is not None: for item in thresh[0]: Plot1.axvline(item,dashes=(5,5),picker=False) Plot2 = Page.figure.add_subplot(212) Plot2.set_xlabel(r'Error score 2',fontsize=14) Plot2.set_ylabel(r'Residue',fontsize=14) colors = list(np.where(np.array(Probs2)>thresh[1][1],'r','b')) Plot2.barh(np.arange(len(resNames)),Probs2,color=colors,linewidth=0) if thresh is not None: for item in thresh[1]: Plot2.axvline(item,dashes=(5,5),picker=False) Page.canvas.draw() new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab(Title,'mpl') Page.Offset = [0,0] if not new: if not newPlot: xylim = lim else: newPlot = True # Page.canvas.mpl_connect('key_press_event', OnKeyPress) Page.canvas.mpl_connect('motion_notify_event', OnMotion) Page.Offset = [0,0] Page.Choice = None Draw() ################################################################################ ##### PlotStrain ################################################################################ def PlotStrain(G2frame,data,newPlot=False): '''plot of strain data, used for diagnostic purposes ''' def OnMotion(event): xpos = event.xdata if xpos: #avoid out of frame mouse position ypos = event.ydata Page.canvas.SetCursor(wx.CROSS_CURSOR) try: G2frame.G2plotNB.status.SetStatusText('d-spacing =%9.5f Azimuth =%9.3f'%(ypos,xpos),1) except TypeError: G2frame.G2plotNB.status.SetStatusText('Select Strain pattern first',1) new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('Strain','mpl') if not new: if not newPlot: xylim = lim else: newPlot = True Page.canvas.mpl_connect('motion_notify_event', OnMotion) Page.Choice = None G2frame.G2plotNB.status.DestroyChildren() #get rid of special stuff on status bar Plot.set_title('Strain') Plot.set_ylabel(r'd-spacing',fontsize=14) Plot.set_xlabel(r'Azimuth',fontsize=14) colors=['b','g','r','c','m','k'] for N,item in enumerate(data['d-zero']): Y,X = np.array(item['ImtaObs']) #plot azimuth as X & d-spacing as Y Plot.plot(X,Y,colors[N%6]+'+',picker=False) Y,X = np.array(item['ImtaCalc']) Plot.plot(X,Y,colors[N%6],picker=False) Plot.plot([0.,360.],[item['Dcalc'],item['Dcalc']],colors[5],dashes=(5,5)) if not newPlot: Page.toolbar.push_current() Plot.set_xlim(xylim[0]) Plot.set_ylim(xylim[1]) xylim = [] Page.toolbar.push_current() Page.toolbar.draw() else: Page.canvas.draw() ################################################################################ ##### PlotSASDSizeDist ################################################################################ def PlotSASDSizeDist(G2frame): def OnPageChanged(event): PlotText = G2frame.G2plotNB.nb.GetPageText(G2frame.G2plotNB.nb.GetSelection()) if 'Powder' in PlotText: PlotPatterns(G2frame,plotType='SASD',newPlot=True) elif 'Size' in PlotText: PlotSASDSizeDist(G2frame) def OnMotion(event): xpos = event.xdata if xpos: #avoid out of frame mouse position ypos = event.ydata Page.canvas.SetCursor(wx.CROSS_CURSOR) try: G2frame.G2plotNB.status.SetStatusText('diameter =%9.3f f(D) =%9.3g'%(xpos,ypos),1) except TypeError: G2frame.G2plotNB.status.SetStatusText('Select Strain pattern first',1) new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('Size Distribution','mpl') if new: G2frame.G2plotNB.Bind(wx.aui.EVT_AUINOTEBOOK_PAGE_CHANGED,OnPageChanged) Page.canvas.mpl_connect('motion_notify_event', OnMotion) Page.Choice = None PatternId = G2frame.PatternId data = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,PatternId, 'Models')) Bins,Dbins,BinMag = data['Size']['Distribution'] Plot.set_title('Size Distribution') Plot.set_xlabel(r'$D, \AA$',fontsize=14) Plot.set_ylabel(r'$Volume distribution f(D)$',fontsize=14) if data['Size']['logBins']: Plot.set_xscale("log",nonposy='mask') Plot.set_xlim([np.min(2.*Bins)/2.,np.max(2.*Bins)*2.]) Plot.bar(2.*Bins-Dbins,BinMag,2.*Dbins,facecolor='green') #plot diameters colors=['b','r','c','m','k'] if 'Size Calc' in data: Rbins,Dist = data['Size Calc'] for i in range(len(Rbins)): if len(Rbins[i]): Plot.plot(2.*Rbins[i],Dist[i],color=colors[i%5]) #plot diameters Page.canvas.draw() ################################################################################ ##### PlotPowderLines ################################################################################ def PlotPowderLines(G2frame): ''' plotting of powder lines (i.e. no powder pattern) as sticks ''' def OnMotion(event): xpos = event.xdata if xpos: #avoid out of frame mouse position Page.canvas.SetCursor(wx.CROSS_CURSOR) G2frame.G2plotNB.status.SetStatusText('2-theta =%9.3f '%(xpos,),1) if G2frame.PickId and G2frame.GPXtree.GetItemText(G2frame.PickId) in ['Index Peak List','Unit Cells List']: found = [] if len(G2frame.HKL): view = Page.toolbar._views.forward()[0][:2] wid = view[1]-view[0] found = G2frame.HKL[np.where(np.fabs(G2frame.HKL.T[-1]-xpos) < 0.002*wid)] if len(found): h,k,l = found[0][:3] Page.SetToolTipString('%d,%d,%d'%(int(h),int(k),int(l))) else: Page.SetToolTipString('') new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('Powder Lines','mpl') if new: Page.canvas.mpl_connect('motion_notify_event', OnMotion) Page.Choice = None Plot.set_title('Powder Pattern Lines') Plot.set_xlabel(r'$\mathsf{2\theta}$',fontsize=14) PatternId = G2frame.PatternId peaks = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,PatternId, 'Index Peak List'))[0] for peak in peaks: Plot.axvline(peak[0],color='b') for hkl in G2frame.HKL: Plot.axvline(hkl[-2],color='r',dashes=(5,5)) xmin = peaks[0][0] xmax = peaks[-1][0] delt = xmax-xmin xlim = [max(0,xmin-delt/20.),min(180.,xmax+delt/20.)] Plot.set_xlim(xlim) Page.canvas.draw() Page.toolbar.push_current() ################################################################################ ##### PlotPeakWidths ################################################################################ def PlotPeakWidths(G2frame,PatternName=None): ''' Plotting of instrument broadening terms as function of 2-theta Seen when "Instrument Parameters" chosen from powder pattern data tree. Parameter PatternName allows the PWDR to be referenced as a string rather than a wx tree item, defined in G2frame.PatternId. ''' # sig = lambda Th,U,V,W: 1.17741*math.sqrt(U*tand(Th)**2+V*tand(Th)+W)*math.pi/18000. # gam = lambda Th,X,Y: (X/cosd(Th)+Y*tand(Th))*math.pi/18000. # gamFW = lambda s,g: np.exp(np.log(s**5+2.69269*s**4*g+2.42843*s**3*g**2+4.47163*s**2*g**3+0.07842*s*g**4+g**5)/5.) # gamFW2 = lambda s,g: math.sqrt(s**2+(0.4654996*g)**2)+.5345004*g #Ubaldo Bafile - private communication if PatternName: G2frame.PatternId = G2gd.GetGPXtreeItemId(G2frame, G2frame.root, PatternName) PatternId = G2frame.PatternId limitID = G2gd.GetGPXtreeItemId(G2frame,PatternId, 'Limits') if limitID: limits = G2frame.GPXtree.GetItemPyData(limitID)[:2] else: return Parms,Parms2 = G2frame.GPXtree.GetItemPyData( \ G2gd.GetGPXtreeItemId(G2frame,PatternId, 'Instrument Parameters')) if 'PKS' in Parms['Type'][0]: return elif 'T' in Parms['Type'][0]: difC = Parms['difC'][0] else: lam = G2mth.getWave(Parms) try: # PATCH: deal with older peak lists, before changed to dict to implement TOF peaks = G2frame.GPXtree.GetItemPyData(G2gd.GetGPXtreeItemId(G2frame,PatternId, 'Peak List'))['peaks'] except TypeError: print ("Your peak list needs reformatting...",end='') item = G2gd.GetGPXtreeItemId(G2frame,PatternId, 'Peak List') G2frame.GPXtree.SelectItem(item) item = G2gd.GetGPXtreeItemId(G2frame,PatternId, 'Instrument Parameters') G2frame.GPXtree.SelectItem(item) print ("done") return xylim = [] new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('Peak Widths','mpl') if not new: if not G2frame.G2plotNB.allowZoomReset: # save previous limits xylim = lim # save information needed to reload from tree and redraw G2frame.G2plotNB.RegisterRedrawRoutine(G2frame.G2plotNB.lastRaisedPlotTab, PlotPeakWidths,(G2frame,G2frame.GPXtree.GetItemText(G2frame.PatternId)) ) TreeItemText = G2frame.GPXtree.GetItemText(G2frame.PatternId) G2frame.G2plotNB.status.SetStatusText('histogram: '+TreeItemText,1) Page.Choice = None Page.SetToolTipString('') X = [] Y = [] Z = [] W = [] if 'C' in Parms['Type'][0]: Plot.set_title('Instrument and sample peak widths') Plot.set_xlabel(r'$Q, \AA^{-1}$',fontsize=14) Plot.set_ylabel(r'$\Delta Q/Q, \Delta d/d$',fontsize=14) Xmin,Xmax = limits[1] X = np.linspace(Xmin,Xmax,num=101,endpoint=True) Q = 4.*np.pi*npsind(X/2.)/lam Z = np.ones_like(X) data = G2mth.setPeakparms(Parms,Parms2,X,Z) s = np.sqrt(data[4])*np.pi/18000. #var -> sig(radians) g = data[6]*np.pi/18000. #centideg -> radians G = G2pwd.getgamFW(g,s)/2. #delt-theta Y = s/nptand(X/2.) Z = g/nptand(X/2.) W = G/nptand(X/2.) Plot.plot(Q,Y,color='r',label='Gaussian') Plot.plot(Q,Z,color='g',label='Lorentzian') Plot.plot(Q,W,color='b',label='G+L') fit = G2mth.setPeakparms(Parms,Parms2,X,Z,useFit=True) sf = np.sqrt(fit[4])*np.pi/18000. gf = fit[6]*np.pi/18000. Gf = G2pwd.getgamFW(gf,sf)/2. Yf = sf/nptand(X/2.) Zf = gf/nptand(X/2.) Wf = Gf/nptand(X/2.) Plot.plot(Q,Yf,color='r',dashes=(5,5),label='Gaussian fit') Plot.plot(Q,Zf,color='g',dashes=(5,5),label='Lorentzian fit') Plot.plot(Q,Wf,color='b',dashes=(5,5),label='G+L fit') X = [] Y = [] Z = [] W = [] for peak in peaks: X.append(4.0*math.pi*sind(peak[0]/2.0)/lam) try: s = math.sqrt(peak[4])*math.pi/18000. except ValueError: s = 0.01 g = peak[6]*math.pi/18000. G = G2pwd.getgamFW(g,s)/2. Y.append(s/tand(peak[0]/2.)) Z.append(g/tand(peak[0]/2.)) W.append(G/tand(peak[0]/2.)) if len(peaks): Plot.plot(X,Y,'+',color='r',label='G peak') Plot.plot(X,Z,'+',color='g',label='L peak') Plot.plot(X,W,'+',color='b',label='G+L peak') Plot.legend(loc='best') Page.canvas.draw() else: #'T'OF Plot.set_title('Instrument and sample peak coefficients') Plot.set_xlabel(r'$Q, \AA^{-1}$',fontsize=14) Plot.set_ylabel(r'$\alpha, \beta, \Delta Q/Q, \Delta d/d$',fontsize=14) Xmin,Xmax = limits[1] T = np.linspace(Xmin,Xmax,num=101,endpoint=True) Z = np.ones_like(T) data = G2mth.setPeakparms(Parms,Parms2,T,Z) ds = T/difC Q = 2.*np.pi/ds A = data[4] B = data[6] S = 1.17741*np.sqrt(data[8])/T G = data[10]/T Plot.plot(Q,A,color='r',label='Alpha') Plot.plot(Q,B,color='g',label='Beta') Plot.plot(Q,S,color='b',label='Gaussian') Plot.plot(Q,G,color='m',label='Lorentzian') fit = G2mth.setPeakparms(Parms,Parms2,T,Z) ds = T/difC Q = 2.*np.pi/ds Af = fit[4] Bf = fit[6] Sf = 1.17741*np.sqrt(fit[8])/T Gf = fit[10]/T Plot.plot(Q,Af,color='r',dashes=(5,5),label='Alpha fit') Plot.plot(Q,Bf,color='g',dashes=(5,5),label='Beta fit') Plot.plot(Q,Sf,color='b',dashes=(5,5),label='Gaussian fit') Plot.plot(Q,Gf,color='m',dashes=(5,5),label='Lorentzian fit') T = [] A = [] B = [] S = [] G = [] W = [] Q = [] for peak in peaks: T.append(peak[0]) A.append(peak[4]) B.append(peak[6]) Q.append(2.*np.pi*difC/peak[0]) S.append(1.17741*np.sqrt(peak[8])/peak[0]) G.append(peak[10]/peak[0]) Plot.plot(Q,A,'+',color='r',label='Alpha peak') Plot.plot(Q,B,'+',color='g',label='Beta peak') Plot.plot(Q,S,'+',color='b',label='Gaussian peak') Plot.plot(Q,G,'+',color='m',label='Lorentzian peak') Plot.legend(loc='best') if xylim and not G2frame.G2plotNB.allowZoomReset: # this restores previous plot limits (but I'm not sure why there are two .push_current calls) Page.toolbar.push_current() Plot.set_xlim(xylim[0]) Plot.set_ylim(xylim[1]) Page.toolbar.push_current() Page.toolbar.draw() else: Page.canvas.draw() ################################################################################ ##### PlotSizeStrainPO ################################################################################ def PlotSizeStrainPO(G2frame,data,hist='',Start=False): '''Plot 3D mustrain/size/preferred orientation figure. In this instance data is for a phase ''' def OnPick(event): if plotType not in ['Inv. pole figure',]: return ind = event.ind[0] h,k,l = RefSets[ind] msg = '%d,%d,%d=%.2f'%(h,k,l,Rmd[ind]) Page.SetToolTipString(msg) def rp2xyz(r,p): z = npcosd(r) xy = np.sqrt(1.-z**2) return xy*npcosd(p),xy*npsind(p),z def OnMotion(event): if plotType not in ['Inv. pole figure',]: return if event.xdata and event.ydata: #avoid out of frame errors xpos = event.xdata ypos = event.ydata r = xpos**2+ypos**2 if r <= 1.0: if 'equal' in G2frame.Projection: r,p = 2.*npasind(np.sqrt(r)*sq2),npatan2d(ypos,xpos) else: r,p = 2.*npatand(np.sqrt(r)),npatan2d(ypos,xpos) if p<0.: p += 360. ipf = lut(r*np.pi/180.,p*np.pi/180.) xyz = np.inner(Bmat.T,np.array([rp2xyz(r,p)])) x,y,z = list(xyz/np.max(np.abs(xyz))) G2frame.G2plotNB.status.SetStatusText( 'psi =%9.3f, beta =%9.3f, MRD =%9.3f hkl=%5.2f,%5.2f,%5.2f'%(r,p,ipf,x,y,z),1) import scipy.interpolate as si generalData = data['General'] SGData = generalData['SGData'] if Start: #initialize the spherical harmonics qlmn arrays ptx.pyqlmninit() Start = False cell = generalData['Cell'][1:] Amat,Bmat = G2lat.cell2AB(cell[:6]) useList = data['Histograms'] phase = generalData['Name'] plotType = generalData['Data plot type'] plotDict = {'Mustrain':'Mustrain','Size':'Size','Preferred orientation':'Pref.Ori.','Inv. pole figure':''} for ptype in plotDict: G2frame.G2plotNB.Delete(ptype) if plotType in ['None'] or not useList: return if hist == '': hist = list(useList.keys())[0] if plotType in ['Mustrain','Size']: new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab(plotType,'3d') else: new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab(plotType,'mpl') if not new: if not Page.IsShown(): Page.Show() else: Page.canvas.mpl_connect('pick_event', OnPick) Page.canvas.mpl_connect('motion_notify_event', OnMotion) Page.Choice = None G2frame.G2plotNB.status.SetStatusText('',1) PHI = np.linspace(0.,360.,30,True) PSI = np.linspace(0.,180.,30,True) X = np.outer(npsind(PHI),npsind(PSI)) Y = np.outer(npcosd(PHI),npsind(PSI)) Z = np.outer(np.ones(np.size(PHI)),npcosd(PSI)) try: #temp patch instead of 'mustrain' for old files with 'microstrain' if plotDict[plotType]: coeff = useList[hist][plotDict[plotType]] except KeyError: return if plotType in ['Mustrain','Size']: if coeff[0] == 'isotropic': X *= coeff[1][0] Y *= coeff[1][0] Z *= coeff[1][0] elif coeff[0] == 'uniaxial': def uniaxCalc(xyz,iso,aniso,axes): Z = np.array(axes) cp = abs(np.dot(xyz,Z)) sp = np.sqrt(1.-cp**2) R = iso*aniso/np.sqrt((iso*cp)**2+(aniso*sp)**2) return R*xyz iso,aniso = coeff[1][:2] axes = np.inner(Amat,np.array(coeff[3])) axes /= nl.norm(axes) Shkl = np.array(coeff[1]) XYZ = np.dstack((X,Y,Z)) XYZ = np.nan_to_num(np.apply_along_axis(uniaxCalc,2,XYZ,iso,aniso,axes)) X,Y,Z = np.dsplit(XYZ,3) X = X[:,:,0] Y = Y[:,:,0] Z = Z[:,:,0] elif coeff[0] == 'ellipsoidal': def ellipseCalc(xyz,E,R): XYZ = xyz*E.T return np.inner(XYZ.T,R) S6 = coeff[4] Sij = G2lat.U6toUij(S6) E,R = nl.eigh(Sij) XYZ = np.dstack((X,Y,Z)) XYZ = np.nan_to_num(np.apply_along_axis(ellipseCalc,2,XYZ,E,R)) X,Y,Z = np.dsplit(XYZ,3) X = X[:,:,0] Y = Y[:,:,0] Z = Z[:,:,0] elif coeff[0] == 'generalized': def genMustrain(xyz,SGData,A,Shkl): uvw = np.inner(Amat.T,xyz) Strm = np.array(G2spc.MustrainCoeff(uvw,SGData)) Sum = np.sum(np.multiply(Shkl,Strm)) Sum = np.where(Sum > 0.01,Sum,0.01) Sum = np.sqrt(Sum) return Sum*xyz Shkl = np.array(coeff[4]) if np.any(Shkl): XYZ = np.dstack((X,Y,Z)) XYZ = np.nan_to_num(np.apply_along_axis(genMustrain,2,XYZ,SGData,Amat,Shkl)) X,Y,Z = np.dsplit(XYZ,3) X = X[:,:,0] Y = Y[:,:,0] Z = Z[:,:,0] if np.any(X) and np.any(Y) and np.any(Z): np.seterr(all='ignore') Plot.plot_surface(X,Y,Z,rstride=1,cstride=1,color='g',linewidth=1) xyzlim = np.array([Plot.get_xlim3d(),Plot.get_ylim3d(),Plot.get_zlim3d()]).T XYZlim = [min(xyzlim[0]),max(xyzlim[1])] Plot.set_xlim3d(XYZlim) Plot.set_ylim3d(XYZlim) Plot.set_zlim3d(XYZlim) Plot.set_aspect('equal') if plotType == 'Size': Plot.set_title('Crystallite size for '+phase+'\n'+coeff[0]+' model') Plot.set_xlabel(r'X, $\mu$m') Plot.set_ylabel(r'Y, $\mu$m') Plot.set_zlabel(r'Z, $\mu$m') else: Plot.set_title(r'$\mu$strain for '+phase+'\n'+coeff[0]+' model') Plot.set_xlabel(r'X, $\mu$strain') Plot.set_ylabel(r'Y, $\mu$strain') Plot.set_zlabel(r'Z, $\mu$strain') elif plotType in ['Preferred orientation',]: h,k,l = generalData['POhkl'] if coeff[0] == 'MD': print ('March-Dollase preferred orientation plot') else: PH = np.array(generalData['POhkl']) phi,beta = G2lat.CrsAng(PH,cell[:6],SGData) SHCoef = {} for item in coeff[5]: L,N = eval(item.strip('C')) SHCoef['C%d,0,%d'%(L,N)] = coeff[5][item] ODFln = G2lat.Flnh(Start,SHCoef,phi,beta,SGData) X = np.linspace(0,90.0,26) Y = G2lat.polfcal(ODFln,'0',X,0.0) Plot.plot(X,Y,color='k',label=str(PH)) Plot.legend(loc='best') Plot.set_title('Axial distribution for HKL='+str(PH)+' in '+phase+'\n'+hist) Plot.set_xlabel(r'$\psi$',fontsize=16) Plot.set_ylabel('MRD',fontsize=14) elif plotType in ['Inv. pole figure',]: Id = G2gd.GetGPXtreeItemId(G2frame,G2frame.root,hist) rId = G2gd.GetGPXtreeItemId(G2frame,Id,'Reflection Lists') RefData = G2frame.GPXtree.GetItemPyData(rId)[phase] if 'Type' not in RefData or 'RefList' not in RefData: G2G.G2MessageBox(G2frame,'Reflection list not ready','RefData error') return Type = RefData['Type'] Refs = RefData['RefList'].T ns = 0 if RefData['Super']: ns = 1 if 'C' in Type: obsRMD = Refs[12+ns] else: obsRMD = Refs[15+ns] Phi = [] Beta = [] Rmd = [] Ops = np.array([Op[0].T for Op in SGData['SGOps']]) refSets = [np.inner(Ops,hkl) for hkl in Refs[:3].T] for ir,refSet in enumerate(refSets): refSet = np.vstack((refSet,-refSet)) #add Friedel pairs refSet = [np.where(ref[2]<0,-1.*ref,ref) for ref in refSet] #take +l of each pair then remove duplicates refSet = [str(ref).strip('[]').replace('-0',' 0') for ref in refSet] refSet = [np.fromstring(item,sep=' ') for item in set(refSet)] refSets[ir] = refSet RefSets = [] for ir,refSet in enumerate(refSets): r,beta,phi = G2lat.HKL2SpAng(refSet,cell[:6],SGData) #radius, inclination, azimuth phi *= np.pi/180. beta *= np.pi/180. Phi += list(phi) Beta += list(beta) Rmd += len(phi)*[obsRMD[ir],] RefSets += refSet RefSets = np.array(RefSets) Beta = np.abs(np.array(Beta)) Phi = np.array(Phi) Phi=np.where(Phi<0.,Phi+2.*np.pi,Phi) Rmd = np.array(Rmd) Rmd = np.where(Rmd<0.,0.,Rmd) if 'equal' in G2frame.Projection: x,y = np.tan(Beta/2.)*np.cos(Phi),np.tan(Beta/2.)*np.sin(Phi) else: x,y = np.tan(Beta/2.)*np.cos(Phi),np.tan(Beta/2.)*np.sin(Phi) sq2 = 1.0/math.sqrt(2.0) npts = 201 X,Y = np.meshgrid(np.linspace(1.,-1.,npts),np.linspace(-1.,1.,npts)) R,P = np.sqrt(X**2+Y**2).flatten(),npatan2d(X,Y).flatten() P=np.where(P<0.,P+360.,P) if 'equal' in G2frame.Projection: R = np.where(R <= 1.,2.*npasind(R*sq2),0.0) else: R = np.where(R <= 1.,2.*npatand(R),0.0) Z = np.zeros_like(R) # GSASIIpath.IPyBreak() try: sfac = 0.1 while True: try: lut = si.SmoothSphereBivariateSpline(Beta,Phi,Rmd,s=sfac) break except ValueError: sfac *= 1.05 Z = [lut(ri*np.pi/180.,p*np.pi/180.) for ri,p in zip(list(R),list(P))] print ('IVP for histogramn: %s: interpolate sfactor: %.2f'%(hist,sfac)) except AttributeError: G2frame.G2plotNB.Delete(plotType) G2G.G2MessageBox(G2frame,'IVP interpolate error: scipy needs to be 0.11.0 or newer', 'IVP error') return Z = np.reshape(Z,(npts,npts)) try: CS = Plot.contour(Y,X,Z,aspect='equal') Plot.clabel(CS,fontsize=9,inline=1) except ValueError: pass acolor = mpl.cm.get_cmap(G2frame.ContourColor) Img = Plot.imshow(Z.T,aspect='equal',cmap=acolor,extent=[-1,1,-1,1]) Plot.plot(-x,y,'+',picker=3) Page.figure.colorbar(Img) Plot.axis('off') Plot.set_title('0 0 1 Inverse pole figure for %s\n%s'%(phase,hist)) Page.canvas.draw() ################################################################################ ##### PlotTexture ################################################################################ def PlotTexture(G2frame,data,Start=False): '''Pole figure, inverse pole figure plotting. dict generalData contains all phase info needed which is in data ''' shModels = ['cylindrical','none','shear - 2/m','rolling - mmm'] SamSym = dict(zip(shModels,['0','-1','2/m','mmm'])) # PatternId = G2frame.PatternId generalData = data['General'] SGData = generalData['SGData'] pName = generalData['Name'] textureData = generalData['SH Texture'] G2frame.G2plotNB.Delete('Texture') if not textureData['Order']: return #no plot!! SHData = generalData['SH Texture'] SHCoef = SHData['SH Coeff'][1] cell = generalData['Cell'][1:7] Amat,Bmat = G2lat.cell2AB(cell) sq2 = 1.0/math.sqrt(2.0) def rp2xyz(r,p): z = npcosd(r) xy = np.sqrt(1.-z**2) return xy*npsind(p),xy*npcosd(p),z def OnMotion(event): SHData = data['General']['SH Texture'] if event.xdata and event.ydata: #avoid out of frame errors xpos = event.xdata ypos = event.ydata if 'Inverse' in SHData['PlotType']: r = xpos**2+ypos**2 if r <= 1.0: if 'equal' in G2frame.Projection: r,p = 2.*npasind(np.sqrt(r)*sq2),npatan2d(ypos,xpos) else: r,p = 2.*npatand(np.sqrt(r)),npatan2d(ypos,xpos) ipf = G2lat.invpolfcal(IODFln,SGData,np.array([r,]),np.array([p,])) xyz = np.inner(Bmat,np.array([rp2xyz(r,p)])) y,x,z = list(xyz/np.max(np.abs(xyz))) G2frame.G2plotNB.status.SetStatusText( 'psi =%9.3f, beta =%9.3f, MRD =%9.3f hkl=%5.2f,%5.2f,%5.2f'%(r,p,ipf,x,y,z),1) elif 'Axial' in SHData['PlotType']: pass else: #ordinary pole figure z = xpos**2+ypos**2 if z <= 1.0: z = np.sqrt(z) if 'equal' in G2frame.Projection: r,p = 2.*npasind(z*sq2),npatan2d(ypos,xpos) else: r,p = 2.*npatand(z),npatan2d(ypos,xpos) pf = G2lat.polfcal(ODFln,SamSym[textureData['Model']],np.array([r,]),np.array([p,])) G2frame.G2plotNB.status.SetStatusText('phi =%9.3f, gam =%9.3f, MRD =%9.3f'%(r,p,pf),1) if '3D' in SHData['PlotType']: new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('Texture','3d') else: new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('Texture','mpl') if not new: if not Page.IsShown(): Page.Show() else: Page.canvas.mpl_connect('motion_notify_event', OnMotion) Page.Choice = None G2frame.G2plotNB.status.SetStatusText('') G2frame.G2plotNB.status.SetStatusWidths([150,-1]) PH = np.array(SHData['PFhkl']) phi,beta = G2lat.CrsAng(PH,cell,SGData) ODFln = G2lat.Flnh(Start,SHCoef,phi,beta,SGData) if not np.any(ODFln): return PX = np.array(SHData['PFxyz']) gam = atan2d(PX[0],PX[1]) xy = math.sqrt(PX[0]**2+PX[1]**2) xyz = math.sqrt(PX[0]**2+PX[1]**2+PX[2]**2) psi = asind(xy/xyz) IODFln = G2lat.Glnh(Start,SHCoef,psi,gam,SamSym[textureData['Model']]) if 'Axial' in SHData['PlotType']: X = np.linspace(0,90.0,26) Y = G2lat.polfcal(ODFln,SamSym[textureData['Model']],X,0.0) Plot.plot(X,Y,color='k',label=str(SHData['PFhkl'])) Plot.legend(loc='best') h,k,l = SHData['PFhkl'] Plot.set_title('%d %d %d Axial distribution for %s'%(h,k,l,pName)) Plot.set_xlabel(r'$\psi$',fontsize=16) Plot.set_ylabel('MRD',fontsize=14) else: npts = 201 if 'Inverse' in SHData['PlotType']: X,Y = np.meshgrid(np.linspace(1.,-1.,npts),np.linspace(-1.,1.,npts)) R,P = np.sqrt(X**2+Y**2).flatten(),npatan2d(X,Y).flatten() if 'equal' in G2frame.Projection: R = np.where(R <= 1.,2.*npasind(R*sq2),0.0) else: R = np.where(R <= 1.,2.*npatand(R),0.0) Z = np.zeros_like(R) Z = G2lat.invpolfcal(IODFln,SGData,R,P) Z = np.reshape(Z,(npts,npts)) try: CS = Plot.contour(Y,X,Z,aspect='equal') Plot.clabel(CS,fontsize=9,inline=1) except ValueError: pass acolor = mpl.cm.get_cmap(G2frame.ContourColor) Img = Plot.imshow(Z.T,aspect='equal',cmap=acolor,extent=[-1,1,-1,1]) Page.figure.colorbar(Img) x,y,z = SHData['PFxyz'] Plot.axis('off') Plot.set_title('%d %d %d Inverse pole figure for %s'%(int(x),int(y),int(z),pName)) Plot.set_xlabel(G2frame.Projection.capitalize()+' projection') elif '3D' in SHData['PlotType']: PSI,GAM = np.mgrid[0:31,0:31] PSI = PSI.flatten()*6. GAM = GAM.flatten()*12. P = G2lat.polfcal(ODFln,SamSym[textureData['Model']],PSI,GAM).reshape((31,31)) GAM = np.linspace(0.,360.,31,True) PSI = np.linspace(0.,180.,31,True) X = np.outer(npsind(GAM),npsind(PSI))*P.T Y = np.outer(npcosd(GAM),npsind(PSI))*P.T Z = np.outer(np.ones(np.size(GAM)),npcosd(PSI))*P.T h,k,l = SHData['PFhkl'] if np.any(X) and np.any(Y) and np.any(Z): np.seterr(all='ignore') Plot.plot_surface(X,Y,Z,rstride=1,cstride=1,color='g',linewidth=1) np.seterr(all='ignore') xyzlim = np.array([Plot.get_xlim3d(),Plot.get_ylim3d(),Plot.get_zlim3d()]).T XYZlim = [min(xyzlim[0]),max(xyzlim[1])] Plot.set_xlim3d(XYZlim) Plot.set_ylim3d(XYZlim) Plot.set_zlim3d(XYZlim) Plot.set_aspect('equal') Plot.set_title('%d %d %d Pole distribution for %s'%(h,k,l,pName)) Plot.set_xlabel(r'X, MRD') Plot.set_ylabel(r'Y, MRD') Plot.set_zlabel(r'Z, MRD') else: X,Y = np.meshgrid(np.linspace(1.,-1.,npts),np.linspace(-1.,1.,npts)) R,P = np.sqrt(X**2+Y**2).flatten(),npatan2d(X,Y).flatten() if 'equal' in G2frame.Projection: R = np.where(R <= 1.,2.*npasind(R*sq2),0.0) else: R = np.where(R <= 1.,2.*npatand(R),0.0) Z = np.zeros_like(R) Z = G2lat.polfcal(ODFln,SamSym[textureData['Model']],R,P) Z = np.reshape(Z,(npts,npts)) try: CS = Plot.contour(Y,X,Z,aspect='equal') Plot.clabel(CS,fontsize=9,inline=1) except ValueError: pass acolor = mpl.cm.get_cmap(G2frame.ContourColor) Img = Plot.imshow(Z.T,aspect='equal',cmap=acolor,extent=[-1,1,-1,1]) Page.figure.colorbar(Img) h,k,l = SHData['PFhkl'] Plot.axis('off') Plot.set_title('%d %d %d Pole figure for %s'%(h,k,l,pName)) Page.canvas.draw() ################################################################################ ##### Plot Modulation ################################################################################ def ModulationPlot(G2frame,data,atom,ax,off=0): global Off,Atom,Ax,Slab,Off Off = off Atom = atom Ax = ax def OnMotion(event): xpos = event.xdata if xpos: #avoid out of frame mouse position ypos = event.ydata ix = int(round(xpos*10)) iy = int(round((Slab.shape[0]-1)*(ypos+0.5-Off*0.005))) Page.canvas.SetCursor(wx.CROSS_CURSOR) try: G2frame.G2plotNB.status.SetStatusText('t =%9.3f %s =%9.3f %s=%9.3f'%(xpos,GkDelta+Ax,ypos,Gkrho,Slab[iy,ix]/8.),1) # GSASIIpath.IPyBreak() except (TypeError,IndexError): G2frame.G2plotNB.status.SetStatusText('Select '+Title+' pattern first',1) def OnPlotKeyPress(event): global Off,Atom,Ax if event.key == '0': Off = 0 elif event.key in ['+','=']: Off += 1 elif event.key == '-': Off -= 1 elif event.key in ['l','r',] and mapData['Flip']: roll = 1 if event.key == 'l': roll = -1 rho = Map['rho'] Map['rho'] = np.roll(rho,roll,axis=3) wx.CallAfter(ModulationPlot,G2frame,data,Atom,Ax,Off) new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('Modulation','mpl') if not new: if not Page.IsShown(): Page.Show() else: Page.canvas.mpl_connect('motion_notify_event', OnMotion) Page.canvas.mpl_connect('key_press_event', OnPlotKeyPress) G2frame.G2plotNB.status.DestroyChildren() #get rid of special stuff on status bar General = data['General'] cx,ct,cs,cia = General['AtomPtrs'] mapData = General['Map'] if mapData['Flip']: Page.Choice = ['+: shift up','-: shift down','0: reset shift','l: move left','r: move right'] else: Page.Choice = ['+: shift up','-: shift down','0: reset shift'] Page.keyPress = OnPlotKeyPress Map = General['4DmapData'] MapType = mapData['MapType'] rhoSize = np.array(Map['rho'].shape) atxyz = np.array(atom[cx:cx+3]) waveType = atom[-1]['SS1']['waveType'] Spos = atom[-1]['SS1']['Spos'] tau = np.linspace(0.,2.,101) wave = np.zeros((3,101)) if len(Spos): scof = [] ccof = [] for i,spos in enumerate(Spos): if waveType in ['ZigZag','Block'] and not i: Tminmax = spos[0][:2] XYZmax = np.array(spos[0][2:]) if waveType == 'Block': wave = G2mth.posBlock(tau,Tminmax,XYZmax).T elif waveType == 'ZigZag': wave = G2mth.posZigZag(tau,Tminmax,XYZmax).T else: scof.append(spos[0][:3]) ccof.append(spos[0][3:]) wave += G2mth.posFourier(tau,np.array(scof),np.array(ccof)) if mapData['Flip']: Title = 'Charge flip' else: Title = MapType Title += ' map for atom '+atom[0]+ \ ' at %.4f %.4f %.4f'%(atxyz[0],atxyz[1],atxyz[2]) ix = -np.array(np.rint(rhoSize[:3]*atxyz)+1,dtype='i') ix += (rhoSize[:3]/2) ix = ix%rhoSize[:3] rho = np.roll(np.roll(np.roll(Map['rho'],ix[0],axis=0),ix[1],axis=1),ix[2],axis=2) ix = rhoSize[:3]/2 ib = 4 hdx = [2,2,2] #this needs to be something for an offset correction on atom positions if Ax == 'x': Doff = (hdx[0]+Off)*.005 slab = np.sum(np.sum(rho[:,ix[1]-ib:ix[1]+ib,ix[2]-ib:ix[2]+ib,:],axis=2),axis=1) Plot.plot(tau,wave[0]) elif Ax == 'y': Doff = (hdx[1]+Off)*.005 slab = np.sum(np.sum(rho[ix[0]-ib:ix[0]+ib,:,ix[2]-ib:ix[2]+ib,:],axis=2),axis=0) Plot.plot(tau,wave[1]) elif Ax == 'z': Doff = (hdx[2]+Off)*.005 slab = np.sum(np.sum(rho[ix[0]-ib:ix[0]+ib,ix[1]-ib:ix[1]+ib,:,:],axis=1),axis=0) Plot.plot(tau,wave[2]) Plot.set_title(Title) Plot.set_xlabel('t') Plot.set_ylabel(r'$\mathsf{\Delta}$%s'%(Ax)) Slab = np.hstack((slab,slab,slab)) acolor = mpl.cm.get_cmap('RdYlGn') if 'delt' in MapType: Plot.contour(Slab[:,:21],20,extent=(0.,2.,-.5+Doff,.5+Doff),cmap=acolor) else: Plot.contour(Slab[:,:21],20,extent=(0.,2.,-.5+Doff,.5+Doff)) Plot.set_ylim([-0.25,0.25]) Page.canvas.draw() ################################################################################ ##### PlotCovariance ################################################################################ def PlotCovariance(G2frame,Data): 'needs a doc string' if not Data: print ('No covariance matrix available') return varyList = Data['varyList'] values = Data['variables'] covMatrix = Data['covMatrix'] sig = np.sqrt(np.diag(covMatrix)) xvar = np.outer(sig,np.ones_like(sig)) covArray = np.divide(np.divide(covMatrix,xvar),xvar.T) title = G2obj.StripUnicode(' for\n'+Data['title'],'') # matplotlib 1.x does not like unicode newAtomDict = Data.get('newAtomDict',{}) G2frame.G2plotNB.status.DestroyChildren() #get rid of special stuff on status bar def OnPlotKeyPress(event): if event.key == 's': choice = [m for m in mpl.cm.datad.keys()] # if not m.endswith("_r") choice.sort() dlg = wx.SingleChoiceDialog(G2frame,'Select','Color scheme',choice) if dlg.ShowModal() == wx.ID_OK: sel = dlg.GetSelection() G2frame.VcovColor = choice[sel] else: G2frame.VcovColor = 'RdYlGn' dlg.Destroy() elif event.key == 'p': covFile = open(os.path.splitext(G2frame.GSASprojectfile)[0]+'.cov','w') covFile.write(128*'*' + '\n') covFile.write('*' + 126*' ' + '*\n') covFile.write('*{:^126}*\n'.format('Covariance Matrix')) covFile.write('*' + 126*' ' + '*\n') covFile.write(128*'*' + '\n\n\n\n') llen = len(varyList) for start in range(0, llen, 8): # split matrix into batches of 7 columns if llen >= start + 8: stop = start + 8 else: stop = llen covFile.write(12*' ' + '\t') for idx in range(start, stop): covFile.write('{:^12}\t'.format(varyList[idx])) covFile.write('\n\n') for line in range(llen): covFile.write('{:>12}\t'.format(varyList[line])) for idx in range(start, stop): covFile.write('{: 12.6f}\t'.format(covArray[line][idx])) covFile.write('\n') covFile.write('\n\n\n') covFile.close() PlotCovariance(G2frame,Data) def OnMotion(event): if event.button: ytics = imgAx.get_yticks() ytics = np.where(ytics180.,Phi-360.,Phi) Psi = np.where(Psi>180.,Psi-360.,Psi) Plot.plot(Phi,Psi,'ro',picker=5) Plot.set_xlim((-180.,180.)) Plot.set_ylim((-180.,180.)) else: if len(Coeff): X,Y = np.meshgrid(np.linspace(0.,360.,45),np.linspace(0.,360.,45)) Z = np.array([-G2mth.calcRamaEnergy(x,y,Coeff)[1] for x,y in zip(X.flatten(),Y.flatten())]) Plot.contour(X,Y,np.reshape(Z,(45,45))) Img = Plot.imshow(rama,aspect='equal',cmap=acolor,interpolation='nearest', extent=[0,360,0,360],origin='lower') if len(PhiPsi): Phi,Psi = PhiPsi.T Plot.plot(Phi,Psi,'ro',picker=5) Plot.set_xlim((0.,360.)) Plot.set_ylim((0.,360.)) Plot.set_title('Ramachandran for '+RamaName+' in '+phaseName) Plot.set_xlabel(r'$\phi$',fontsize=16) Plot.set_ylabel(r'$\psi$',fontsize=16) Page.figure.colorbar(Img) Page.canvas.draw() ################################################################################ ##### PlotSeq ################################################################################ def PlotSelectedSequence(G2frame,ColumnList,TableGet,SelectX,fitnum=None,fitvals=None): '''Plot a result from a sequential refinement :param wx.Frame G2frame: The main GSAS-II tree "window" :param list ColumnList: list of int values corresponding to columns selected as y values :param function TableGet: a function that takes a column number as argument and returns the column label, the values and there ESDs (or None) :param function SelectX: a function that returns a selected column number (or None) as the X-axis selection ''' global Title,xLabel,yLabel xLabel = yLabel = Title = '' def OnMotion(event): if event.xdata and event.ydata: #avoid out of frame errors xpos = event.xdata ypos = event.ydata msg = '%5.3f %.6g'%(xpos,ypos) Page.SetToolTipString(msg) def OnKeyPress(event): global Title,xLabel,yLabel if event.key == 's': G2frame.seqXaxis = G2frame.seqXselect() wx.CallAfter(Draw) elif event.key == 't': dlg = G2G.MultiStringDialog(G2frame,'Set titles & labels',[' Title ',' x-Label ',' y-Label '], [Title,xLabel,yLabel]) if dlg.Show(): Title,xLabel,yLabel = dlg.GetValues() dlg.Destroy() Draw() elif event.key == 'l': G2frame.seqLines = not G2frame.seqLines Draw() def Draw(): global Title,xLabel,yLabel G2frame.G2plotNB.status.SetStatusText( \ 'press L to toggle lines, S to select X axis, T to change titles (reselect column to show?)',1) Plot.clear() colors=['b','g','r','c','m','k'] uselist = Page.seqTableGet(0)[1] if G2frame.seqXaxis is not None: xName,X,Xsig = Page.seqTableGet(G2frame.seqXaxis) else: X = np.arange(0,G2frame.SeqTable.GetNumberRows(),1) xName = 'Data sequence number' for ic,col in enumerate(Page.seqYaxisList): Ncol = colors[ic%6] name,Y,sig = Page.seqTableGet(col) # deal with missing (None) values Xnew = [] Ynew = [] Ysnew = [] for i in range(len(X)): if not uselist[i]: continue if X[i] is None or Y[i] is None: if Ysnew: if G2frame.seqReverse and not G2frame.seqXaxis: Ynew = Ynew[::-1] Ysnew = Ysnew[::-1] if G2frame.seqLines: Plot.errorbar(Xnew,Ynew,yerr=Ysnew,color=Ncol) else: Plot.errorbar(Xnew,Ynew,yerr=Ysnew,linestyle='None',color=Ncol,marker='x') else: if G2frame.seqReverse and not G2frame.seqXaxis: Ynew = Ynew[::-1] Plot.plot(Xnew,Ynew,color=Ncol) Plot.plot(Xnew,Ynew,'o',color=Ncol) Xnew = [] Ynew = [] Ysnew = [] continue Xnew.append(X[i]) Ynew.append(Y[i]) if sig: Ysnew.append(sig[i]) if Ysnew: if G2frame.seqReverse and not G2frame.seqXaxis: Ynew = Ynew[::-1] Ysnew = Ysnew[::-1] if G2frame.seqLines: Plot.errorbar(Xnew,Ynew,yerr=Ysnew,color=Ncol,label=name) else: Plot.errorbar(Xnew,Ynew,yerr=Ysnew,label=name,linestyle='None',color=Ncol,marker='x') else: if G2frame.seqReverse and not G2frame.seqXaxis: Ynew = Ynew[::-1] Plot.plot(Xnew,Ynew,color=Ncol) Plot.plot(Xnew,Ynew,'o',color=Ncol,label=name) if Page.fitvals: # TODO: deal with fitting of None values if G2frame.seqReverse and not G2frame.seqXaxis: Page.fitvals = Page.fitvals[::-1] Plot.plot(X,Page.fitvals,label='Fit',color=colors[(ic+2)%6]) Plot.legend(loc='best') if Title: Plot.set_title(Title) else: Plot.set_title('') if xLabel: Plot.set_xlabel(xLabel) else: Plot.set_xlabel(xName) if yLabel: Plot.set_ylabel(yLabel) else: Plot.set_ylabel('Parameter values') Page.canvas.draw() G2frame.seqXselect = SelectX try: G2frame.seqXaxis except: G2frame.seqXaxis = None if fitnum is None: label = 'Sequential refinement' else: label = 'Parametric fit #'+str(fitnum+1) new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab(label,'mpl') if not new: if not Page.IsShown(): Page.Show() else: Page.canvas.mpl_connect('key_press_event', OnKeyPress) Page.canvas.mpl_connect('motion_notify_event', OnMotion) Page.Choice = ['l - toggle lines','s - select x-axis','t - change titles',] Page.keyPress = OnKeyPress Page.seqYaxisList = ColumnList Page.seqTableGet = TableGet Page.fitvals = fitvals Draw() ################################################################################ ##### PlotExposedImage & PlotImage ################################################################################ def PlotExposedImage(G2frame,newPlot=False,event=None): '''General access module for 2D image plotting ''' plotNo = G2frame.G2plotNB.nb.GetSelection() if plotNo < 0: return # no plots if G2frame.G2plotNB.nb.GetPageText(plotNo) == '2D Powder Image': PlotImage(G2frame,newPlot,event,newImage=True) elif G2frame.G2plotNB.nb.GetPageText(plotNo) == '2D Integration': PlotIntegration(G2frame,newPlot,event) def OnStartMask(G2frame): '''Initiate the start of a Frame or Polygon map, etc. Called from a menu command (GSASIIimgGUI) or from OnImPlotKeyPress. Variable G2frame.MaskKey contains a single letter ('f' or 'p', etc.) that determines what type of mask is created. :param wx.Frame G2frame: The main GSAS-II tree "window" ''' Masks = G2frame.GPXtree.GetItemPyData( G2gd.GetGPXtreeItemId(G2frame,G2frame.Image, 'Masks')) if G2frame.MaskKey == 'f': new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('2D Powder Image','mpl',newImage=False) if Masks['Frames']: Masks['Frames'] = [] PlotImage(G2frame,newImage=True) G2frame.MaskKey = 'f' Page.figure.suptitle('Defining Frame mask (use right-mouse to end)',color='g',fontweight='bold') Page.canvas.draw() elif G2frame.MaskKey == 'p': Masks['Polygons'].append([]) new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('2D Powder Image','mpl',newImage=False) Page.figure.suptitle('Defining Polygon mask (use right-mouse to end)',color='r',fontweight='bold') Page.canvas.draw() elif G2frame.MaskKey == 'a': new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('2D Powder Image','mpl',newImage=False) Page.figure.suptitle('Left-click to create an arc mask',color='r',fontweight='bold') Page.canvas.draw() elif G2frame.MaskKey == 'r': new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('2D Powder Image','mpl',newImage=False) Page.figure.suptitle('Left-click to create a ring mask',color='r',fontweight='bold') Page.canvas.draw() elif G2frame.MskDelete: new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('2D Powder Image','mpl',newImage=False) Page.figure.suptitle('select spot mask to delete',color='r',fontweight='bold') Page.canvas.draw() G2imG.UpdateMasks(G2frame,Masks) def OnStartNewDzero(G2frame): '''Initiate the start of adding a new d-zero to a strain data set :param wx.Frame G2frame: The main GSAS-II tree "window" :param str eventkey: a single letter ('a') that triggers the addition of a d-zero. ''' G2frame.GetStatusBar().SetStatusText('Add strain ring active - LB pick d-zero value',0) G2frame.PickId = G2gd.GetGPXtreeItemId(G2frame,G2frame.Image, 'Stress/Strain') data = G2frame.GPXtree.GetItemPyData(G2frame.PickId) return data def ToggleMultiSpotMask(G2frame): '''Turns on and off MultiSpot selection mode; displays a subtitle on plot the is cleared by the next PlotImage call ''' new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('2D Powder Image','mpl',newImage=False) if G2frame.MaskKey == 's': G2frame.MaskKey = '' Page.Choice[-1] = 's: start multiple spot mask mode' wx.CallAfter(PlotImage,G2frame,newImage=True) else: G2frame.MaskKey = 's' (x0,y0),(x1,y1) = Plot.get_position().get_points() Page.Choice[-1] = 's: stop multiple spot mask mode' ShowSpotMaskInfo(G2frame,Page) def ShowSpotMaskInfo(G2frame,Page): if G2frame.MaskKey == 's': Page.figure.suptitle('Multiple spot mode on (size={}), press s or right-click to end' .format(G2frame.spotSize),color='r',fontweight='bold') else: Page.figure.suptitle('New spot size={}'.format(G2frame.spotSize), color='r',fontweight='bold') Page.canvas.draw() def ComputeArc(angI,angO,wave,azm0=0,azm1=362): '''Computes arc/ring arrays in with inner and outer radii from angI,angO and beginning and ending azimuths azm0,azm1 (optional). Returns the inner and outer ring/arc arrays. ''' Dsp = lambda tth,wave: wave/(2.*npsind(tth/2.)) xy1 = [] xy2 = [] aR = [azm0,azm1,max(3,int(0.5+azm1-azm0))] # number of points should be at least 3 if azm1-azm0 > 180: aR[2] /= 2 # for more than 180 degrees, steps can be 2 deg. Azm = np.linspace(*aR) for azm in Azm: xy1.append(G2img.GetDetectorXY(Dsp(angI,wave),azm,Data)) #what about hyperbola xy2.append(G2img.GetDetectorXY(Dsp(angO,wave),azm,Data)) #what about hyperbola return np.array(xy1).T,np.array(xy2).T def UpdatePolygon(pick,event,polygon): '''Update a polygon (or frame) in response to the location of the mouse. Delete the selected point if moved on top of another. With right button add a point after the current button. ''' Xpos,Ypos = [event.xdata,event.ydata] if event.button == 1: # find distance to closest point other than selected point dlist = [np.sqrt((x-Xpos)**2 + (y-Ypos)**2) for i,(x,y) in enumerate(polygon)] dlist[pick.pointNumber] = max(dlist) dmin = min(dlist) cp = dlist.index(min(dlist)) # closest point if dmin < 1.5 and cp != pick.pointNumber: del polygon[pick.pointNumber] else: polygon[pick.pointNumber] = [Xpos,Ypos] polygon[-1] = polygon[0][:] elif event.button == 3: polygon.insert(pick.pointNumber+1,[Xpos,Ypos]) def PlotImage(G2frame,newPlot=False,event=None,newImage=True): '''Plot of 2D detector images as contoured plot. Also plot calibration ellipses, masks, etc. Plots whatever is in G2frame.ImageZ :param wx.Frame G2frame: main GSAS-II frame :param bool newPlot: if newPlot is True, the plot is reset (zoomed out, etc.) :param event: matplotlib mouse event (or None) :param bool newImage: If True, the Figure is cleared and redrawn ''' from matplotlib.patches import Ellipse,Circle import numpy.ma as ma G2frame.cid = None #Dsp = lambda tth,wave: wave/(2.*npsind(tth/2.)) global Data,Masks,StrSta # RVD: these are needed for multiple image controls/masks colors=['b','g','r','c','m','k'] Data = G2frame.GPXtree.GetItemPyData( G2gd.GetGPXtreeItemId(G2frame,G2frame.Image, 'Image Controls')) G2frame.spotSize = GSASIIpath.GetConfigValue('Spot_mask_diameter',1.0) G2frame.spotString = '' # patch if 'invert_x' not in Data: Data['invert_x'] = False Data['invert_y'] = True # end patch Masks = G2frame.GPXtree.GetItemPyData( G2gd.GetGPXtreeItemId(G2frame,G2frame.Image, 'Masks')) try: #may be absent StrSta = G2frame.GPXtree.GetItemPyData( G2gd.GetGPXtreeItemId(G2frame,G2frame.Image, 'Stress/Strain')) except TypeError: #is missing StrSta = {} def OnImMotion(event): Page.SetToolTipString('') sizexy = Data['size'] if event.xdata and event.ydata and len(G2frame.ImageZ): #avoid out of frame errors Page.SetToolTipString('%8.2f %8.2fmm'%(event.xdata,event.ydata)) Page.canvas.SetCursor(wx.CROSS_CURSOR) item = G2frame.itemPicked pixelSize = Data['pixelSize'] scalex = 1000./pixelSize[0] #microns --> 1/mm scaley = 1000./pixelSize[1] if item and G2frame.GPXtree.GetItemText(G2frame.PickId) == 'Image Controls': if 'Text' in str(item): Page.SetToolTipString('%8.3f %8.3fmm'%(event.xdata,event.ydata)) else: xcent,ycent = Data['center'] xpos = event.xdata-xcent ypos = event.ydata-ycent tth,azm = G2img.GetTthAzm(event.xdata,event.ydata,Data) if 'line3' in str(item) or 'line4' in str(item) and not Data['fullIntegrate']: Page.SetToolTipString('%6d deg'%(azm)) elif 'line1' in str(item) or 'line2' in str(item): Page.SetToolTipString('%8.3f deg'%(tth)) else: xcent,ycent = Data['center'] xpos = event.xdata ypos = event.ydata radius = np.sqrt((xpos-xcent)**2+(ypos-ycent)**2) xpix = int(xpos*scalex) ypix = int(ypos*scaley) Int = 0 if (0 <= xpix < sizexy[0]) and (0 <= ypix < sizexy[1]): Int = G2frame.ImageZ[ypix][xpix] tth,azm,D,dsp = G2img.GetTthAzmDsp(xpos,ypos,Data) Q = 2.*math.pi/dsp if G2frame.StrainKey: G2frame.G2plotNB.status.SetStatusText('d-zero pick active',0) elif G2frame.MaskKey in ['p','f']: G2frame.G2plotNB.status.SetStatusText('Polygon/frame mask pick - LB next point, RB close polygon',1) else: G2frame.G2plotNB.status.SetStatusText( \ 'Radius=%.3fmm, 2-th=%.3fdeg, dsp=%.3fA, Q=%.5fA-1, azm=%.2fdeg, I=%6d'%(radius,tth,dsp,Q,azm,Int),1) def OnImPlotKeyPress(event): try: treeItem = G2frame.GPXtree.GetItemText(G2frame.PickId) except TypeError: return if treeItem == 'Masks': if event.key in [str(i) for i in range(10)]+['.']: G2frame.spotString += event.key return elif G2frame.spotString: try: size = float(G2frame.spotString) G2frame.spotSize = size print('Spot size set to {} mm'.format(size)) ShowSpotMaskInfo(G2frame,Page) except: print('Spot size {} invalid'.format(G2frame.spotString)) G2frame.spotString = '' if event.key == 's': # turn multiple spot mode on/off ToggleMultiSpotMask(G2frame) return elif event.key == ' ': # space key: ask for spot size dlg = G2G.SingleFloatDialog(G2frame.G2plotNB,'Spot Size', 'Enter new value for spot size', G2frame.spotSize,[.1,50]) if dlg.ShowModal() == wx.ID_OK: G2frame.spotSize = dlg.GetValue() print('Spot size set to {} mm'.format(G2frame.spotSize)) ShowSpotMaskInfo(G2frame,Page) dlg.Destroy() elif event.key == 't': try: # called from menu? Xpos,Ypos = event.xdata,event.ydata except AttributeError: G2G.G2MessageBox(G2frame.G2plotNB, 'You must use the "{}" key from the keyboard'.format(event.key), 'Keyboard only') return if not (event.xdata and event.ydata): return spot = [event.xdata,event.ydata,G2frame.spotSize] Masks['Points'].append(spot) artist = Circle(spot[:2],radius=spot[2]/2,fc='none',ec='r',picker=3) Page.figure.gca().add_artist(artist) artist.itemNumber = len(Masks['Points'])-1 artist.itemType = 'Spot' G2imG.UpdateMasks(G2frame,Masks) Page.canvas.draw() return elif event.key in ['l','p','f','a','r']: G2frame.MaskKey = event.key OnStartMask(G2frame) elif event.key == 'd': G2frame.MskDelete = True OnStartMask(G2frame) elif treeItem == 'Stress/Strain': if event.key in ['a',]: G2frame.StrainKey = event.key OnStartNewDzero(G2frame) wx.CallAfter(PlotImage,G2frame,newImage=False) elif treeItem == 'Image Controls': if event.key in ['c',]: Xpos = event.xdata if not Xpos: #got point out of frame return Ypos = event.ydata dlg = wx.MessageDialog(G2frame,'Are you sure you want to change the center?', 'Center change',style=wx.OK|wx.CANCEL) try: if dlg.ShowModal() == wx.ID_OK: print ('move center to: %.3f,%.3f'%(Xpos,Ypos)) Data['center'] = [Xpos,Ypos] G2imG.UpdateImageControls(G2frame,Data,Masks) wx.CallAfter(PlotImage,G2frame,newPlot=False) finally: dlg.Destroy() return elif event.key in ['d',]: # set dmin from plot position if not (event.xdata and event.ydata): return xpos = event.xdata ypos = event.ydata tth,azm,D,dsp = G2img.GetTthAzmDsp(xpos,ypos,Data) G2frame.calibDmin.SetValue(dsp) elif event.key == 'l': G2frame.logPlot = not G2frame.logPlot elif event.key in ['x',]: Data['invert_x'] = not Data['invert_x'] elif event.key in ['y',]: Data['invert_y'] = not Data['invert_y'] else: return wx.CallAfter(PlotImage,G2frame,newPlot=True) def OnImPick(event): 'A object has been picked' def OnDragIntBound(event): 'Respond to the dragging of one of the integration boundaries' if event.xdata is None or event.ydata is None: # mouse is outside window. Could abort the movement, # for now ignore the movement until it moves back in return tth,azm,D,dsp = G2img.GetTthAzmDsp(event.xdata,event.ydata,Data) itemPicked = str(G2frame.itemPicked) if 'line1' in itemPicked and 'Line2D' in itemPicked: Data['IOtth'][0] = max(tth,0.001) elif 'line2' in itemPicked and 'Line2D' in itemPicked: Data['IOtth'][1] = tth elif 'line3' in itemPicked and 'Line2D' in itemPicked: Data['LRazimuth'][0] = int(azm) Data['LRazimuth'][0] %= 360 elif 'line4' in itemPicked and 'Line2D' in itemPicked: Data['LRazimuth'][1] = int(azm) Data['LRazimuth'][1] %= 360 else: return if Data['LRazimuth'][0] > Data['LRazimuth'][1]: Data['LRazimuth'][1] += 360 if Data['fullIntegrate']: Data['LRazimuth'][1] = Data['LRazimuth'][0]+360 #if Data['IOtth'][0] > Data['IOtth'][1]: # Data['IOtth'][0],Data['IOtth'][1] = Data['IOtth'][1],Data['IOtth'][0] # compute arcs, etc LRAzim = Data['LRazimuth'] #NB: integers AzmthOff = Data['azmthOff'] IOtth = Data['IOtth'] wave = Data['wavelength'] dspI = wave/(2.0*sind(IOtth[0]/2.0)) ellI = G2img.GetEllipse(dspI,Data) #=False if dsp didn't yield an ellipse (ugh! a parabola or a hyperbola) dspO = wave/(2.0*sind(IOtth[1]/2.0)) ellO = G2img.GetEllipse(dspO,Data) #Ditto & more likely for outer ellipse Azm = np.arange(LRAzim[0],LRAzim[1]+1.)-AzmthOff if ellI: xyI = [] for azm in Azm: xy = G2img.GetDetectorXY(dspI,azm,Data) if np.any(xy): xyI.append(xy) if len(xyI): xyI = np.array(xyI) arcxI,arcyI = xyI.T if ellO: xyO = [] for azm in Azm: xy = G2img.GetDetectorXY(dspO,azm,Data) if np.any(xy): xyO.append(xy) if len(xyO): xyO = np.array(xyO) arcxO,arcyO = xyO.T Page.canvas.restore_region(savedplot) if 'line1' in itemPicked and 'Line2D' in itemPicked: pick.set_data([arcxI,arcyI]) elif 'line2' in itemPicked and 'Line2D' in itemPicked: pick.set_data([arcxO,arcyO]) elif 'line3' in itemPicked and 'Line2D' in itemPicked: pick.set_data([[arcxI[0],arcxO[0]],[arcyI[0],arcyO[0]]]) elif 'line4' in itemPicked and 'Line2D' in itemPicked: pick.set_data([[arcxI[-1],arcxO[-1]],[arcyI[-1],arcyO[-1]]]) Page.figure.gca().draw_artist(pick) Page.canvas.blit(Page.figure.gca().bbox) def OnDragMask(event): 'Respond to the dragging of a mask' if event.xdata is None or event.ydata is None: # mouse is outside window. Could abort the movement, # for now ignore the movement until it moves back in return Xpos,Ypos = [event.xdata,event.ydata] #if Page.toolbar._active: return # zoom/pan selected Page.canvas.restore_region(savedplot) try: pickType = pick.itemType except: pickType = '?' if pickType == "Spot": itemNum = G2frame.itemPicked.itemNumber if event.button == 1: x = Masks['Points'][itemNum][0]+Xpos-XposBeforeDrag y = Masks['Points'][itemNum][1]+Ypos-YposBeforeDrag pick.center=[x,y] elif event.button == 3: r = math.sqrt((Xpos-Masks['Points'][itemNum][0])**2+ (Ypos-Masks['Points'][itemNum][1])**2) pick.radius = r Page.figure.gca().draw_artist(pick) elif pickType.startswith('Ring'): wave = Data['wavelength'] itemNum = G2frame.itemPicked.itemNumber if event.button == 1: angO = angI = G2img.GetTth(Xpos,Ypos,Data) if pickType == 'RingInner': angO += Masks['Rings'][itemNum][1] else: angI -= Masks['Rings'][itemNum][1] Masks['Rings'][itemNum][0] = (angO+angI)/2 elif event.button == 3: ang = G2img.GetTth(Xpos,Ypos,Data) t = 2*abs(ang - Masks['Rings'][itemNum][0]) angI = Masks['Rings'][itemNum][0] - t/2. angO = Masks['Rings'][itemNum][0] + t/2. Masks['Rings'][itemNum][1] = t (x1,y1),(x2,y2) = ComputeArc(angI,angO,wave) pI,pO = G2frame.ringList[pick.itemNumber] pI.set_data((x1,y1)) pO.set_data((x2,y2)) Page.figure.gca().draw_artist(pI) Page.figure.gca().draw_artist(pO) elif pickType.startswith('Arc'): wave = Data['wavelength'] itemNum = G2frame.itemPicked.itemNumber tth,azm,thick = Masks['Arcs'][itemNum] tthN,azmN,D,dsp = G2img.GetTthAzmDsp(Xpos,Ypos,Data) if event.button == 1: if pickType == 'ArcInner': angO = angI = tthN angO += thick off = 0 Masks['Arcs'][itemNum][0] = (angO + angI)/2 elif pickType == 'ArcOuter': angO = angI = tthN angI -= thick off = 0 Masks['Arcs'][itemNum][0] = (angO + angI)/2 elif pickType == 'ArcLower': angO = tth + thick/2 angI = tth - thick/2 off = azmN - azm[0] elif pickType == 'ArcUpper': angO = tth + thick/2 angI = tth - thick/2 off = azmN - azm[1] azm[0] += off azm[1] += off elif event.button == 3: if pickType == 'ArcInner' or pickType == 'ArcOuter': t = 2*abs(tthN - tth) angI = tth - t/2. angO = tth + t/2. Masks['Arcs'][itemNum][2] = t off = 0 elif pickType == 'ArcLower': angO = tth + thick/2 angI = tth - thick/2 off = azmN - azm[0] elif pickType == 'ArcUpper': angO = tth + thick/2 angI = tth - thick/2 off = azmN - azm[1] newRange = azm[1] - azm[0] - 2*off if newRange < 2 or newRange > 358: return # don't let the azimuthal range get too small or large azm[0] += off azm[1] -= off (x1,y1),(x2,y2) = ComputeArc(angI,angO,wave,*azm) pI,pO,pL,pU = G2frame.arcList[pick.itemNumber] pI.set_data((x2,y2)) pO.set_data((x1,y1)) pL.set_data(([x1[0],x2[0]],[y1[0],y2[0]])) pU.set_data(([x1[-1],x2[-1]],[y1[-1],y2[-1]])) Page.figure.gca().draw_artist(pI) Page.figure.gca().draw_artist(pO) Page.figure.gca().draw_artist(pL) Page.figure.gca().draw_artist(pU) elif pickType == 'Polygon': # respond to drag polygon = Masks['Polygons'][pick.itemNumber][:] UpdatePolygon(pick,event,polygon) xl,yl = np.hsplit(np.array(polygon),2) artist = Plot.plot(xl,yl,'r+')[0] # points Page.figure.gca().add_artist(artist) artist = G2frame.polyList[pick.itemNumber] artist.set_data((xl,yl)) # lines Page.figure.gca().draw_artist(artist) elif pickType == 'Frame': polygon = Masks['Frames'][:] UpdatePolygon(pick,event,polygon) xl,yl = np.hsplit(np.array(polygon),2) artist = Plot.plot(xl,yl,'g+')[0] # points Page.figure.gca().add_artist(artist) artist = G2frame.frameArtist artist.set_data((xl,yl)) # lines Page.figure.gca().draw_artist(artist) else: # non-dragable object return Page.canvas.blit(Page.figure.gca().bbox) if G2frame.itemPicked is not None: return if G2frame.GPXtree.GetItemText(G2frame.PickId) == 'Image Controls': G2frame.itemPicked = pick = event.artist G2frame.mousePicked = event.mouseevent # prepare to animate move of integration ranges Page = G2frame.G2plotNB.nb.GetPage(plotNum) saveLinestyle = pick.get_linestyle() pick.set_linestyle(':') # set line as dotted Page.figure.gca() Page.canvas.draw() # refresh without dotted line & save bitmap savedplot = Page.canvas.copy_from_bbox(Page.figure.gca().bbox) G2frame.cid = Page.canvas.mpl_connect('motion_notify_event', OnDragIntBound) pick.set_linestyle(saveLinestyle) # back to original elif G2frame.GPXtree.GetItemText(G2frame.PickId) == 'Masks': # prepare to animate dragging of mask G2frame.itemPicked = pick = event.artist G2frame.mousePicked = event.mouseevent XposBeforeDrag,YposBeforeDrag = [event.mouseevent.xdata,event.mouseevent.ydata] #GSASIIpath.IPyBreak() Page = G2frame.G2plotNB.nb.GetPage(plotNum) try: pickType = pick.itemType except: # should not happen anymore pickType = '?' if pickType == 'Spot': pl = [pick,] elif pickType.startswith('Ring'): pl = G2frame.ringList[pick.itemNumber] elif pickType.startswith('Arc'): pl = G2frame.arcList[pick.itemNumber] elif pickType == 'Polygon': pl = [G2frame.polyList[pick.itemNumber]] elif pickType == 'Frame': pl = [G2frame.frameArtist,] else: print('picktype {} should not happen!'.format(pickType)) GSASIIpath.IPyBreak() saveLinestyle = [p.get_linestyle() for p in pl] for p in pl: p.set_linestyle('dotted') # set line as dotted Page.canvas.draw() # refresh without dotted line & save bitmap savedplot = Page.canvas.copy_from_bbox(Page.figure.gca().bbox) G2frame.cid = Page.canvas.mpl_connect('motion_notify_event', OnDragMask) for p,s in zip(pl,saveLinestyle): p.set_linestyle(s) # set back to original def OnImRelease(event): '''Called when the mouse is released inside an image plot window ''' try: treeItem = G2frame.GPXtree.GetItemText(G2frame.PickId) except TypeError: return new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('2D Powder Image','mpl',newImage=False) if G2frame.cid is not None: # if there is a drag connection, delete it Page.canvas.mpl_disconnect(G2frame.cid) G2frame.cid = None if treeItem not in ['Image Controls','Masks','Stress/Strain']: return if treeItem == 'Masks' and G2frame.spotString: try: size = float(G2frame.spotString) G2frame.spotSize = size print('Spot size set to {} mm'.format(size)) ShowSpotMaskInfo(G2frame,Page) except: print('Spot size {} invalid'.format(G2frame.spotString)) G2frame.spotString = '' pixelSize = Data['pixelSize'] scalex = 1000./pixelSize[0] scaley = 1000./pixelSize[1] # pixLimit = Data['pixLimit'] #can be too tight pixLimit = 20 #this makes the search box 40x40 pixels if G2frame.itemPicked is None and treeItem == 'Image Controls' and len(G2frame.ImageZ): # nothing being dragged, add calibration point (left mouse) or launch calibration (right) Xpos = event.xdata if not (Xpos and G2frame.ifGetRing): #got point out of frame return Ypos = event.ydata if Ypos and not Page.toolbar._active: #make sure zoom/pan not selected if event.button == 1: Xpix = Xpos*scalex Ypix = Ypos*scaley if event.key == 'shift': #force selection at cursor position xpos = Xpix ypos = Ypix I = J = 10 else: xpos,ypos,I,J = G2img.ImageLocalMax(G2frame.ImageZ,pixLimit,Xpix,Ypix) if I and J: xpos += .5 #shift to pixel center ypos += .5 xpos /= scalex #convert to mm ypos /= scaley Data['ring'].append([xpos,ypos]) elif event.button == 3: G2frame.GetStatusBar().SetStatusText('Calibrating...',0) if G2img.ImageCalibrate(G2frame,Data): G2frame.GetStatusBar().SetStatusText('Calibration successful - Show ring picks to check',0) print ('Calibration successful') else: G2frame.GetStatusBar().SetStatusText('Calibration failed - Show ring picks to diagnose',0) print ('Calibration failed') G2frame.ifGetRing = False G2imG.UpdateImageControls(G2frame,Data,Masks) return wx.CallAfter(PlotImage,G2frame,newImage=False) return elif G2frame.MaskKey and treeItem == 'Masks': # nothing being dragged, create a new mask Xpos,Ypos = [event.xdata,event.ydata] if not Xpos or not Ypos or Page.toolbar._active: #got point out of frame or zoom/pan selected return if G2frame.MaskKey == 's': if event.button == 3: ToggleMultiSpotMask(G2frame) else: spot = [Xpos,Ypos,G2frame.spotSize] Masks['Points'].append(spot) artist = Circle((Xpos,Ypos),radius=spot[2]/2,fc='none',ec='r',picker=3) Page.figure.gca().add_artist(artist) artist.itemNumber = len(Masks['Points'])-1 artist.itemType = 'Spot' G2imG.UpdateMasks(G2frame,Masks) Page.canvas.draw() return elif G2frame.MaskKey == 's': if event.button == 1: spot = [Xpos,Ypos,G2frame.spotSize] Masks['Points'].append(spot) G2imG.UpdateMasks(G2frame,Masks) G2frame.MaskKey = '' wx.CallAfter(PlotImage,G2frame,newImage=True) return elif G2frame.MaskKey == 'r': if event.button == 1: tth = G2img.GetTth(Xpos,Ypos,Data) t = GSASIIpath.GetConfigValue('Ring_mask_thickness',0.1) Masks['Rings'].append([tth,t]) G2imG.UpdateMasks(G2frame,Masks) G2frame.MaskKey = '' wx.CallAfter(PlotImage,G2frame,newImage=True) return elif G2frame.MaskKey == 'a': if event.button == 1: tth,azm = G2img.GetTthAzm(Xpos,Ypos,Data) azm = int(azm) t = GSASIIpath.GetConfigValue('Ring_mask_thickness',0.1) a = GSASIIpath.GetConfigValue('Arc_mask_azimuth',10.0) Masks['Arcs'].append([tth,[azm-a/2.,azm+a/2.],t]) G2imG.UpdateMasks(G2frame,Masks) G2frame.MaskKey = '' wx.CallAfter(PlotImage,G2frame,newImage=True) return elif G2frame.MaskKey =='p' or G2frame.MaskKey =='f': if G2frame.MaskKey =='p': polygon = Masks['Polygons'][-1] color = 'r' lbl = 'Polygon' else: polygon = Masks['Frames'] color = 'g' lbl = 'Frame' if event.button == 3: # close the polygon/frame if len(polygon) <= 2: # too few points if G2frame.MaskKey =='p': del Masks['Polygons'][-1] else: Masks['Frames'] = [] G2G.G2MessageBox(G2frame.G2plotNB,lbl+' deleted -- not enough points', 'too few points') else: polygon.append(polygon[0][:]) # G2frame.G2plotNB.status.SetStatusText('Polygon closed',) # BHT: never gets seen G2frame.MaskKey = '' G2imG.UpdateMasks(G2frame,Masks) wx.CallAfter(PlotImage,G2frame,newImage=True) return else: G2frame.G2plotNB.status.SetStatusText('New '+lbl+' point: %.1f,%.1f'%(Xpos,Ypos),1) if len(polygon): xpr,ypr = polygon[-1] Plot.plot((xpr,Xpos),(ypr,Ypos),color) Plot.plot(Xpos,Ypos,color+'+') Page.canvas.draw() polygon.append([Xpos,Ypos]) #G2imG.UpdateMasks(G2frame,Masks) return G2imG.UpdateMasks(G2frame,Masks) wx.CallAfter(PlotImage,G2frame,newImage=False) elif G2frame.MskDelete: G2frame.MskDelete = False if G2frame.itemPicked: del Masks['Points'][G2frame.itemPicked.itemNumber] G2imG.UpdateMasks(G2frame,Masks) wx.CallAfter(PlotImage,G2frame,newImage=True) elif treeItem == 'Stress/Strain' and G2frame.StrainKey: Xpos,Ypos = [event.xdata,event.ydata] if not Xpos or not Ypos or Page.toolbar._active: #got point out of frame or zoom/pan selected return dsp = G2img.GetDsp(Xpos,Ypos,Data) StrSta['d-zero'].append({'Dset':dsp,'Dcalc':0.0,'pixLimit':10,'cutoff':0.5,'Ivar':0.0, 'ImxyObs':[[],[]],'ImxyCalc':[[],[]],'ImtaObs':[[],[]],'ImtaCalc':[[],[]],'Emat':[1.0,1.0,1.0]}) R,r = G2img.MakeStrStaRing(StrSta['d-zero'][-1],G2frame.ImageZ,Data) if not len(R): del StrSta['d-zero'][-1] G2frame.ErrorDialog('Strain peak selection','WARNING - No points found for this ring selection') StrSta['d-zero'] = G2mth.sortArray(StrSta['d-zero'],'Dset',reverse=True) G2frame.StrainKey = '' G2imG.UpdateStressStrain(G2frame,StrSta) wx.CallAfter(PlotImage,G2frame,newPlot=False) else: # start here after dragging of integration range lines or a mask Xpos,Ypos = [event.xdata,event.ydata] if not Xpos or not Ypos or Page.toolbar._active: #got point out of frame or zoom/pan selected return tth,azm,dsp = G2img.GetTthAzmDsp(Xpos,Ypos,Data)[:3] itemPicked = str(G2frame.itemPicked) try: pickType = G2frame.itemPicked.itemType except: pickType = '?' if G2frame.ifGetRing: #delete a calibration ring pick xypos = [Xpos,Ypos] rings = Data['ring'] for ring in rings: if np.allclose(ring,xypos,.01,0): rings.remove(ring) elif 'Line2D' in itemPicked and treeItem == 'Image Controls': if 'line1' in itemPicked: Data['IOtth'][0] = max(tth,0.001) elif 'line2' in itemPicked: Data['IOtth'][1] = tth elif 'line3' in itemPicked: Data['LRazimuth'][0] = int(azm) elif 'line4' in itemPicked and not Data['fullIntegrate']: Data['LRazimuth'][1] = int(azm) Data['LRazimuth'][0] %= 360 Data['LRazimuth'][1] %= 360 if Data['LRazimuth'][0] > Data['LRazimuth'][1]: Data['LRazimuth'][1] += 360 if Data['fullIntegrate']: Data['LRazimuth'][1] = Data['LRazimuth'][0]+360 if Data['IOtth'][0] > Data['IOtth'][1]: Data['IOtth'][0],Data['IOtth'][1] = Data['IOtth'][1],Data['IOtth'][0] if Data['binType'] == 'Q': wave = Data['wavelength'] IOtth = [4.*math.pi*sind(Data['IOtth'][0]/2.)/wave,4.*math.pi*sind(Data['IOtth'][1]/2.)/wave] G2frame.InnerTth.SetValue(IOtth[0]) G2frame.OuterTth.SetValue(IOtth[1]) else: G2frame.InnerTth.SetValue(Data['IOtth'][0]) G2frame.OuterTth.SetValue(Data['IOtth'][1]) G2frame.Lazim.SetValue(Data['LRazimuth'][0]) G2frame.Razim.SetValue(Data['LRazimuth'][1]) elif pickType == "Spot" and treeItem == 'Masks': if event.button == 1: spotnum = G2frame.itemPicked.itemNumber Masks['Points'][spotnum][0:2] = G2frame.itemPicked.center elif event.button == 3: # update the selected circle mask with the last drawn values spotnum = G2frame.itemPicked.itemNumber Masks['Points'][spotnum] = list(G2frame.itemPicked.center) + [ 2.*G2frame.itemPicked.radius] G2imG.UpdateMasks(G2frame,Masks) elif pickType.startswith('Ring') and treeItem == 'Masks': G2imG.UpdateMasks(G2frame,Masks) # changes saved during animation elif pickType.startswith('Arc') and treeItem == 'Masks': G2imG.UpdateMasks(G2frame,Masks) # changes saved during animation elif pickType == 'Polygon' and treeItem == 'Masks': polygon = Masks['Polygons'][G2frame.itemPicked.itemNumber] UpdatePolygon(G2frame.itemPicked,event,polygon) G2imG.UpdateMasks(G2frame,Masks) elif pickType == 'Frame' and treeItem == 'Masks': UpdatePolygon(G2frame.itemPicked,event,Masks['Frames']) G2imG.UpdateMasks(G2frame,Masks) else: # nothing was done, nothing was changed, don't replot G2frame.itemPicked = None return wx.CallAfter(PlotImage,G2frame,newImage=True) G2frame.itemPicked = None # PlotImage execution starts here if not len(G2frame.ImageZ): return xylim = [] new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('2D Powder Image','mpl',newImage=newImage) if newImage: G2frame.MaskKey = '' # subtitle will be removed, so turn off mode if not new: if not newPlot: xylim = lim else: Page.canvas.mpl_connect('key_press_event', OnImPlotKeyPress) Page.canvas.mpl_connect('motion_notify_event', OnImMotion) Page.canvas.mpl_connect('pick_event', OnImPick) Page.canvas.mpl_connect('button_release_event', OnImRelease) Page.Choice = None Title = G2frame.GPXtree.GetItemText(G2frame.Image)[4:] G2frame.G2plotNB.status.DestroyChildren() #get rid of special stuff on status bar if G2frame.logPlot: Title = 'log('+Title+')' Plot.set_title(Title) try: if G2frame.GPXtree.GetItemText(G2frame.PickId) in ['Image Controls',]: Page.Choice = (' key press','l: log(I) on','d: set dmin','x: flip x','y: flip y',) if G2frame.logPlot: Page.Choice[1] = 'l: log(I) off' Page.keyPress = OnImPlotKeyPress elif G2frame.GPXtree.GetItemText(G2frame.PickId) in ['Masks',]: Page.Choice = [' key press','l: log(I) on','a: arc mask','r: ring mask', 'p: polygon mask','f: frame mask', 't: add spot mask at mouse position', 'd: select spot mask to delete with mouse', ' typing a number sets diameter of new spot masks', ' (space) input the spot mask diameter'] Page.Choice.append('s: start multiple spot mask mode') # this must be the last choice if G2frame.logPlot: Page.Choice[1] = 'l: log(I) off' Page.keyPress = OnImPlotKeyPress elif G2frame.GPXtree.GetItemText(G2frame.PickId) in ['Stress/Strain',]: Page.Choice = (' key press','a: add new ring',) Page.keyPress = OnImPlotKeyPress except TypeError: pass size,imagefile,imagetag = G2frame.GPXtree.GetImageLoc(G2frame.Image) imScale = 1 maxpix = 2048 if len(G2frame.ImageZ) > maxpix: imScale = len(G2frame.ImageZ)//maxpix sizexy = Data['size'] pixelSize = Data['pixelSize'] Xmax = sizexy[0]*pixelSize[0]/1000. Ymax = sizexy[1]*pixelSize[1]/1000. xlim = (0,Xmax) ylim = (Ymax,0) Imin,Imax = Data['range'][1] acolor = mpl.cm.get_cmap(Data['color']) xcent,ycent = Data['center'] Plot.set_xlabel('Image x-axis, mm',fontsize=12) Plot.set_ylabel('Image y-axis, mm',fontsize=12) #do threshold mask - "real" mask - others are just bondaries Zlim = Masks['Thresholds'][1] wx.BeginBusyCursor() try: if newImage: Imin,Imax = Data['range'][1] MA = ma.masked_greater(ma.masked_less(G2frame.ImageZ,Zlim[0]),Zlim[1]) MaskA = ma.getmaskarray(MA) A = G2img.ImageCompress(MA,imScale) AM = G2img.ImageCompress(MaskA,imScale) if G2frame.logPlot: A = np.where(A>Imin,np.where(A0,np.log(A),0) AM = np.where(AM>0,np.log(AM),0) Imin,Imax = [np.amin(A),np.amax(A)] Plot.imshow(AM,aspect='equal',cmap='Reds', interpolation='nearest',vmin=0,vmax=2,extent=[0,Xmax,Ymax,0]) Page.ImgObj = Plot.imshow(A,aspect='equal',cmap=acolor, interpolation='nearest',vmin=Imin,vmax=Imax,extent=[0,Xmax,Ymax,0]) Plot.plot(xcent,ycent,'x') #G2frame.GPXtree.GetItemText(item) if Data['showLines']: # draw integration range arc/circles/lines LRAzim = Data['LRazimuth'] #NB: integers Nazm = Data['outAzimuths'] delAzm = float(LRAzim[1]-LRAzim[0])/Nazm AzmthOff = Data['azmthOff'] IOtth = Data['IOtth'] wave = Data['wavelength'] dspI = wave/(2.0*sind(IOtth[0]/2.0)) ellI = G2img.GetEllipse(dspI,Data) #=False if dsp didn't yield an ellipse (ugh! a parabola or a hyperbola) dspO = wave/(2.0*sind(IOtth[1]/2.0)) ellO = G2img.GetEllipse(dspO,Data) #Ditto & more likely for outer ellipse Azm = np.arange(LRAzim[0],LRAzim[1]+1.)-AzmthOff if ellI: xyI = [] for azm in Azm: xy = G2img.GetDetectorXY(dspI,azm,Data) if np.any(xy): xyI.append(xy) if len(xyI): xyI = np.array(xyI) arcxI,arcyI = xyI.T Plot.plot(arcxI,arcyI,picker=3) if ellO: xyO = [] for azm in Azm: xy = G2img.GetDetectorXY(dspO,azm,Data) if np.any(xy): xyO.append(xy) if len(xyO): xyO = np.array(xyO) arcxO,arcyO = xyO.T Plot.plot(arcxO,arcyO,picker=3) if ellO and ellI: Plot.plot([arcxI[0],arcxO[0]],[arcyI[0],arcyO[0]],picker=3) Plot.plot([arcxI[-1],arcxO[-1]],[arcyI[-1],arcyO[-1]],picker=3) for i in range(Nazm): cake = LRAzim[0]+i*delAzm-AzmthOff if Data.get('centerAzm',False): cake += delAzm/2. ind = np.searchsorted(Azm,cake) Plot.plot([arcxI[ind],arcxO[ind]],[arcyI[ind],arcyO[ind]],color='k',dashes=(5,5)) if G2frame.PickId and G2frame.GPXtree.GetItemText(G2frame.PickId) in ['Image Controls',]: for xring,yring in Data['ring']: Plot.plot(xring,yring,'r+',picker=3) if Data['setRings']: N = 0 for ring in Data['rings']: xring,yring = np.array(ring).T[:2] Plot.plot(xring,yring,'.',color=colors[N%6]) N += 1 for ellipse in Data['ellipses']: #what about hyperbola? cent,phi,[width,height],col = ellipse if width > 0: #ellipses Plot.add_artist(Ellipse([cent[0],cent[1]],2*width,2*height,phi,ec=col,fc='none')) Plot.text(cent[0],cent[1],'+',color=col,ha='center',va='center') if G2frame.PickId and G2frame.GPXtree.GetItemText(G2frame.PickId) in ['Stress/Strain',]: for N,ring in enumerate(StrSta['d-zero']): if 'ImxyCalc' in ring: xringc,yringc = ring['ImxyCalc'] Plot.plot(xringc,yringc,colors[N%6]) xring,yring = ring['ImxyObs'] Plot.plot(xring,yring,colors[N%6]+'.') # display the Masks if 'Frames' not in Masks: Masks['Frames'] = [] # patch for i,spot in enumerate(Masks['Points']): # drawing spot masks if len(spot): x,y,d = spot artist = Circle((x,y),radius=d/2,fc='none',ec='r',picker=3) Plot.add_artist(artist) artist.itemNumber = i artist.itemType = 'Spot' G2frame.ringList = [] for iring,ring in enumerate(Masks['Rings']): # drawing spot masks if ring: tth,thick = ring wave = Data['wavelength'] (x1,y1),(x2,y2) = ComputeArc(tth-thick/2.,tth+thick/2.,wave) artistO, = Plot.plot(x1,y1,'r',picker=3) artistO.itemNumber = iring artistO.itemType = 'RingOuter' artistI, = Plot.plot(x2,y2,'r',picker=3) artistI.itemNumber = iring artistI.itemType = 'RingInner' G2frame.ringList.append([artistI,artistO]) G2frame.arcList = [] for iarc,arc in enumerate(Masks['Arcs']): # drawing arc masks if arc: tth,azm,thick = arc wave = Data['wavelength'] (x1,y1),(x2,y2) = ComputeArc(tth-thick/2.,tth+thick/2.,wave,azm[0],azm[1]) arcList = [] arcList.append(Plot.plot(x2,y2,'r',picker=3)[0]) # 'inner' arcList[-1].itemNumber = iarc arcList[-1].itemType = 'ArcInner' arcList.append(Plot.plot(x1,y1,'r',picker=3)[0]) # 'outer' arcList[-1].itemNumber = iarc arcList[-1].itemType = 'ArcOuter' arcList.append(Plot.plot([x1[0],x2[0]],[y1[0],y2[0]],'r',picker=3)[0]) # 'lower' arcList[-1].itemNumber = iarc arcList[-1].itemType = 'ArcLower' arcList.append(Plot.plot([x1[-1],x2[-1]],[y1[-1],y2[-1]],'r',picker=3)[0]) # 'upper' arcList[-1].itemNumber = iarc arcList[-1].itemType = 'ArcUpper' G2frame.arcList.append(arcList) G2frame.polyList = [] for ipoly,polygon in enumerate(Masks['Polygons']): if not polygon: continue # ignore if empty if polygon[0] != polygon[-1]: print('Closing polygon {}'.format(ipoly)) polygon.append(polygon[0][:]) xl,yl = np.hsplit(np.array(polygon),2) G2frame.polyList.append(Plot.plot(xl,yl,'r')[0]) # line for i,(x,y) in enumerate(zip(xl[:-1],yl[:-1])): artist = Plot.plot(x,y,'r+',picker=10)[0] # point (plus sign) artist.itemNumber = ipoly artist.itemType = 'Polygon' artist.pointNumber = i G2frame.frameArtist = [] if Masks['Frames']: polygon = Masks['Frames'] if polygon[0] != polygon[-1]: print('Closing frame mask') polygon.append(polygon[0][:]) xl,yl = np.hsplit(np.array(polygon),2) G2frame.frameArtist = Plot.plot(xl,yl,'g')[0] for i,(x,y) in enumerate(zip(xl[:-1],yl[:-1])): artist = Plot.plot(x,y,'g+',picker=10)[0] # point (plus sign) artist.itemType = 'Frame' artist.pointNumber = i if newImage: Page.figure.colorbar(Page.ImgObj) Plot.set_xlim(xlim) Plot.set_ylim(ylim) if Data['invert_x']: Plot.invert_xaxis() if Data['invert_y']: Plot.invert_yaxis() if not newPlot and xylim: Page.toolbar.push_current() Plot.set_xlim(xylim[0]) Plot.set_ylim(xylim[1]) xylim = [] Page.toolbar.push_current() Page.toolbar.draw() # patch for wx 2.9 on Mac, to force a redraw i,j= wx.__version__.split('.')[0:2] if int(i)+int(j)/10. > 2.8 and 'wxOSX' in wx.PlatformInfo: Page.canvas.draw() else: Page.canvas.draw() finally: wx.EndBusyCursor() ################################################################################ ##### PlotIntegration ################################################################################ def PlotIntegration(G2frame,newPlot=False,event=None): '''Plot of 2D image after image integration with 2-theta and azimuth as coordinates ''' def OnMotion(event): Page.SetToolTipString('') Page.canvas.SetCursor(wx.CROSS_CURSOR) azm = event.ydata tth = event.xdata if azm and tth: G2frame.G2plotNB.status.SetStatusText(\ 'Detector 2-th =%9.3fdeg, azm = %7.2fdeg'%(tth,azm),1) new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('2D Integration','mpl') if not new: if not newPlot: xylim = lim else: Page.canvas.mpl_connect('motion_notify_event', OnMotion) Page.views = False Page.Choice = None Data = G2frame.GPXtree.GetItemPyData( G2gd.GetGPXtreeItemId(G2frame,G2frame.Image, 'Image Controls')) image = G2frame.Integrate[0] xsc = G2frame.Integrate[1] ysc = G2frame.Integrate[2] Imin,Imax = Data['range'][1] acolor = mpl.cm.get_cmap(Data['color']) Plot.set_title(G2frame.GPXtree.GetItemText(G2frame.Image)[4:]) Plot.set_ylabel('azimuth',fontsize=12) Plot.set_xlabel('2-theta',fontsize=12) Img = Plot.imshow(image,cmap=acolor,vmin=Imin,vmax=Imax,interpolation='nearest', \ extent=[ysc[0],ysc[-1],xsc[-1],xsc[0]],aspect='auto') Page.figure.colorbar(Img) # if Data['ellipses']: # for ellipse in Data['ellipses']: # x,y = np.array(G2img.makeIdealRing(ellipse[:3])) #skip color # tth,azm = G2img.GetTthAzm(x,y,Data) ## azm = np.where(azm < 0.,azm+360,azm) # Plot.plot(tth,azm,'b,') if not newPlot: Page.toolbar.push_current() Plot.set_xlim(xylim[0]) Plot.set_ylim(xylim[1]) xylim = [] Page.toolbar.push_current() Page.toolbar.draw() else: Page.canvas.draw() ################################################################################ ##### PlotTRImage ################################################################################ def PlotTRImage(G2frame,tax,tay,taz,newPlot=False): '''a test plot routine - not normally used ''' def OnMotion(event): Page.SetToolTipString('') Page.canvas.SetCursor(wx.CROSS_CURSOR) azm = event.xdata tth = event.ydata if azm and tth: G2frame.G2plotNB.status.SetStatusText(\ 'Detector 2-th =%9.3fdeg, azm = %7.2fdeg'%(tth,azm),1) new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('2D Transformed Powder Image','mpl') if not new: if not newPlot: xylim = lim else: Page.canvas.mpl_connect('motion_notify_event', OnMotion) Page.views = False Page.Choice = None Data = G2frame.GPXtree.GetItemPyData( G2gd.GetGPXtreeItemId(G2frame,G2frame.Image, 'Image Controls')) Imin,Imax = Data['range'][1] step = (Imax-Imin)/5. V = np.arange(Imin,Imax,step) acolor = mpl.cm.get_cmap(Data['color']) Plot.set_title(G2frame.GPXtree.GetItemText(G2frame.Image)[4:]) Plot.set_xlabel('azimuth',fontsize=12) Plot.set_ylabel('2-theta',fontsize=12) Plot.contour(tax,tay,taz,V,cmap=acolor) if Data['showLines']: IOtth = Data['IOtth'] if Data['fullIntegrate']: LRAzim = [-180,180] else: LRAzim = Data['LRazimuth'] #NB: integers Plot.plot([LRAzim[0],LRAzim[1]],[IOtth[0],IOtth[0]],picker=True) Plot.plot([LRAzim[0],LRAzim[1]],[IOtth[1],IOtth[1]],picker=True) if not Data['fullIntegrate']: Plot.plot([LRAzim[0],LRAzim[0]],[IOtth[0],IOtth[1]],picker=True) Plot.plot([LRAzim[1],LRAzim[1]],[IOtth[0],IOtth[1]],picker=True) if Data['setRings']: rings = np.concatenate((Data['rings']),axis=0) for xring,yring,dsp in rings: x,y = G2img.GetTthAzm(xring,yring,Data) Plot.plot(y,x,'r+') if Data['ellipses']: for ellipse in Data['ellipses']: ring = np.array(G2img.makeIdealRing(ellipse[:3])) #skip color x,y = np.hsplit(ring,2) tth,azm = G2img.GetTthAzm(x,y,Data) Plot.plot(azm,tth,'b,') if not newPlot: Page.toolbar.push_current() Plot.set_xlim(xylim[0]) Plot.set_ylim(xylim[1]) xylim = [] Page.toolbar.push_current() Page.toolbar.draw() else: Page.canvas.draw() ################################################################################ ##### PlotStructure ################################################################################ def PlotStructure(G2frame,data,firstCall=False): '''Crystal structure plotting package. Can show structures as balls, sticks, lines, thermal motion ellipsoids and polyhedra. Magnetic moments shown as black/red arrows according to spin state ''' def FindPeaksBonds(XYZ): rFact = data['Drawing'].get('radiusFactor',0.85) #data['Drawing'] could be empty! Bonds = [[] for x in XYZ] for i,xyz in enumerate(XYZ): Dx = XYZ-xyz dist = np.sqrt(np.sum(np.inner(Dx,Amat)**2,axis=1)) IndB = ma.nonzero(ma.masked_greater(dist,rFact*2.2)) for j in IndB[0]: Bonds[i].append(Dx[j]/2.) Bonds[j].append(-Dx[j]/2.) return Bonds # PlotStructure initialization here global mcsaXYZ,mcsaTypes,mcsaBonds global cell, Vol, Amat, Bmat, A4mat, B4mat ForthirdPI = 4.0*math.pi/3.0 generalData = data['General'] cell = generalData['Cell'][1:7] Vol = generalData['Cell'][7:8][0] Amat,Bmat = G2lat.cell2AB(cell) #Amat - crystal to cartesian, Bmat - inverse Gmat,gmat = G2lat.cell2Gmat(cell) A4mat = np.concatenate((np.concatenate((Amat,[[0],[0],[0]]),axis=1),[[0,0,0,1],]),axis=0) B4mat = np.concatenate((np.concatenate((Bmat,[[0],[0],[0]]),axis=1),[[0,0,0,1],]),axis=0) SGData = generalData['SGData'] SpnFlp = SGData.get('SpnFlp',[1,]) atomData = data['Atoms'] mapPeaks = [] if generalData.get('DisAglCtrls',{}): BondRadii = generalData['DisAglCtrls']['BondRadii'] else: BondRadii = generalData['BondRadii'] drawingData = data['Drawing'] if not drawingData: return #nothing setup, nothing to draw if 'Map Peaks' in data: mapPeaks = np.array(data['Map Peaks']) peakMax = 100. if len(mapPeaks): peakMax = np.max(mapPeaks.T[0]) if 'Plane' not in drawingData: drawingData['Plane'] = [[0,0,1],False,False,0.0,[255,255,0]] resRBData = data['RBModels'].get('Residue',[]) vecRBData = data['RBModels'].get('Vector',[]) rbAtmDict = {} for rbObj in resRBData+vecRBData: exclList = ['X' for i in range(len(rbObj['Ids']))] rbAtmDict.update(dict(zip(rbObj['Ids'],exclList))) testRBObj = data.get('testRBObj',{}) rbObj = testRBObj.get('rbObj',{}) MCSA = data.get('MCSA',{}) mcsaModels = MCSA.get('Models',[]) if len(mcsaModels) > 1: XYZs,Types = G2mth.UpdateMCSAxyz(Bmat,MCSA) mcsaXYZ = [] mcsaTypes = [] neqv = 0 for xyz,atyp in zip(XYZs,Types): equiv = G2spc.GenAtom(xyz,SGData,All=True,Move=False) neqv = max(neqv,len(equiv)) for item in equiv: mcsaXYZ.append(item[0]) mcsaTypes.append(atyp) mcsaXYZ = np.array(mcsaXYZ) mcsaTypes = np.array(mcsaTypes) nuniq = mcsaXYZ.shape[0]//neqv mcsaXYZ = np.reshape(mcsaXYZ,(nuniq,neqv,3)) mcsaTypes = np.reshape(mcsaTypes,(nuniq,neqv)) cent = np.fix(np.sum(mcsaXYZ+2.,axis=0)/nuniq)-2 cent[0] = [0,0,0] #make sure 1st one isn't moved mcsaXYZ = np.swapaxes(mcsaXYZ,0,1)-cent[:,np.newaxis,:] mcsaTypes = np.swapaxes(mcsaTypes,0,1) mcsaXYZ = np.reshape(mcsaXYZ,(nuniq*neqv,3)) mcsaTypes = np.reshape(mcsaTypes,(nuniq*neqv)) mcsaBonds = FindPeaksBonds(mcsaXYZ) drawAtoms = drawingData.get('Atoms',[]) mapData = {} showBonds = False if 'Map' in generalData: mapData = generalData['Map'] showBonds = mapData.get('Show bonds',False) Wt = np.array([255,255,255]) Rd = np.array([255,0,0]) Gr = np.array([0,255,0]) wxGreen = wx.Colour(0,255,0) Bl = np.array([0,0,255]) Or = np.array([255,128,0]) wxOrange = wx.Colour(255,128,0) uBox = np.array([[0,0,0],[1,0,0],[1,1,0],[0,1,0],[0,0,1],[1,0,1],[1,1,1],[0,1,1]]) uEdges = np.array([ [uBox[0],uBox[1]],[uBox[0],uBox[3]],[uBox[0],uBox[4]],[uBox[1],uBox[2]], [uBox[2],uBox[3]],[uBox[1],uBox[5]],[uBox[2],uBox[6]],[uBox[3],uBox[7]], [uBox[4],uBox[5]],[uBox[5],uBox[6]],[uBox[6],uBox[7]],[uBox[7],uBox[4]]]) mD = 0.1 mV = np.array([[[-mD,0,0],[mD,0,0]],[[0,-mD,0],[0,mD,0]],[[0,0,-mD],[0,0,mD]]]) mapPeakVecs = np.inner(mV,Bmat) backColor = np.array(list(drawingData['backColor'])+[0,]) Bc = np.array(list(drawingData['backColor'])) uColors = [Rd,Gr,Bl,Wt-Bc, Wt-Bc,Wt-Bc,Wt-Bc,Wt-Bc, Wt-Bc,Wt-Bc,Wt-Bc,Wt-Bc] G2frame.tau = 0. G2frame.seq = 0 def OnKeyBox(event): mode = cb.GetValue() if mode in ['jpeg','bmp','tiff',]: try: import Image as Im except ImportError: try: from PIL import Image as Im except ImportError: print ("PIL/pillow Image module not present. Cannot save images without this") raise Exception("PIL/pillow Image module not found") projFile = G2frame.GSASprojectfile Fname = (os.path.splitext(projFile)[0]+'.'+mode).replace('*','+') size = Page.canvas.GetSize() GL.glPixelStorei(GL.GL_UNPACK_ALIGNMENT, 1) if mode in ['jpeg',]: Pix = GL.glReadPixels(0,0,size[0],size[1],GL.GL_RGBA, GL.GL_UNSIGNED_BYTE) im = Im.new("RGBA", (size[0],size[1])) else: Pix = GL.glReadPixels(0,0,size[0],size[1],GL.GL_RGB, GL.GL_UNSIGNED_BYTE) im = Im.new("RGB", (size[0],size[1])) try: im.frombytes(Pix) except AttributeError: im.fromstring(Pix) im = im.transpose(Im.FLIP_TOP_BOTTOM) im.save(Fname,mode) cb.SetValue(' save as/key:') G2frame.G2plotNB.status.SetStatusText('Drawing saved to: '+Fname,1) else: event.key = cb.GetValue()[0] cb.SetValue(' save as/key:') wx.CallAfter(OnKey,event) Page.canvas.SetFocus() # redirect the Focus from the button back to the plot def OnKey(event): #on key UP!! keyBox = False try: keyCode = event.GetKeyCode() if keyCode > 255: keyCode = 0 key = chr(keyCode) except AttributeError: #if from OnKeyBox above keyBox = True key = str(event.key).upper() indx = drawingData['selectedAtoms'] cx,ct = drawingData['atomPtrs'][:2] if key in ['C']: drawingData['viewPoint'] = [np.array([.5,.5,.5]),[0,0]] drawingData['viewDir'] = [0,0,1] drawingData['oldxy'] = [] V0 = np.array([0,0,1]) V = np.inner(Amat,V0) V /= np.sqrt(np.sum(V**2)) A = np.arccos(np.sum(V*V0)) Q = G2mth.AV2Q(A,[0,1,0]) drawingData['Quaternion'] = Q SetViewPointText(drawingData['viewPoint'][0]) SetViewDirText(drawingData['viewDir']) Q = drawingData['Quaternion'] G2frame.G2plotNB.status.SetStatusText('New quaternion: %.2f+, %.2fi+ ,%.2fj+, %.2fk'%(Q[0],Q[1],Q[2],Q[3]),1) elif key in ['N']: drawAtoms = drawingData['Atoms'] if not len(drawAtoms): #no atoms return pI = drawingData['viewPoint'][1] if not len(pI): pI = [0,0] if indx: pI[0] = indx[pI[1]] Tx,Ty,Tz = drawAtoms[pI[0]][cx:cx+3] pI[1] += 1 if pI[1] >= len(indx): pI[1] = 0 else: Tx,Ty,Tz = drawAtoms[pI[0]][cx:cx+3] pI[0] += 1 if pI[0] >= len(drawAtoms): pI[0] = 0 drawingData['viewPoint'] = [np.array([Tx,Ty,Tz]),pI] SetViewPointText(drawingData['viewPoint'][0]) G2frame.G2plotNB.status.SetStatusText('View point at atom '+drawAtoms[pI[0]][ct-1]+str(pI),1) elif key in ['P']: drawAtoms = drawingData['Atoms'] if not len(drawAtoms): #no atoms return pI = drawingData['viewPoint'][1] if not len(pI): pI = [0,0] if indx: pI[0] = indx[pI[1]] Tx,Ty,Tz = drawAtoms[pI[0]][cx:cx+3] pI[1] -= 1 if pI[1] < 0: pI[1] = len(indx)-1 else: Tx,Ty,Tz = drawAtoms[pI[0]][cx:cx+3] pI[0] -= 1 if pI[0] < 0: pI[0] = len(drawAtoms)-1 drawingData['viewPoint'] = [np.array([Tx,Ty,Tz]),pI] SetViewPointText(drawingData['viewPoint'][0]) G2frame.G2plotNB.status.SetStatusText('View point at atom '+drawAtoms[pI[0]][ct-1]+str(pI),1) elif key in ['U','D','L','R'] and mapData['Flip'] == True: dirDict = {'U':[0,1],'D':[0,-1],'L':[-1,0],'R':[1,0]} SetMapRoll(dirDict[key]) if 'rho' in generalData.get('4DmapData',{}): Set4DMapRoll(dirDict[key]) SetPeakRoll(dirDict[key]) SetMapPeaksText(mapPeaks) elif key in ['M',]and generalData['Modulated']: #make a movie file G2frame.tau = 0. for i in range(100): G2frame.tau += 0.1 G2frame.tau %= 1. G2frame.G2plotNB.status.SetStatusText('Modulation tau = %.2f'%(G2frame.tau),1) data['Drawing']['Atoms'],Fade = G2mth.ApplyModulation(data,G2frame.tau) #modifies drawing atom array! SetDrawAtomsText(data['Drawing']['Atoms']) G2phG.FindBondsDraw(data) #rebuild bonds & polygons if not np.any(Fade): Fade += 1 Draw('key down',Fade) return elif key in ['+','-','=','0']: if keyBox: OnKeyPressed(event) return Draw('key up') def OnKeyPressed(event): #On key down for repeating operation - used to change tau... try: keyCode = event.GetKeyCode() if keyCode > 255: keyCode = 0 key = chr(keyCode) except AttributeError: #if from OnKeyBox above key = str(event.key).upper() if key in ['+','-','=','0']: if generalData['Modulated']: if key == '0': G2frame.tau = 0. elif key in ['+','=']: G2frame.tau += 0.1 elif key == '-': G2frame.tau -= 0.1 G2frame.tau %= 1. #force 0-1 range; makes loop G2frame.G2plotNB.status.SetStatusText('Modulation tau = %.2f'%(G2frame.tau),1) data['Drawing']['Atoms'],Fade = G2mth.ApplyModulation(data,G2frame.tau) #modifies drawing atom array! SetDrawAtomsText(data['Drawing']['Atoms']) G2phG.FindBondsDraw(data) #rebuild bonds & polygons if not np.any(Fade): Fade += 1 Draw('key down',Fade) else: #TODO sequential result movie here SeqId = G2gd.GetGPXtreeItemId(G2frame, G2frame.root, 'Sequential results') if SeqId: Seqdata = G2frame.GPXtree.GetItemPyData(SeqId) histNames = [seqKey for seqKey in Seqdata.keys() if 'PWDR' in seqKey] histNames.sort() if key == '0': G2frame.seq = 0 elif key in ['=','+']: G2frame.seq += 1 elif key in ['-','_']: G2frame.seq -= 1 G2frame.seq %= len(histNames) #makes loop G2frame.G2plotNB.status.SetStatusText('Seq. data file: %s'%(histNames[G2frame.seq]),1) pId = data['pId'] SGData = generalData['SGData'] pfx = str(pId)+'::' phfx = '%d:%d:'%(pId,G2frame.seq) seqData = Seqdata[histNames[G2frame.seq]] parmDict = seqData['parmDict'] cellA = G2lat.cellDijFill(pfx,phfx,SGData,parmDict) global cell, Vol, Amat, Bmat, A4mat, B4mat cell = G2lat.A2cell(cellA) Vol = G2lat.calc_V(cellA) Amat,Bmat = G2lat.cell2AB(cell) #Amat - crystal to cartesian, Bmat - inverse Gmat,gmat = G2lat.cell2Gmat(cell) A4mat = np.concatenate((np.concatenate((Amat,[[0],[0],[0]]),axis=1),[[0,0,0,1],]),axis=0) B4mat = np.concatenate((np.concatenate((Bmat,[[0],[0],[0]]),axis=1),[[0,0,0,1],]),axis=0) data['Drawing']['Atoms'] = G2mth.ApplySeqData(data,seqData) SetDrawAtomsText(data['Drawing']['Atoms']) G2phG.FindBondsDrawCell(data,cell) #rebuild bonds & polygons Draw('key down') else: pass def GetTruePosition(xy,Add=False): View = GL.glGetIntegerv(GL.GL_VIEWPORT) Proj = GL.glGetDoublev(GL.GL_PROJECTION_MATRIX) Model = GL.glGetDoublev(GL.GL_MODELVIEW_MATRIX) Zmax = 1. if Add: Indx = GetSelectedAtoms() if G2frame.phaseDisplay.GetPageText(getSelection()) == 'Map peaks': for i,peak in enumerate(mapPeaks): x,y,z = peak[1:4] X,Y,Z = GLU.gluProject(x,y,z,Model,Proj,View) XY = [int(X),int(View[3]-Y)] if np.allclose(xy,XY,atol=10) and Z < Zmax: Zmax = Z try: Indx.remove(i) ClearSelectedAtoms() for id in Indx: SetSelectedAtoms(id,Add) except: SetSelectedAtoms(i,Add) else: cx = drawingData['atomPtrs'][0] for i,atom in enumerate(drawAtoms): x,y,z = atom[cx:cx+3] X,Y,Z = GLU.gluProject(x,y,z,Model,Proj,View) XY = [int(X),int(View[3]-Y)] if np.allclose(xy,XY,atol=10) and Z < Zmax: Zmax = Z try: Indx.remove(i) ClearSelectedAtoms() for id in Indx: SetSelectedAtoms(id,Add) except: SetSelectedAtoms(i,Add) def OnMouseDown(event): xy = event.GetPosition() if event.ShiftDown(): if event.LeftIsDown(): GetTruePosition(xy) elif event.RightIsDown(): GetTruePosition(xy,True) else: drawingData['oldxy'] = list(xy) def OnMouseMove(event): if event.ShiftDown(): #don't want any inadvertant moves when picking return newxy = event.GetPosition() if event.Dragging(): if event.AltDown() and rbObj: if event.LeftIsDown(): SetRBRotation(newxy) Q = rbObj['Orient'][0] G2frame.G2plotNB.status.SetStatusText('New quaternion: %.2f+, %.2fi+ ,%.2fj+, %.2fk'%(Q[0],Q[1],Q[2],Q[3]),1) elif event.RightIsDown(): SetRBTranslation(newxy) Tx,Ty,Tz = rbObj['Orig'][0] G2frame.G2plotNB.status.SetStatusText('New view point: %.4f, %.4f, %.4f'%(Tx,Ty,Tz),1) elif event.MiddleIsDown(): SetRBRotationZ(newxy) Q = rbObj['Orient'][0] G2frame.G2plotNB.status.SetStatusText('New quaternion: %.2f+, %.2fi+ ,%.2fj+, %.2fk'%(Q[0],Q[1],Q[2],Q[3]),1) Draw('move') elif not event.ControlDown(): if event.LeftIsDown(): SetRotation(newxy) Q = drawingData['Quaternion'] G2frame.G2plotNB.status.SetStatusText('New quaternion: %.2f+, %.2fi+ ,%.2fj+, %.2fk'%(Q[0],Q[1],Q[2],Q[3]),1) elif event.RightIsDown(): SetTranslation(newxy) Tx,Ty,Tz = drawingData['viewPoint'][0] rho = G2mth.getRho([Tx,Ty,Tz],mapData) G2frame.G2plotNB.status.SetStatusText('New view point: %.4f, %.4f, %.4f; density: %.4f'%(Tx,Ty,Tz,rho),1) elif event.MiddleIsDown(): SetRotationZ(newxy) Q = drawingData['Quaternion'] G2frame.G2plotNB.status.SetStatusText('New quaternion: %.2f+, %.2fi+ ,%.2fj+, %.2fk'%(Q[0],Q[1],Q[2],Q[3]),1) Draw('move') def OnMouseWheel(event): if event.ShiftDown(): return drawingData['cameraPos'] += event.GetWheelRotation()/24. drawingData['cameraPos'] = max(10,min(500,drawingData['cameraPos'])) G2frame.G2plotNB.status.SetStatusText('New camera distance: %.2f'%(drawingData['cameraPos']),1) page = getSelection() if page: if G2frame.phaseDisplay.GetPageText(page) == 'Draw Options': G2frame.phaseDisplay.cameraPosTxt.SetLabel('Camera Position: '+'%.2f'%(drawingData['cameraPos'])) G2frame.phaseDisplay.cameraSlider.SetValue(drawingData['cameraPos']) Draw('wheel') def getSelection(): try: return G2frame.phaseDisplay.GetSelection() except AttributeError: G2frame.G2plotNB.status.SetStatusText('Select this from Phase data window!',1) return 0 def SetViewPointText(VP): page = getSelection() if page: if G2frame.phaseDisplay.GetPageText(page) == 'Draw Options': G2frame.phaseDisplay.viewPoint.SetValue('%.3f %.3f %.3f'%(VP[0],VP[1],VP[2])) def SetRBOrigText(): page = getSelection() if page: if G2frame.phaseDisplay.GetPageText(page) == 'RB Models': for i,sizer in enumerate(testRBObj['Sizers']['Xsizers']): sizer.SetValue('%8.5f'%(testRBObj['rbObj']['Orig'][0][i])) def SetRBOrienText(): page = getSelection() if page: if G2frame.phaseDisplay.GetPageText(page) == 'RB Models': for i,sizer in enumerate(testRBObj['Sizers']['Osizers']): sizer.SetValue('%8.5f'%(testRBObj['rbObj']['Orient'][0][i])) def SetViewDirText(VD): page = getSelection() if page: if G2frame.phaseDisplay.GetPageText(page) == 'Draw Options': G2frame.phaseDisplay.viewDir.SetValue('%.3f %.3f %.3f'%(VD[0],VD[1],VD[2])) def SetMapPeaksText(mapPeaks): data['Map Peaks'] = mapPeaks page = getSelection() if page: if G2frame.phaseDisplay.GetPageText(page) == 'Map peaks': G2frame.MapPeaksTable.SetData(data['Map Peaks']) panel = G2frame.phaseDisplay.GetPage(page).GetChildren() names = [child.GetName() for child in panel] try: panel[names.index('GridWindow')].Refresh() except ValueError: #different wx versions! panel[names.index('grid window')].Refresh() def SetDrawAtomsText(drawAtoms): page = getSelection() if page: if G2frame.phaseDisplay.GetPageText(page) == 'Draw Atoms': table = G2frame.atomTable.GetData() for i,atom in enumerate(drawAtoms): table[i][2:5] = atom[2:5] G2frame.atomTable.SetData(table) panel = G2frame.phaseDisplay.GetPage(page).GetChildren() names = [child.GetName() for child in panel] try: panel[names.index('GridWindow')].Refresh() except ValueError: #different wx versions! panel[names.index('grid window')].Refresh() def ClearSelectedAtoms(): page = getSelection() if page: if G2frame.phaseDisplay.GetPageText(page) == 'Draw Atoms': G2frame.phaseDisplay.GetPage(page).ClearSelection() #this is the Atoms grid in Draw Atoms elif G2frame.phaseDisplay.GetPageText(page) == 'Map peaks': G2frame.phaseDisplay.GetPage(page).ClearSelection() #this is the Atoms grid in Atoms elif G2frame.phaseDisplay.GetPageText(page) == 'Atoms': G2frame.phaseDisplay.GetPage(page).ClearSelection() #this is the Atoms grid in Atoms def SetSelectedAtoms(ind,Add=False): page = getSelection() if page: if G2frame.phaseDisplay.GetPageText(page) == 'Draw Atoms': G2frame.phaseDisplay.GetPage(page).SelectRow(ind,Add) #this is the Atoms grid in Draw Atoms elif G2frame.phaseDisplay.GetPageText(page) == 'Map peaks': G2frame.phaseDisplay.GetPage(page).SelectRow(ind,Add) elif G2frame.phaseDisplay.GetPageText(page) == 'Atoms': Id = drawAtoms[ind][-3] for i,atom in enumerate(atomData): if atom[-1] == Id: G2frame.phaseDisplay.GetPage(page).SelectRow(i) #this is the Atoms grid in Atoms def GetSelectedAtoms(): page = getSelection() Ind = [] if page: if G2frame.phaseDisplay.GetPageText(page) == 'Draw Atoms': Ind = G2frame.phaseDisplay.GetPage(page).GetSelectedRows() #this is the Atoms grid in Draw Atoms elif G2frame.phaseDisplay.GetPageText(page) == 'Map peaks': Ind = G2frame.phaseDisplay.GetPage(page).GetSelectedRows() elif G2frame.phaseDisplay.GetPageText(page) == 'Atoms': Ind = G2frame.phaseDisplay.GetPage(page).GetSelectedRows() #this is the Atoms grid in Atoms return Ind def SetBackground(): R,G,B,A = Page.camera['backColor'] GL.glClearColor(R,G,B,A) GL.glClear(GL.GL_COLOR_BUFFER_BIT | GL.GL_DEPTH_BUFFER_BIT) def SetLights(): GL.glEnable(GL.GL_DEPTH_TEST) GL.glShadeModel(GL.GL_SMOOTH) GL.glEnable(GL.GL_LIGHTING) GL.glEnable(GL.GL_LIGHT0) GL.glLightModeli(GL.GL_LIGHT_MODEL_TWO_SIDE,0) GL.glLightfv(GL.GL_LIGHT0,GL.GL_AMBIENT,[.1,.1,.1,1]) GL.glLightfv(GL.GL_LIGHT0,GL.GL_DIFFUSE,[.8,.8,.8,1]) # glLightfv(GL_LIGHT0,GL_SPECULAR,[1,1,1,1]) # glLightfv(GL_LIGHT0,GL_POSITION,[0,0,1,1]) def GetRoll(newxy,rhoshape): Q = drawingData['Quaternion'] dxy = G2mth.prodQVQ(G2mth.invQ(Q),np.inner(Bmat,newxy+[0,])) dxy = np.array(dxy*rhoshape) roll = np.where(dxy>0.5,1,np.where(dxy<-.5,-1,0)) return roll def SetMapRoll(newxy): rho = generalData['Map']['rho'] roll = GetRoll(newxy,rho.shape) generalData['Map']['rho'] = np.roll(np.roll(np.roll(rho,roll[0],axis=0),roll[1],axis=1),roll[2],axis=2) drawingData['oldxy'] = list(newxy) def Set4DMapRoll(newxy): rho = generalData['4DmapData']['rho'] roll = GetRoll(newxy,rho.shape[:3]) generalData['4DmapData']['rho'] = np.roll(np.roll(np.roll(rho,roll[0],axis=0),roll[1],axis=1),roll[2],axis=2) def SetPeakRoll(newxy): rho = generalData['Map']['rho'] roll = GetRoll(newxy,rho.shape) steps = 1./np.array(rho.shape) dxy = roll*steps for peak in mapPeaks: peak[1:4] += dxy peak[1:4] %= 1. peak[4] = np.sqrt(np.sum(np.inner(Amat,peak[1:4])**2)) def SetTranslation(newxy): #first get translation vector in screen coords. oldxy = drawingData['oldxy'] if not len(oldxy): oldxy = list(newxy) dxy = newxy-oldxy drawingData['oldxy'] = list(newxy) V = np.array([-dxy[0],dxy[1],0.]) #then transform to rotated crystal coordinates & apply to view point Q = drawingData['Quaternion'] V = np.inner(Bmat,G2mth.prodQVQ(G2mth.invQ(Q),V)) Tx,Ty,Tz = drawingData['viewPoint'][0] Tx += V[0]*0.01 Ty += V[1]*0.01 Tz += V[2]*0.01 drawingData['viewPoint'][0] = np.array([Tx,Ty,Tz]) SetViewPointText([Tx,Ty,Tz]) def SetRBTranslation(newxy): #first get translation vector in screen coords. oldxy = drawingData['oldxy'] if not len(oldxy): oldxy = list(newxy) dxy = newxy-oldxy drawingData['oldxy'] = list(newxy) V = np.array([-dxy[0],dxy[1],0.]) #then transform to rotated crystal coordinates & apply to RB origin Q = drawingData['Quaternion'] V = np.inner(Bmat,G2mth.prodQVQ(G2mth.invQ(Q),V)) Tx,Ty,Tz = rbObj['Orig'][0] Tx -= V[0]*0.01 Ty -= V[1]*0.01 Tz -= V[2]*0.01 rbObj['Orig'][0] = Tx,Ty,Tz SetRBOrigText() def SetRotation(newxy): 'Perform a rotation in x-y space due to a left-mouse drag' #first get rotation vector in screen coords. & angle increment oldxy = drawingData['oldxy'] if not len(oldxy): oldxy = list(newxy) dxy = newxy-oldxy drawingData['oldxy'] = list(newxy) V = np.array([dxy[1],dxy[0],0.]) A = 0.25*np.sqrt(dxy[0]**2+dxy[1]**2) if not A: return # nothing changed, nothing to do # next transform vector back to xtal coordinates via inverse quaternion # & make new quaternion Q = drawingData['Quaternion'] V = G2mth.prodQVQ(G2mth.invQ(Q),np.inner(Bmat,V)) DQ = G2mth.AVdeg2Q(A,V) Q = G2mth.prodQQ(Q,DQ) drawingData['Quaternion'] = Q # finally get new view vector - last row of rotation matrix VD = np.inner(Bmat,G2mth.Q2Mat(Q)[2]) VD /= np.sqrt(np.sum(VD**2)) drawingData['viewDir'] = VD SetViewDirText(VD) def SetRotationZ(newxy): #first get rotation vector (= view vector) in screen coords. & angle increment View = GL.glGetIntegerv(GL.GL_VIEWPORT) cent = [View[2]/2,View[3]/2] oldxy = drawingData['oldxy'] if not len(oldxy): oldxy = list(newxy) dxy = newxy-oldxy drawingData['oldxy'] = list(newxy) V = drawingData['viewDir'] A = [0,0] A[0] = dxy[1]*.25 A[1] = dxy[0]*.25 if newxy[0] > cent[0]: A[0] *= -1 if newxy[1] < cent[1]: A[1] *= -1 # next transform vector back to xtal coordinates & make new quaternion Q = drawingData['Quaternion'] V = np.inner(Amat,V) Qx = G2mth.AVdeg2Q(A[0],V) Qy = G2mth.AVdeg2Q(A[1],V) Q = G2mth.prodQQ(Q,Qx) Q = G2mth.prodQQ(Q,Qy) drawingData['Quaternion'] = Q def SetRBRotation(newxy): #first get rotation vector in screen coords. & angle increment oldxy = drawingData['oldxy'] if not len(oldxy): oldxy = list(newxy) dxy = newxy-oldxy drawingData['oldxy'] = list(newxy) V = np.array([dxy[1],dxy[0],0.]) A = 0.25*np.sqrt(dxy[0]**2+dxy[1]**2) # next transform vector back to xtal coordinates via inverse quaternion # & make new quaternion Q = rbObj['Orient'][0] #rotate RB to Cart QC = drawingData['Quaternion'] #rotate Cart to drawing V = G2mth.prodQVQ(G2mth.invQ(QC),V) V = G2mth.prodQVQ(G2mth.invQ(Q),V) DQ = G2mth.AVdeg2Q(A,V) Q = G2mth.prodQQ(Q,DQ) rbObj['Orient'][0] = Q SetRBOrienText() def SetRBRotationZ(newxy): #first get rotation vector (= view vector) in screen coords. & angle increment View = GL.glGetIntegerv(GL.GL_VIEWPORT) cent = [View[2]/2,View[3]/2] oldxy = drawingData['oldxy'] if not len(oldxy): oldxy = list(newxy) dxy = newxy-oldxy drawingData['oldxy'] = list(newxy) V = drawingData['viewDir'] A = [0,0] A[0] = dxy[1]*.25 A[1] = dxy[0]*.25 if newxy[0] < cent[0]: A[0] *= -1 if newxy[1] > cent[1]: A[1] *= -1 # next transform vector back to RB coordinates & make new quaternion Q = rbObj['Orient'][0] #rotate RB to cart V = np.inner(Amat,V) V = -G2mth.prodQVQ(G2mth.invQ(Q),V) Qx = G2mth.AVdeg2Q(A[0],V) Qy = G2mth.AVdeg2Q(A[1],V) Q = G2mth.prodQQ(Q,Qx) Q = G2mth.prodQQ(Q,Qy) rbObj['Orient'][0] = Q SetRBOrienText() def RenderBox(): GL.glEnable(GL.GL_COLOR_MATERIAL) GL.glLineWidth(2) GL.glEnable(GL.GL_BLEND) GL.glBlendFunc(GL.GL_SRC_ALPHA,GL.GL_ONE_MINUS_SRC_ALPHA) GL.glEnable(GL.GL_LINE_SMOOTH) GL.glBegin(GL.GL_LINES) for line,color in zip(uEdges,uColors): GL.glColor3ubv(color) GL.glVertex3fv(line[0]) GL.glVertex3fv(line[1]) GL.glEnd() GL.glColor4ubv([0,0,0,0]) GL.glDisable(GL.GL_LINE_SMOOTH) GL.glDisable(GL.GL_BLEND) GL.glDisable(GL.GL_COLOR_MATERIAL) def RenderUnitVectors(x,y,z): GL.glEnable(GL.GL_COLOR_MATERIAL) GL.glLineWidth(2) GL.glEnable(GL.GL_BLEND) GL.glBlendFunc(GL.GL_SRC_ALPHA,GL.GL_ONE_MINUS_SRC_ALPHA) GL.glEnable(GL.GL_LINE_SMOOTH) GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glScalef(1/cell[0],1/cell[1],1/cell[2]) GL.glBegin(GL.GL_LINES) for line,color in list(zip(uEdges,uColors))[:3]: GL.glColor3ubv(color) GL.glVertex3fv(-line[1]/2.) GL.glVertex3fv(line[1]/2.) GL.glEnd() GL.glPopMatrix() GL.glColor4ubv([0,0,0,0]) GL.glDisable(GL.GL_LINE_SMOOTH) GL.glDisable(GL.GL_BLEND) GL.glDisable(GL.GL_COLOR_MATERIAL) def RenderPlane(plane,color): fade = list(color) + [.25,] GL.glMaterialfv(GL.GL_FRONT_AND_BACK,GL.GL_AMBIENT_AND_DIFFUSE,fade) GL.glShadeModel(GL.GL_FLAT) GL.glEnable(GL.GL_BLEND) GL.glBlendFunc(GL.GL_SRC_ALPHA,GL.GL_ONE_MINUS_SRC_ALPHA) GL.glPushMatrix() GL.glShadeModel(GL.GL_SMOOTH) GL.glPolygonMode(GL.GL_FRONT_AND_BACK,GL.GL_FILL) GL.glFrontFace(GL.GL_CW) GL.glBegin(GL.GL_TRIANGLE_FAN) for vertex in plane: GL.glVertex3fv(vertex) GL.glEnd() GL.glPopMatrix() GL.glDisable(GL.GL_BLEND) GL.glShadeModel(GL.GL_SMOOTH) def RenderSphere(x,y,z,radius,color): GL.glMaterialfv(GL.GL_FRONT_AND_BACK,GL.GL_DIFFUSE,color) GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glMultMatrixf(B4mat.T) q = GLU.gluNewQuadric() GLU.gluSphere(q,radius,20,10) GL.glPopMatrix() def RenderDots(XYZ,RC): GL.glEnable(GL.GL_COLOR_MATERIAL) XYZ = np.array(XYZ) GL.glPushMatrix() for xyz,rc in zip(XYZ,RC): x,y,z = xyz r,c = rc GL.glColor3fv(c/255.) GL.glPointSize(r*50) GL.glBegin(GL.GL_POINTS) GL.glVertex3fv(xyz) GL.glEnd() GL.glPopMatrix() GL.glColor4ubv([0,0,0,0]) GL.glDisable(GL.GL_COLOR_MATERIAL) def RenderSmallSphere(x,y,z,radius,color): GL.glMaterialfv(GL.GL_FRONT_AND_BACK,GL.GL_DIFFUSE,color) GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glMultMatrixf(B4mat.T) q = GLU.gluNewQuadric() GLU.gluSphere(q,radius,4,2) GL.glPopMatrix() def RenderEllipsoid(x,y,z,ellipseProb,E,R4,color): s1,s2,s3 = E GL.glMaterialfv(GL.GL_FRONT_AND_BACK,GL.GL_DIFFUSE,color) GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glMultMatrixf(B4mat.T) GL.glMultMatrixf(R4.T) GL.glEnable(GL.GL_NORMALIZE) GL.glScale(s1,s2,s3) q = GLU.gluNewQuadric() GLU.gluSphere(q,ellipseProb,20,10) GL.glDisable(GL.GL_NORMALIZE) GL.glPopMatrix() def RenderBonds(x,y,z,Bonds,radius,color,slice=20): GL.glMaterialfv(GL.GL_FRONT_AND_BACK,GL.GL_DIFFUSE,color) GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glMultMatrixf(B4mat.T) for bond in Bonds: GL.glPushMatrix() Dx = np.inner(Amat,bond) Z = np.sqrt(np.sum(Dx**2)) if Z: azm = atan2d(-Dx[1],-Dx[0]) phi = acosd(Dx[2]/Z) GL.glRotate(-azm,0,0,1) GL.glRotate(phi,1,0,0) q = GLU.gluNewQuadric() GLU.gluCylinder(q,radius,radius,Z,slice,2) GL.glPopMatrix() GL.glPopMatrix() def RenderMoment(x,y,z,Moment,color,slice=20): Dx = 0.5*Moment Z = np.sqrt(np.sum(Dx**2)) if Z: GL.glMaterialfv(GL.GL_FRONT_AND_BACK,GL.GL_DIFFUSE,color) GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glMultMatrixf(B4mat.T) GL.glTranslate(-Dx[0],-Dx[1],-Dx[2]) azm = atan2d(-Dx[1],-Dx[0]) phi = acosd(Dx[2]/Z) GL.glRotate(-azm,0,0,1) GL.glRotate(phi,1,0,0) q = GLU.gluNewQuadric() GLU.gluQuadricOrientation(q,GLU.GLU_INSIDE) GLU.gluDisk(q,0.,.1,slice,1) GLU.gluQuadricOrientation(q,GLU.GLU_OUTSIDE) GLU.gluCylinder(q,.1,.1,2.*Z,slice,2) GL.glTranslate(0,0,2*Z) GLU.gluQuadricOrientation(q,GLU.GLU_INSIDE) GLU.gluDisk(q,.1,.2,slice,1) GLU.gluQuadricOrientation(q,GLU.GLU_OUTSIDE) GLU.gluCylinder(q,.2,0.,.4,slice,2) GL.glPopMatrix() def RenderLines(x,y,z,Bonds,color): GL.glShadeModel(GL.GL_FLAT) xyz = np.array([x,y,z]) GL.glEnable(GL.GL_COLOR_MATERIAL) GL.glLineWidth(1) GL.glColor3fv(color) GL.glPushMatrix() GL.glBegin(GL.GL_LINES) for bond in Bonds: GL.glVertex3fv(xyz) GL.glVertex3fv(xyz+bond) GL.glEnd() GL.glColor4ubv([0,0,0,0]) GL.glPopMatrix() GL.glDisable(GL.GL_COLOR_MATERIAL) GL.glShadeModel(GL.GL_SMOOTH) def RenderPolyhedra(x,y,z,Faces,color): GL.glShadeModel(GL.GL_FLAT) GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glMaterialfv(GL.GL_FRONT_AND_BACK,GL.GL_DIFFUSE,color) GL.glShadeModel(GL.GL_SMOOTH) GL.glMultMatrixf(B4mat.T) for face,norm in Faces: GL.glPolygonMode(GL.GL_FRONT_AND_BACK,GL.GL_FILL) GL.glFrontFace(GL.GL_CW) GL.glNormal3fv(norm) GL.glBegin(GL.GL_TRIANGLES) for vert in face: GL.glVertex3fv(vert) GL.glEnd() GL.glPopMatrix() GL.glShadeModel(GL.GL_SMOOTH) def RenderMapPeak(x,y,z,color,den): GL.glShadeModel(GL.GL_FLAT) xyz = np.array([x,y,z]) GL.glEnable(GL.GL_COLOR_MATERIAL) GL.glLineWidth(3) GL.glColor3fv(2*color*den/255) GL.glPushMatrix() GL.glBegin(GL.GL_LINES) for vec in mapPeakVecs: GL.glVertex3fv(vec[0]+xyz) GL.glVertex3fv(vec[1]+xyz) GL.glEnd() GL.glColor4ubv([0,0,0,0]) GL.glPopMatrix() GL.glDisable(GL.GL_COLOR_MATERIAL) GL.glShadeModel(GL.GL_SMOOTH) def RenderBackbone(Backbone,BackboneColor,radius): GL.glPushMatrix() GL.glMultMatrixf(B4mat.T) GL.glEnable(GL.GL_COLOR_MATERIAL) GL.glShadeModel(GL.GL_SMOOTH) # gle.gleSetJoinStyle(TUBE_NORM_EDGE | TUBE_JN_ANGLE | TUBE_JN_CAP) # gle.glePolyCylinder(Backbone,BackboneColor,radius) GL.glPopMatrix() GL.glDisable(GL.GL_COLOR_MATERIAL) def RenderLabel(x,y,z,label,r,color,matRot): ''' color wx.Colour object ''' GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glMultMatrixf(B4mat.T) GL.glDisable(GL.GL_LIGHTING) # GL.glWindowPos3f(0,0,0) GL.glMultMatrixf(matRot) GL.glRotate(180,1,0,0) #fix to flip about x-axis text = gltext.Text(text=label,font=Font,foreground=color) text.draw_text(scale=0.025) GL.glEnable(GL.GL_LIGHTING) GL.glPopMatrix() def RenderMap(rho,rhoXYZ,indx,Rok): GL.glShadeModel(GL.GL_FLAT) cLevel = drawingData['contourLevel'] XYZ = [] RC = [] for i,xyz in enumerate(rhoXYZ): if not Rok[i]: x,y,z = xyz I,J,K = indx[i] alpha = 1.0 if cLevel < 1.: alpha = min(1.0,(abs(rho[I,J,K])/mapData['rhoMax']-cLevel)/(1.-cLevel)) if rho[I,J,K] < 0.: XYZ.append(xyz) RC.append([0.2*alpha,2*Or]) else: XYZ.append(xyz) RC.append([0.2*alpha,2*Gr]) RenderDots(XYZ,RC) GL.glShadeModel(GL.GL_SMOOTH) def Draw(caller='',Fade=[]): #useful debug? # if caller: # print caller,generalData['Name'] # end of useful debug vdWRadii = generalData['vdWRadii'] mapData = generalData['Map'] D4mapData = generalData.get('4DmapData',{}) pageName = '' page = getSelection() if page: pageName = G2frame.phaseDisplay.GetPageText(page) rhoXYZ = [] rho = [] if len(D4mapData.get('rho',[])): #preferentially select 4D map if there rho = D4mapData['rho'][:,:,:,int(G2frame.tau*10)] #pick current tau 3D slice elif len(mapData['rho']): #ordinary 3D map rho = mapData['rho'] if len(rho): VP = drawingData['viewPoint'][0]-np.array([.5,.5,.5]) contLevel = drawingData['contourLevel']*mapData['rhoMax'] if 'delt-F' in mapData['MapType'] or 'N' in mapData.get('Type',''): rho = ma.array(rho,mask=(np.abs(rho)=0,VP%steps,VP%steps-steps) Vsteps = -np.array(VP/steps,dtype='i') rho = np.roll(np.roll(np.roll(rho,Vsteps[0],axis=0),Vsteps[1],axis=1),Vsteps[2],axis=2) indx = np.array(ma.nonzero(rho)).T rhoXYZ = indx*steps+VP-incre Nc = max(len(rhoXYZ),1) rcube = 2000.*Vol/(ForthirdPI*Nc) rmax = math.exp(math.log(rcube)/3.)**2 radius = min(drawingData.get('mapSize',10.)**2,rmax) view = drawingData['viewPoint'][0] Rok = np.sum(np.inner(Amat,rhoXYZ-view).T**2,axis=1)>radius Ind = GetSelectedAtoms() VS = np.array(Page.canvas.GetSize()) aspect = float(VS[0])/float(VS[1]) cPos = drawingData['cameraPos'] Zclip = drawingData['Zclip']*cPos/200. Q = drawingData['Quaternion'] Tx,Ty,Tz = drawingData['viewPoint'][0] cx,ct,cs,ci = drawingData['atomPtrs'] bondR = drawingData['bondRadius'] G,g = G2lat.cell2Gmat(cell) GS = G GS[0][1] = GS[1][0] = math.sqrt(GS[0][0]*GS[1][1]) GS[0][2] = GS[2][0] = math.sqrt(GS[0][0]*GS[2][2]) GS[1][2] = GS[2][1] = math.sqrt(GS[1][1]*GS[2][2]) ellipseProb = G2lat.criticalEllipse(drawingData['ellipseProb']/100.) SetBackground() GL.glInitNames() GL.glPushName(0) GL.glMatrixMode(GL.GL_PROJECTION) GL.glLoadIdentity() GL.glViewport(0,0,VS[0],VS[1]) GLU.gluPerspective(20.,aspect,cPos-Zclip,cPos+Zclip) GLU.gluLookAt(0,0,cPos,0,0,0,0,1,0) SetLights() GL.glMatrixMode(GL.GL_MODELVIEW) GL.glLoadIdentity() matRot = G2mth.Q2Mat(Q) matRot = np.concatenate((np.concatenate((matRot,[[0],[0],[0]]),axis=1),[[0,0,0,1],]),axis=0) GL.glMultMatrixf(matRot.T) GL.glMultMatrixf(A4mat.T) GL.glTranslate(-Tx,-Ty,-Tz) if drawingData['showABC']: x,y,z = drawingData['viewPoint'][0] RenderUnitVectors(x,y,z) Backbones = {} BackboneColor = [] # glEnable(GL_BLEND) # glBlendFunc(GL_SRC_ALPHA,GL_ONE_MINUS_SRC_ALPHA) if not len(Fade): atmFade = np.ones(len(drawingData['Atoms'])) else: atmFade = Fade for iat,atom in enumerate(drawingData['Atoms']): x,y,z = atom[cx:cx+3] Bonds = atom[-2] Faces = atom[-1] try: atNum = generalData['AtomTypes'].index(atom[ct]) except ValueError: atNum = -1 CL = atom[cs+2] if not atmFade[iat]: continue atColor = atmFade[iat]*np.array(CL)/255. if drawingData['showRigidBodies'] and atom[ci] in rbAtmDict: bndColor = Or/255. else: bndColor = atColor if iat in Ind and G2frame.phaseDisplay.GetPageText(getSelection()) != 'Map peaks': atColor = np.array(Gr)/255. # color += [.25,] radius = 0.5 if atom[cs] != '': try: GL.glLoadName(atom[-3]) except: #problem with old files - missing code pass if 'balls' in atom[cs]: vdwScale = drawingData['vdwScale'] ballScale = drawingData['ballScale'] if atNum < 0: radius = 0.2 elif 'H' == atom[ct]: if drawingData['showHydrogen']: if 'vdW' in atom[cs] and atNum >= 0: radius = vdwScale*vdWRadii[atNum] else: radius = ballScale*drawingData['sizeH'] else: radius = 0.0 else: if 'vdW' in atom[cs]: radius = vdwScale*vdWRadii[atNum] else: radius = ballScale*BondRadii[atNum] RenderSphere(x,y,z,radius,atColor) if 'sticks' in atom[cs]: RenderBonds(x,y,z,Bonds,bondR,bndColor) elif 'ellipsoids' in atom[cs]: RenderBonds(x,y,z,Bonds,bondR,bndColor) if atom[cs+3] == 'A': Uij = atom[cs+5:cs+11] U = np.multiply(G2spc.Uij2U(Uij),GS) U = np.inner(Amat,np.inner(U,Amat).T) E,R = nl.eigh(U) R4 = np.concatenate((np.concatenate((R,[[0],[0],[0]]),axis=1),[[0,0,0,1],]),axis=0) E = np.sqrt(E) if atom[ct] == 'H' and not drawingData['showHydrogen']: pass else: RenderEllipsoid(x,y,z,ellipseProb,E,R4,atColor) else: if atom[ct] == 'H' and not drawingData['showHydrogen']: pass else: radius = ellipseProb*math.sqrt(abs(atom[cs+4])) RenderSphere(x,y,z,radius,atColor) elif 'lines' in atom[cs]: radius = 0.1 RenderLines(x,y,z,Bonds,bndColor) # RenderBonds(x,y,z,Bonds,0.05,color,6) elif atom[cs] == 'sticks': radius = 0.1 RenderBonds(x,y,z,Bonds,bondR,bndColor) elif atom[cs] == 'polyhedra': RenderPolyhedra(x,y,z,Faces,atColor) elif atom[cs] == 'backbone': if atom[ct-1].split()[0] in ['C','N']: if atom[2] not in Backbones: Backbones[atom[2]] = [] Backbones[atom[2]].append(list(np.inner(Amat,np.array([x,y,z])))) BackboneColor.append(list(atColor)) if generalData['Type'] == 'magnetic': SymOp = int(atom[cs-1].split('+')[0]) OpNum = G2spc.GetOpNum(SymOp,SGData)-1 Moment = np.array(atom[cx+3:cx+6]) color = (Wt-Bc)/255. if SpnFlp[OpNum] < 0: color = Rd/255. RenderMoment(x,y,z,Moment,color) if atom[cs+1] == 'type': RenderLabel(x,y,z,' '+atom[ct],radius,wxGreen,matRot) elif atom[cs+1] == 'name': RenderLabel(x,y,z,' '+atom[ct-1],radius,wxGreen,matRot) elif atom[cs+1] == 'number': RenderLabel(x,y,z,' '+str(iat),radius,wxGreen,matRot) elif atom[cs+1] == 'residue' and atom[ct-1] == 'CA': RenderLabel(x,y,z,' '+atom[ct-4],radius,wxGreen,matRot) elif atom[cs+1] == '1-letter' and atom[ct-1] == 'CA': RenderLabel(x,y,z,' '+atom[ct-3],radius,wxGreen,matRot) elif atom[cs+1] == 'chain' and atom[ct-1] == 'CA': RenderLabel(x,y,z,' '+atom[ct-2],radius,wxGreen,matRot) # glDisable(GL_BLEND) if len(rhoXYZ): RenderMap(rho,rhoXYZ,indx,Rok) if len(mapPeaks): XYZ = mapPeaks.T[1:4].T mapBonds = FindPeaksBonds(XYZ) for ind,[mag,x,y,z] in enumerate(mapPeaks[:,:4]): if ind in Ind and pageName == 'Map peaks': RenderMapPeak(x,y,z,Gr,1.0) else: if mag > 0.: RenderMapPeak(x,y,z,Wt,mag/peakMax) else: RenderMapPeak(x,y,z,Rd,-mag/peakMax) if showBonds: RenderLines(x,y,z,mapBonds[ind],Wt) if len(testRBObj) and pageName == 'RB Models': XYZ = G2mth.UpdateRBXYZ(Bmat,testRBObj['rbObj'],testRBObj['rbData'],testRBObj['rbType'])[0] rbBonds = FindPeaksBonds(XYZ) for ind,[x,y,z] in enumerate(XYZ): aType = testRBObj['rbAtTypes'][ind] name = ' '+aType+str(ind) color = np.array(testRBObj['AtInfo'][aType][1]) RenderSphere(x,y,z,0.2,color/255.) RenderBonds(x,y,z,rbBonds[ind],0.03,Gr) RenderLabel(x,y,z,name,0.2,wxOrange,matRot) if len(mcsaModels) > 1 and pageName == 'MC/SA': #skip the default MD entry for ind,[x,y,z] in enumerate(mcsaXYZ): aType = mcsaTypes[ind] name = ' '+aType+str(ind) color = np.array(MCSA['AtInfo'][aType][1]) RenderSphere(x,y,z,0.2,color/255.) RenderBonds(x,y,z,mcsaBonds[ind],0.03,Gr/255.) RenderLabel(x,y,z,name,0.2,wxOrange,matRot) if Backbones: for chain in Backbones: Backbone = Backbones[chain] RenderBackbone(Backbone,BackboneColor,bondR) if drawingData['unitCellBox']: RenderBox() if drawingData['Plane'][1]: H,phase,stack,phase,color = drawingData['Plane'] Planes = G2lat.PlaneIntercepts(Amat,Bmat,H,phase,stack) for plane in Planes: RenderPlane(plane,color) # print time.time()-time0 try: if Page.context: Page.canvas.SetCurrent(Page.context) except: pass Page.canvas.SwapBuffers() def OnSize(event): Draw('size') def OnFocus(event): Draw('focus') # PlotStructure execution starts here (N.B. initialization above) new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab(generalData['Name'],'ogl') if new: Page.views = False Font = Page.GetFont() Page.Choice = None if mapData.get('Flip',False): choice = [' save as/key:','jpeg','tiff','bmp','c: center on 1/2,1/2,1/2', 'u: roll up','d: roll down','l: roll left','r: roll right'] else: choice = [' save as/key:','jpeg','tiff','bmp','c: center on 1/2,1/2,1/2','n: next','p: previous'] if generalData['Modulated'] and len(drawAtoms): choice += ['+: increase tau','-: decrease tau','0: set tau = 0'] #add 'm: make modulation movie' Tx,Ty,Tz = drawingData['viewPoint'][0] rho = G2mth.getRho([Tx,Ty,Tz],mapData) G2frame.G2plotNB.status.SetStatusText('View point: %.4f, %.4f, %.4f; density: %.4f'%(Tx,Ty,Tz,rho),1) cb = wx.ComboBox(G2frame.G2plotNB.status,style=wx.CB_DROPDOWN|wx.CB_READONLY,choices=choice) cb.Bind(wx.EVT_COMBOBOX, OnKeyBox) cb.SetValue(' save as/key:') Page.canvas.Bind(wx.EVT_LEFT_DOWN, OnMouseDown) Page.canvas.Bind(wx.EVT_RIGHT_DOWN, OnMouseDown) Page.canvas.Bind(wx.EVT_MIDDLE_DOWN, OnMouseDown) Page.canvas.Bind(wx.EVT_KEY_UP, OnKey) Page.canvas.Bind(wx.EVT_KEY_DOWN,OnKeyPressed) Page.canvas.Bind(wx.EVT_MOTION, OnMouseMove) Page.canvas.Bind(wx.EVT_MOUSEWHEEL, OnMouseWheel) Page.canvas.Bind(wx.EVT_SIZE, OnSize) Page.canvas.Bind(wx.EVT_SET_FOCUS, OnFocus) Page.camera['position'] = drawingData['cameraPos'] Page.camera['viewPoint'] = np.inner(Amat,drawingData['viewPoint'][0]) Page.camera['backColor'] = backColor/255. try: Page.canvas.SetCurrent() except: pass wx.CallAfter(Draw,'main') # if firstCall: Draw('main') # draw twice the first time that graphics are displayed ################################################################################ #### Plot Rigid Body ################################################################################ def PlotRigidBody(G2frame,rbType,AtInfo,rbData,defaults): '''RB plotting package. Can show rigid body structures as balls & sticks ''' def FindBonds(XYZ): rbTypes = rbData['rbTypes'] Radii = [] for Atype in rbTypes: Radii.append(AtInfo[Atype][0]) if Atype == 'H': Radii[-1] = 0.5 Radii = np.array(Radii) Bonds = [[] for i in range(len(Radii))] for i,xyz in enumerate(XYZ): Dx = XYZ-xyz dist = np.sqrt(np.sum(Dx**2,axis=1)) sumR = Radii[i]+Radii IndB = ma.nonzero(ma.masked_greater(dist-0.85*sumR,0.)) for j in IndB[0]: Bonds[i].append(Dx[j]*Radii[i]/sumR[j]) Bonds[j].append(-Dx[j]*Radii[j]/sumR[j]) return Bonds Mydir = G2frame.dirname Rd = np.array([255,0,0]) Gr = np.array([0,255,0]) Bl = np.array([0,0,255]) uBox = np.array([[0,0,0],[1,0,0],[0,1,0],[0,0,1]]) uEdges = np.array([[uBox[0],uBox[1]],[uBox[0],uBox[2]],[uBox[0],uBox[3]]]) uColors = [Rd,Gr,Bl] if rbType == 'Vector': atNames = [str(i)+':'+Ty for i,Ty in enumerate(rbData['rbTypes'])] XYZ = np.array([[0.,0.,0.] for Ty in rbData['rbTypes']]) for imag,mag in enumerate(rbData['VectMag']): XYZ += mag*rbData['rbVect'][imag] Bonds = FindBonds(XYZ) elif rbType == 'Residue': # atNames = [str(i)+':'+Ty for i,Ty in enumerate(rbData['atNames'])] atNames = rbData['atNames'] XYZ = np.copy(rbData['rbXYZ']) #don't mess with original! Seq = rbData['rbSeq'] for ia,ib,ang,mv in Seq: va = XYZ[ia]-XYZ[ib] Q = G2mth.AVdeg2Q(ang,va) for im in mv: vb = XYZ[im]-XYZ[ib] vb = G2mth.prodQVQ(Q,vb) XYZ[im] = XYZ[ib]+vb Bonds = FindBonds(XYZ) elif rbType == 'Z-matrix': pass # def SetRBOrigin(): # page = getSelection() # if page: # if G2frame.GetPageText(page) == 'Rigid bodies': # G2frame.MapPeaksTable.SetData(mapPeaks) # panel = G2frame.GetPage(page).GetChildren() # names = [child.GetName() for child in panel] # panel[names.index('grid window')].Refresh() def OnMouseDown(event): xy = event.GetPosition() defaults['oldxy'] = list(xy) def OnMouseMove(event): newxy = event.GetPosition() if event.Dragging(): if event.LeftIsDown(): SetRotation(newxy) Q = defaults['Quaternion'] G2frame.G2plotNB.status.SetStatusText('New quaternion: %.2f+, %.2fi+ ,%.2fj+, %.2fk'%(Q[0],Q[1],Q[2],Q[3]),1) # elif event.RightIsDown(): # SetRBOrigin(newxy) elif event.MiddleIsDown(): SetRotationZ(newxy) Q = defaults['Quaternion'] G2frame.G2plotNB.status.SetStatusText('New quaternion: %.2f+, %.2fi+ ,%.2fj+, %.2fk'%(Q[0],Q[1],Q[2],Q[3]),1) Draw('move') def OnMouseWheel(event): defaults['cameraPos'] += event.GetWheelRotation()/24 defaults['cameraPos'] = max(10,min(500,defaults['cameraPos'])) G2frame.G2plotNB.status.SetStatusText('New camera distance: %.2f'%(defaults['cameraPos']),1) Draw('wheel') def SetBackground(): R,G,B,A = Page.camera['backColor'] GL.glClearColor(R,G,B,A) GL.glClear(GL.GL_COLOR_BUFFER_BIT | GL.GL_DEPTH_BUFFER_BIT) def SetLights(): GL.glEnable(GL.GL_DEPTH_TEST) GL.glShadeModel(GL.GL_FLAT) GL.glEnable(GL.GL_LIGHTING) GL.glEnable(GL.GL_LIGHT0) GL.glLightModeli(GL.GL_LIGHT_MODEL_TWO_SIDE,0) GL.glLightfv(GL.GL_LIGHT0,GL.GL_AMBIENT,[1,1,1,.8]) GL.glLightfv(GL.GL_LIGHT0,GL.GL_DIFFUSE,[1,1,1,1]) def SetRotation(newxy): #first get rotation vector in screen coords. & angle increment oldxy = defaults['oldxy'] if not len(oldxy): oldxy = list(newxy) dxy = newxy-oldxy defaults['oldxy'] = list(newxy) V = np.array([dxy[1],dxy[0],0.]) A = 0.25*np.sqrt(dxy[0]**2+dxy[1]**2) # next transform vector back to xtal coordinates via inverse quaternion # & make new quaternion Q = defaults['Quaternion'] V = G2mth.prodQVQ(G2mth.invQ(Q),V) DQ = G2mth.AVdeg2Q(A,V) Q = G2mth.prodQQ(Q,DQ) defaults['Quaternion'] = Q # finally get new view vector - last row of rotation matrix VD = G2mth.Q2Mat(Q)[2] VD /= np.sqrt(np.sum(VD**2)) defaults['viewDir'] = VD def SetRotationZ(newxy): #first get rotation vector (= view vector) in screen coords. & angle increment View = GL.glGetIntegerv(GL.GL_VIEWPORT) cent = [View[2]/2,View[3]/2] oldxy = defaults['oldxy'] if not len(oldxy): oldxy = list(newxy) dxy = newxy-oldxy defaults['oldxy'] = list(newxy) V = defaults['viewDir'] A = [0,0] A[0] = dxy[1]*.25 A[1] = dxy[0]*.25 if newxy[0] > cent[0]: A[0] *= -1 if newxy[1] < cent[1]: A[1] *= -1 # next transform vector back to xtal coordinates & make new quaternion Q = defaults['Quaternion'] Qx = G2mth.AVdeg2Q(A[0],V) Qy = G2mth.AVdeg2Q(A[1],V) Q = G2mth.prodQQ(Q,Qx) Q = G2mth.prodQQ(Q,Qy) defaults['Quaternion'] = Q def RenderUnitVectors(x,y,z): GL.glEnable(GL.GL_COLOR_MATERIAL) GL.glLineWidth(1) GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glBegin(GL.GL_LINES) for line,color in zip(uEdges,uColors): GL.glColor3ubv(color) GL.glVertex3fv(-line[1]) GL.glVertex3fv(line[1]) GL.glEnd() GL.glPopMatrix() GL.glColor4ubv([0,0,0,0]) GL.glDisable(GL.GL_COLOR_MATERIAL) def RenderSphere(x,y,z,radius,color): GL.glMaterialfv(GL.GL_FRONT_AND_BACK,GL.GL_DIFFUSE,color) GL.glPushMatrix() GL.glTranslate(x,y,z) q = GLU.gluNewQuadric() GLU.gluSphere(q,radius,20,10) GL.glPopMatrix() def RenderBonds(x,y,z,Bonds,radius,color,slice=20): GL.glMaterialfv(GL.GL_FRONT_AND_BACK,GL.GL_DIFFUSE,color) GL.glPushMatrix() GL.glTranslate(x,y,z) for Dx in Bonds: GL.glPushMatrix() Z = np.sqrt(np.sum(Dx**2)) if Z: azm = atan2d(-Dx[1],-Dx[0]) phi = acosd(Dx[2]/Z) GL.glRotate(-azm,0,0,1) GL.glRotate(phi,1,0,0) q = GLU.gluNewQuadric() GLU.gluCylinder(q,radius,radius,Z,slice,2) GL.glPopMatrix() GL.glPopMatrix() def RenderLabel(x,y,z,label,matRot): GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glDisable(GL.GL_LIGHTING) GL.glRasterPos3f(0,0,0) GL.glMultMatrixf(matRot) GL.glRotate(180,1,0,0) #fix to flip about x-axis text = gltext.TextElement(text=label,font=Font,foreground=wx.WHITE) text.draw_text(scale=0.025) GL.glEnable(GL.GL_LIGHTING) GL.glPopMatrix() def Draw(caller=''): #useful debug? # if caller: # print caller # end of useful debug cPos = defaults['cameraPos'] VS = np.array(Page.canvas.GetSize()) aspect = float(VS[0])/float(VS[1]) Q = defaults['Quaternion'] SetBackground() GL.glInitNames() GL.glPushName(0) GL.glMatrixMode(GL.GL_PROJECTION) GL.glLoadIdentity() GL.glViewport(0,0,VS[0],VS[1]) GLU.gluPerspective(20.,aspect,1.,500.) GLU.gluLookAt(0,0,cPos,0,0,0,0,1,0) SetLights() GL.glMatrixMode(GL.GL_MODELVIEW) GL.glLoadIdentity() matRot = G2mth.Q2Mat(Q) matRot = np.concatenate((np.concatenate((matRot,[[0],[0],[0]]),axis=1),[[0,0,0,1],]),axis=0) GL.glMultMatrixf(matRot.T) RenderUnitVectors(0.,0.,0.) radius = 0.2 for iat,atom in enumerate(XYZ): x,y,z = atom CL = AtInfo[rbData['rbTypes'][iat]][1] color = np.array(CL)/255. RenderSphere(x,y,z,radius,color) RenderBonds(x,y,z,Bonds[iat],0.05,color) RenderLabel(x,y,z,' '+atNames[iat],matRot) try: if Page.context: Page.canvas.SetCurrent(Page.context) except: pass Page.canvas.SwapBuffers() def OnSize(event): Draw('size') def OnKeyBox(event): mode = cb.GetValue() if mode in ['jpeg','bmp','tiff',]: try: import Image as Im except ImportError: try: from PIL import Image as Im except ImportError: print ("PIL/pillow Image module not present. Cannot save images without this") raise Exception("PIL/pillow Image module not found") Fname = os.path.join(Mydir,Page.name+'.'+mode) print (Fname+' saved') size = Page.canvas.GetSize() GL.glPixelStorei(GL.GL_UNPACK_ALIGNMENT, 1) if mode in ['jpeg',]: Pix = GL.glReadPixels(0,0,size[0],size[1],GL.GL_RGBA, GL.GL_UNSIGNED_BYTE) im = Im.new("RGBA", (size[0],size[1])) else: Pix = GL.glReadPixels(0,0,size[0],size[1],GL.GL_RGB, GL.GL_UNSIGNED_BYTE) im = Im.new("RGB", (size[0],size[1])) try: im.frombytes(Pix) except AttributeError: im.fromstring(Pix) im = im.transpose(Im.FLIP_TOP_BOTTOM) im.save(Fname,mode) cb.SetValue(' save as/key:') G2frame.G2plotNB.status.SetStatusText('Drawing saved to: '+Fname,1) # PlotStructure execution starts here (N.B. initialization above) new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('Rigid body','ogl') if new: Page.views = False Page.name = rbData['RBname'] Page.Choice = None choice = [' save as:','jpeg','tiff','bmp',] cb = wx.ComboBox(G2frame.G2plotNB.status,style=wx.CB_DROPDOWN|wx.CB_READONLY,choices=choice) cb.Bind(wx.EVT_COMBOBOX, OnKeyBox) cb.SetValue(' save as/key:') Font = Page.GetFont() Page.canvas.Bind(wx.EVT_MOUSEWHEEL, OnMouseWheel) Page.canvas.Bind(wx.EVT_LEFT_DOWN, OnMouseDown) Page.canvas.Bind(wx.EVT_RIGHT_DOWN, OnMouseDown) Page.canvas.Bind(wx.EVT_MIDDLE_DOWN, OnMouseDown) Page.canvas.Bind(wx.EVT_MOTION, OnMouseMove) Page.canvas.Bind(wx.EVT_SIZE, OnSize) Page.camera['position'] = defaults['cameraPos'] Page.camera['backColor'] = np.array([0,0,0,0]) Page.canvas.SetCurrent() Draw('main') Draw('main') #to fill both buffers so save works ################################################################################ #### Plot Layers ################################################################################ def PlotLayers(G2frame,Layers,laySeq,defaults): '''Layer plotting package. Can show layer structures as balls & sticks ''' global AtNames,AtTypes,XYZ,Bonds,Faces def FindBonds(atTypes,XYZ): Radii = [] for Atype in atTypes: Radii.append(AtInfo[Atype[0]]['Drad']) if Atype[0] == 'H': Radii[-1] = 0.5 Radii = np.array(Radii) Bonds = [[] for i in range(len(Radii))] for i,xyz in enumerate(XYZ): Dx = np.inner(Amat,(XYZ-xyz)).T dist = np.sqrt(np.sum(Dx**2,axis=1)) sumR = Radii[i]+Radii IndB = ma.nonzero(ma.masked_greater(dist-0.85*sumR,0.)) for j in IndB[0]: Bonds[i].append(Dx[j]*Radii[i]/sumR[j]) Bonds[j].append(-Dx[j]*Radii[j]/sumR[j]) return Bonds def FindFaces(Bonds): Faces = [] for bonds in Bonds: faces = [] if len(bonds) > 2: FaceGen = G2lat.uniqueCombinations(bonds,3) #N.B. this is a generator for face in FaceGen: vol = nl.det(face) if abs(vol) > .5 or len(bonds) == 3: if vol < 0.: face = [face[0],face[2],face[1]] face = 1.8*np.array(face) if not np.array([np.array(nl.det(face-bond))+0.0001 < 0 for bond in bonds]).any(): norm = np.cross(face[1]-face[0],face[2]-face[0]) norm /= np.sqrt(np.sum(norm**2)) faces.append([face,norm]) Faces.append(faces) return Faces def getAtoms(): global AtNames,AtTypes,XYZ,Bonds,Faces AtNames = [] AtTypes = [] newXYZ = np.zeros((0,3)) TX = np.zeros(3) for il in range(len(laySeq)): layer = laySeq[il] if Layers['Layers'][layer]['SameAs']: layer = Names.index(Layers['Layers'][layer]['SameAs']) atNames = [atom[0] for atom in Layers['Layers'][layer]['Atoms']] atTypes = [[atom[1],il] for atom in Layers['Layers'][layer]['Atoms']] XYZ = np.array([atom[2:5] for atom in Layers['Layers'][layer]['Atoms']]) if '-1' in Layers['Layers'][layer]['Symm']: atNames += atNames atTypes += atTypes XYZ = np.concatenate((XYZ,-XYZ)) if il: TX += np.array(Trans[laySeq[il-1]][laySeq[il]][1:4]) # TX[0] %= 1. # TX[1] %= 1. XYZ += TX AtNames += atNames AtTypes += atTypes newXYZ = np.concatenate((newXYZ,XYZ)) XYZ = newXYZ na = max(int(8./cell[0]),1) nb = max(int(8./cell[1]),1) indA = range(-na,na) indB = range(-nb,nb) Units = np.array([[h,k,0] for h in indA for k in indB]) newXYZ = np.zeros((0,3)) for unit in Units: newXYZ = np.concatenate((newXYZ,unit+XYZ)) if len(Units): AtNames *= len(Units) AtTypes *= len(Units) XYZ = newXYZ # GSASIIpath.IPyBreak() Bonds = FindBonds(AtTypes,XYZ) Faces = FindFaces(Bonds) def OnKeyBox(event): mode = cb.GetValue() if mode in ['jpeg','bmp','tiff',]: try: import Image as Im except ImportError: try: from PIL import Image as Im except ImportError: print ("PIL/pillow Image module not present. Cannot save images without this") raise Exception("PIL/pillow Image module not found") projFile = G2frame.GSASprojectfile Fname = (os.path.splitext(projFile)[0]+'.'+mode).replace('*','+') size = Page.canvas.GetSize() GL.glPixelStorei(GL.GL_UNPACK_ALIGNMENT, 1) if mode in ['jpeg',]: Pix = GL.glReadPixels(0,0,size[0],size[1],GL.GL_RGBA, GL.GL_UNSIGNED_BYTE) im = Im.new("RGBA", (size[0],size[1])) else: Pix = GL.glReadPixels(0,0,size[0],size[1],GL.GL_RGB, GL.GL_UNSIGNED_BYTE) im = Im.new("RGB", (size[0],size[1])) try: im.frombytes(Pix) except AttributeError: im.fromstring(Pix) im = im.transpose(Im.FLIP_TOP_BOTTOM) im.save(Fname,mode) print (' Drawing saved to: '+Fname) elif mode[0] in ['L','F','P']: event.key = cb.GetValue()[0] wx.CallAfter(OnPlotKeyPress,event) Page.canvas.SetFocus() # redirect the Focus from the button back to the plot def OnPlotKeyPress(event): global AtNames,AtTypes,XYZ,Bonds try: key = event.GetKeyCode() if key > 255: key = 0 keyCode = chr(key) except AttributeError: #if from OnKeyBox above keyCode = str(event.key).upper() dx = 0. dy = 0. dz = 0. if keyCode == 'L': Page.labels = not Page.labels Draw('labels') return elif keyCode =='F' and len(laySeq) == 2: Page.fade = not Page.fade elif keyCode == 'P': Page.poly = not Page.poly if len(laySeq) != 2: return Trans = Layers['Transitions'] Yi,Xi = laySeq dxyz = 0.01 if keyCode == 'X': dx = dxyz if event.shiftDown: dx *= -1. Trans[Yi][Xi][1] += dx SetTransText(Yi,Xi,Trans[Yi][Xi],1) elif keyCode == 'Y': dy = dxyz if event.shiftDown: dy *= -1. Trans[Yi][Xi][2] += dy SetTransText(Yi,Xi,Trans[Yi][Xi],2) elif keyCode == 'Z': dz = dxyz if event.shiftDown: dz *= -1. Trans[Yi][Xi][3] += dz SetTransText(Yi,Xi,Trans[Yi][Xi],3) getAtoms() Draw('shift') def SetTransText(Yi,Xi,XYZ,id): page = G2frame.phaseDisplay.GetSelection() if page: if G2frame.phaseDisplay.GetPageText(page) == 'Layers': G2frame.phaseDisplay.GetPage(page).transGrids[Yi].Refresh() def OnMouseDown(event): xy = event.GetPosition() defaults['oldxy'] = list(xy) def OnMouseMove(event): newxy = event.GetPosition() if event.Dragging(): if event.LeftIsDown(): SetRotation(newxy) elif event.RightIsDown(): SetTranslation(newxy) Tx,Ty,Tz = defaults['viewPoint'][0] elif event.MiddleIsDown(): SetRotationZ(newxy) Draw('move') def OnMouseWheel(event): defaults['cameraPos'] += event.GetWheelRotation()/24 defaults['cameraPos'] = max(10,min(500,defaults['cameraPos'])) Draw('wheel') def SetBackground(): R,G,B,A = Page.camera['backColor'] GL.glClearColor(R,G,B,A) GL.glClear(GL.GL_COLOR_BUFFER_BIT | GL.GL_DEPTH_BUFFER_BIT) def SetLights(): GL.glEnable(GL.GL_DEPTH_TEST) GL.glShadeModel(GL.GL_FLAT) GL.glEnable(GL.GL_LIGHTING) GL.glEnable(GL.GL_LIGHT0) GL.glLightModeli(GL.GL_LIGHT_MODEL_TWO_SIDE,0) GL.glLightfv(GL.GL_LIGHT0,GL.GL_AMBIENT,[1,1,1,.8]) GL.glLightfv(GL.GL_LIGHT0,GL.GL_DIFFUSE,[1,1,1,1]) def SetTranslation(newxy): #first get translation vector in screen coords. oldxy = defaults['oldxy'] if not len(oldxy): oldxy = list(newxy) dxy = newxy-oldxy defaults['oldxy'] = list(newxy) V = np.array([-dxy[0],dxy[1],0.]) #then transform to rotated crystal coordinates & apply to view point Q = defaults['Quaternion'] V = np.inner(Bmat,G2mth.prodQVQ(G2mth.invQ(Q),V)) Tx,Ty,Tz = defaults['viewPoint'][0] delt = 0.01 Tx += V[0]*delt Ty += V[1]*delt Tz += V[2]*delt defaults['viewPoint'][0] = np.array([Tx,Ty,Tz]) def SetRotation(newxy): #first get rotation vector in screen coords. & angle increment oldxy = defaults['oldxy'] if not len(oldxy): oldxy = list(newxy) dxy = newxy-oldxy defaults['oldxy'] = list(newxy) V = np.array([dxy[1],dxy[0],0.]) A = 0.25*np.sqrt(dxy[0]**2+dxy[1]**2) # next transform vector back to xtal coordinates via inverse quaternion # & make new quaternion Q = defaults['Quaternion'] V = G2mth.prodQVQ(G2mth.invQ(Q),V) DQ = G2mth.AVdeg2Q(A,V) Q = G2mth.prodQQ(Q,DQ) defaults['Quaternion'] = Q # finally get new view vector - last row of rotation matrix VD = G2mth.Q2Mat(Q)[2] VD /= np.sqrt(np.sum(VD**2)) defaults['viewDir'] = VD def SetRotationZ(newxy): #first get rotation vector (= view vector) in screen coords. & angle increment View = GL.glGetIntegerv(GL.GL_VIEWPORT) cent = [View[2]/2,View[3]/2] oldxy = defaults['oldxy'] if not len(oldxy): oldxy = list(newxy) dxy = newxy-oldxy defaults['oldxy'] = list(newxy) V = defaults['viewDir'] A = [0,0] A[0] = dxy[1]*.25 A[1] = dxy[0]*.25 if newxy[0] > cent[0]: A[0] *= -1 if newxy[1] < cent[1]: A[1] *= -1 # next transform vector back to xtal coordinates & make new quaternion Q = defaults['Quaternion'] Qx = G2mth.AVdeg2Q(A[0],V) Qy = G2mth.AVdeg2Q(A[1],V) Q = G2mth.prodQQ(Q,Qx) Q = G2mth.prodQQ(Q,Qy) defaults['Quaternion'] = Q def RenderUnitVectors(x,y,z): GL.glEnable(GL.GL_COLOR_MATERIAL) GL.glLineWidth(1) GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glBegin(GL.GL_LINES) for line,color in zip(uEdges,uColors): GL.glColor3ubv(color) GL.glVertex3fv(line[0]) GL.glVertex3fv(line[1]) GL.glEnd() GL.glPopMatrix() GL.glColor4ubv([0,0,0,0]) GL.glDisable(GL.GL_COLOR_MATERIAL) def RenderSphere(x,y,z,radius,color): GL.glMaterialfv(GL.GL_FRONT_AND_BACK,GL.GL_DIFFUSE,color) GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glMultMatrixf(B4mat.T) q = GLU.gluNewQuadric() GLU.gluSphere(q,radius,20,10) GL.glPopMatrix() def RenderBonds(x,y,z,Bonds,radius,color,slice=20): GL.glMaterialfv(GL.GL_FRONT_AND_BACK,GL.GL_DIFFUSE,color) GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glMultMatrixf(B4mat.T) for Dx in Bonds: GL.glPushMatrix() Z = np.sqrt(np.sum(Dx**2)) if Z: azm = atan2d(-Dx[1],-Dx[0]) phi = acosd(Dx[2]/Z) GL.glRotate(-azm,0,0,1) GL.glRotate(phi,1,0,0) q = GLU.gluNewQuadric() GLU.gluCylinder(q,radius,radius,Z,slice,2) GL.glPopMatrix() GL.glPopMatrix() def RenderPolyhedra(x,y,z,Faces,color): GL.glShadeModel(GL.GL_FLAT) GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glMaterialfv(GL.GL_FRONT_AND_BACK,GL.GL_DIFFUSE,color) GL.glShadeModel(GL.GL_SMOOTH) GL.glMultMatrixf(B4mat.T) for face,norm in Faces: GL.glPolygonMode(GL.GL_FRONT_AND_BACK,GL.GL_FILL) GL.glFrontFace(GL.GL_CW) GL.glNormal3fv(norm) GL.glBegin(GL.GL_TRIANGLES) for vert in face: GL.glVertex3fv(vert) GL.glEnd() GL.glPopMatrix() GL.glShadeModel(GL.GL_SMOOTH) def RenderLabel(x,y,z,label,matRot): GL.glPushMatrix() GL.glTranslate(x,y,z) GL.glMultMatrixf(B4mat.T) GL.glDisable(GL.GL_LIGHTING) GL.glRasterPos3f(0,0,0) GL.glMultMatrixf(matRot) GL.glRotate(180,1,0,0) #fix to flip about x-axis text = gltext.TextElement(text=label,font=Font,foreground=wx.WHITE) text.draw_text(scale=0.025) GL.glEnable(GL.GL_LIGHTING) GL.glPopMatrix() def Draw(caller=''): #useful debug? # if caller: # print caller # end of useful debug global AtNames,AtTypes,XYZ,Bonds,Faces cPos = defaults['cameraPos'] VS = np.array(Page.canvas.GetSize()) aspect = float(VS[0])/float(VS[1]) Tx,Ty,Tz = defaults['viewPoint'][0] Q = defaults['Quaternion'] SetBackground() GL.glInitNames() GL.glPushName(0) GL.glMatrixMode(GL.GL_PROJECTION) GL.glLoadIdentity() GL.glViewport(0,0,VS[0],VS[1]) GLU.gluPerspective(20.,aspect,1.,500.) GLU.gluLookAt(0,0,cPos,0,0,0,0,1,0) SetLights() GL.glMatrixMode(GL.GL_MODELVIEW) GL.glLoadIdentity() matRot = G2mth.Q2Mat(Q) matRot = np.concatenate((np.concatenate((matRot,[[0],[0],[0]]),axis=1),[[0,0,0,1],]),axis=0) GL.glMultMatrixf(matRot.T) GL.glMultMatrixf(A4mat.T) GL.glTranslate(-Tx,-Ty,-Tz) RenderUnitVectors(0.,0.,0.) bondRad = 0.1 atomRad = 0.5 if Page.labels: bondRad = 0.05 atomRad = 0.2 GL.glShadeModel(GL.GL_SMOOTH) for iat,atom in enumerate(XYZ): x,y,z = atom CL = AtInfo[AtTypes[iat][0]]['Color'] color = np.array(CL)/255. if len(laySeq) == 2 and AtTypes[iat][1] and Page.fade: color *= .5 if Page.poly: if len(Faces[iat])>16: #allows tetrahedra but not stray triangles RenderPolyhedra(x,y,z,Faces[iat],color) else: RenderSphere(x,y,z,atomRad,color) RenderBonds(x,y,z,Bonds[iat],bondRad,color) if Page.labels: RenderLabel(x,y,z,' '+AtNames[iat],matRot) try: if Page.context: Page.canvas.SetCurrent(Page.context) except: pass Page.canvas.SwapBuffers() def OnSize(event): Draw('size') # PlotLayers execution starts here cell = Layers['Cell'][1:7] Amat,Bmat = G2lat.cell2AB(cell) #Amat - crystal to cartesian, Bmat - inverse A4mat = np.concatenate((np.concatenate((Amat,[[0],[0],[0]]),axis=1),[[0,0,0,1],]),axis=0) B4mat = np.concatenate((np.concatenate((Bmat,[[0],[0],[0]]),axis=1),[[0,0,0,1],]),axis=0) Trans = Layers['Transitions'] Wt = np.array([255,255,255]) Rd = np.array([255,0,0]) Gr = np.array([0,255,0]) Bl = np.array([0,0,255]) Bc = np.array([0,0,0]) uBox = np.array([[0,0,0],[1,0,0],[1,1,0],[0,1,0],[0,0,1],[1,0,1],[1,1,1],[0,1,1]]) uEdges = np.array([ [uBox[0],uBox[1]],[uBox[0],uBox[3]],[uBox[0],uBox[4]],[uBox[1],uBox[2]], [uBox[2],uBox[3]],[uBox[1],uBox[5]],[uBox[2],uBox[6]],[uBox[3],uBox[7]], [uBox[4],uBox[5]],[uBox[5],uBox[6]],[uBox[6],uBox[7]],[uBox[7],uBox[4]]]) uColors = [Rd,Gr,Bl,Wt-Bc, Wt-Bc,Wt-Bc,Wt-Bc,Wt-Bc, Wt-Bc,Wt-Bc,Wt-Bc,Wt-Bc] uEdges[2][1][2] = len(laySeq) AtInfo = Layers['AtInfo'] Names = [layer['Name'] for layer in Layers['Layers']] getAtoms() new,plotNum,Page,Plot,lim = G2frame.G2plotNB.FindPlotTab('Layer','ogl') if new: Page.views = False Page.labels = False Page.fade = False Page.poly = False choice = [' save as:','jpeg','tiff','bmp','use keys for:','L - toggle labels', 'F - fade 2nd layer','P - polyhedra'] if len(laySeq) == 2: choice += ['F - toggle fade','X/shift-X move Dx','Y/shift-Y move Dy','Z/shift-Z move Dz'] Page.keyPress = OnPlotKeyPress Font = Page.GetFont() cb = wx.ComboBox(G2frame.G2plotNB.status,style=wx.CB_DROPDOWN|wx.CB_READONLY,choices=choice) cb.Bind(wx.EVT_COMBOBOX, OnKeyBox) text = [str(Layers['Layers'][seq]['Name']) for seq in laySeq] G2frame.G2plotNB.status.SetStatusText(' Layers plotted: '+str(text).replace("'",'')[1:-1],1) Page.canvas.Bind(wx.EVT_MOUSEWHEEL, OnMouseWheel) Page.canvas.Bind(wx.EVT_LEFT_DOWN, OnMouseDown) Page.canvas.Bind(wx.EVT_RIGHT_DOWN, OnMouseDown) Page.canvas.Bind(wx.EVT_MIDDLE_DOWN, OnMouseDown) Page.canvas.Bind(wx.EVT_MOTION, OnMouseMove) Page.canvas.Bind(wx.EVT_KEY_UP, OnPlotKeyPress) Page.canvas.Bind(wx.EVT_SIZE, OnSize) Page.camera['position'] = defaults['cameraPos'] Page.camera['backColor'] = np.array([0,0,0,0]) Page.context = wx.glcanvas.GLContext(Page.canvas) Page.canvas.SetCurrent(Page.context) wx.CallAfter(Draw,'main')